Migrate to Go 1.18 (#45)

* Migrate to Go 1.18 and add linters

.github/workflows/ci.yml

@@ -9,13 +9,25 @@ env:
   IMAGE_NAME: ${{ github.repository }}
 
 jobs:
+  lint:
+    name: Lint
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/setup-go@v3
+        with: { go-version: '1.18' }
+      - uses: actions/checkout@v2
+      - run: |
+          mkdir -p ui/dist/img
+          touch ui/dist/index.html ui/dist/favicon.ico ui/dist/manifest.json ui/dist/img/fake.png
+      - uses: golangci/golangci-lint-action@v3
+
   test:
     name: Test
     runs-on: ubuntu-latest
     env: { GIN_MODE: test }
     steps:
-      - uses: actions/setup-go@v2
-        with: { go-version: '1.17' }
+      - uses: actions/setup-go@v3
+        with: { go-version: '1.18' }
       - uses: actions/setup-node@v2
         with: { node-version: '14' }
       - uses: actions/checkout@v2
@@ -51,8 +63,8 @@ jobs:
     runs-on: ubuntu-latest
     needs: [ build-npm, test ]
     steps:
-      - uses: actions/setup-go@v2
-        with: { go-version: '1.17' }
+      - uses: actions/setup-go@v3
+        with: { go-version: '1.18' }
       - uses: actions/checkout@v2
       - uses: actions/download-artifact@v2
         with: { name: ui, path: ui/dist }

.golangci.yml

@@ -0,0 +1,116 @@
+run:
+  go: "1.18"
+  skip-dirs:
+    - generated
+linters:
+  enable:
+    - asciicheck
+    - containedctx
+    - decorder
+    - depguard
+    - dogsled
+    - durationcheck
+    - errchkjson
+    - errname
+    - errorlint
+    - exhaustive
+    - exportloopref
+    - forbidigo
+    - forcetypeassert
+    - gci
+    - gocritic
+    - godot
+    - gofmt
+    - gofumpt
+    - goheader
+    - goimports
+    - gomodguard
+    - goprintffuncname
+    - gosec
+    - grouper
+    - ifshort
+    - importas
+    - ireturn
+    - misspell
+    - nakedret
+    - nilnil
+    - nlreturn
+    - nolintlint
+    - paralleltest
+    - predeclared
+    - promlinter
+    - revive
+    - tenv
+    - thelper
+    - unconvert
+    - whitespace
+
+  disable:
+    # go 1.18
+    - bodyclose
+    - contextcheck
+    - gosimple
+    - nilerr
+    - noctx
+    - rowserrcheck
+    - sqlclosecheck
+    - staticcheck
+    - stylecheck
+    - tparallel
+    - unparam
+    - unused
+    - wastedassign
+
+    # complexity
+    - cyclop
+    - gocognit
+    - gocyclo
+    - maintidx
+    - nestif
+
+    # disable
+    - dupl
+    - exhaustivestruct
+    - funlen
+    - gochecknoglobals
+    - gochecknoinits
+    - goconst
+    - godox
+    - goerr113
+    - gomnd
+    - gomoddirectives
+    - lll
+    - makezero
+    - prealloc
+    - structcheck
+    - tagliatelle
+    - testpackage
+    - varnamelen
+    - wrapcheck
+    - wsl
+linters-settings:
+  gci:
+    sections:
+      - standard
+      - default
+      - prefix(github.com/SecurityBrewery/catalyst)
+  ireturn:
+    allow:
+      - error
+      - context.Context
+      - go-driver.Cursor
+      - go-driver.Collection
+      - go-driver.Database
+      - chi.Router
+issues:
+  exclude-rules:
+    - path: caql
+      text: "var-naming: don't use underscores"
+    - path: database/user.go
+      text: "G404"
+      linters: [ gosec ]
+    - path: caql/function.go
+      text: "G404"
+      linters: [ gosec ]
+    - path: caql
+      linters: [ forcetypeassert ]

auth.go

@@ -2,15 +2,16 @@ package catalyst
 
 import (
 	"context"
+	"crypto/rand"
 	"crypto/sha256"
 	"encoding/base64"
 	"errors"
 	"fmt"
-	"math/rand"
 	"net/http"
 	"strings"
 
 	"github.com/coreos/go-oidc/v3/oidc"
+	"golang.org/x/exp/slices"
 	"golang.org/x/oauth2"
 
 	"github.com/SecurityBrewery/catalyst/database"
@@ -43,6 +44,7 @@ func (c *AuthConfig) Verifier(ctx context.Context) (*oidc.IDTokenVerifier, error
 			return nil, err
 		}
 	}
+
 	return c.provider.Verifier(&oidc.Config{SkipClientIDCheck: true}), nil
 }
 
@@ -81,12 +83,14 @@ func bearerAuth(db *database.Database, authHeader string, iss string, config *Au
 		return http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
 			if !strings.HasPrefix(authHeader, "Bearer ") {
 				api.JSONErrorStatus(w, http.StatusUnauthorized, errors.New("no bearer token"))
+
 				return
 			}
 
 			claims, apiError := verifyClaims(r, config, authHeader[7:])
 			if apiError != nil {
 				api.JSONErrorStatus(w, apiError.Status, apiError.Internal)
+
 				return
 			}
 
@@ -100,6 +104,7 @@ func bearerAuth(db *database.Database, authHeader string, iss string, config *Au
 			r, err := setContextClaims(r, db, claims, config)
 			if err != nil {
 				api.JSONErrorStatus(w, http.StatusInternalServerError, fmt.Errorf("could not load user: %w", err))
+
 				return
 			}
 
@@ -116,6 +121,7 @@ func keyAuth(db *database.Database, keyHeader string) func(next http.Handler) ht
 			key, err := db.UserByHash(r.Context(), h)
 			if err != nil {
 				api.JSONErrorStatus(w, http.StatusInternalServerError, fmt.Errorf("could not verify private token: %w", err))
+
 				return
 			}
 
@@ -132,16 +138,19 @@ func sessionAuth(db *database.Database, config *AuthConfig) func(next http.Handl
 			claims, noCookie, err := claimsCookie(r)
 			if err != nil {
 				api.JSONError(w, err)
+
 				return
 			}
 			if noCookie {
 				redirectToLogin(w, r, config.OAuth2)
+
 				return
 			}
 
 			r, err = setContextClaims(r, db, claims, config)
 			if err != nil {
 				api.JSONErrorStatus(w, http.StatusInternalServerError, fmt.Errorf("could not load user: %w", err))
+
 				return
 			}
 
@@ -150,7 +159,7 @@ func sessionAuth(db *database.Database, config *AuthConfig) func(next http.Handl
 	}
 }
 
-func setContextClaims(r *http.Request, db *database.Database, claims map[string]interface{}, config *AuthConfig) (*http.Request, error) {
+func setContextClaims(r *http.Request, db *database.Database, claims map[string]any, config *AuthConfig) (*http.Request, error) {
 	newUser, newSetting, err := mapUserAndSettings(claims, config)
 	if err != nil {
 		return nil, err
@@ -182,7 +191,7 @@ func setContextUser(r *http.Request, user *model.UserResponse, hooks *hooks.Hook
 	return busdb.SetContext(r, user)
 }
 
-func mapUserAndSettings(claims map[string]interface{}, config *AuthConfig) (*model.UserForm, *model.UserData, error) {
+func mapUserAndSettings(claims map[string]any, config *AuthConfig) (*model.UserForm, *model.UserData, error) {
 	// handle Bearer tokens
 	// if typ, ok := claims["typ"]; ok && typ == "Bearer" {
 	// 	return &model.User{
@@ -208,8 +217,8 @@ func mapUserAndSettings(claims map[string]interface{}, config *AuthConfig) (*mod
 		name = ""
 	}
 
-	var roles = role.Strings(config.AuthDefaultRoles)
-	if contains(config.AuthAdminUsers, username) {
+	roles := role.Strings(config.AuthDefaultRoles)
+	if slices.Contains(config.AuthAdminUsers, username) {
 		roles = append(roles, role.Admin)
 	}
 
@@ -223,20 +232,12 @@ func mapUserAndSettings(claims map[string]interface{}, config *AuthConfig) (*mod
 		}, nil
 }
 
-func contains(l []string, s string) bool {
-	for _, e := range l {
-		if e == s {
-			return true
-		}
-	}
-	return false
-}
-
-func getString(m map[string]interface{}, key string) (string, error) {
+func getString(m map[string]any, key string) (string, error) {
 	if v, ok := m[key]; ok {
 		if s, ok := v.(string); ok {
 			return s, nil
 		}
+
 		return "", fmt.Errorf("mapping of %s failed, wrong type (%T)", key, v)
 	}
 
@@ -247,12 +248,14 @@ func redirectToLogin(w http.ResponseWriter, r *http.Request, oauth2Config *oauth
 	state, err := state()
 	if err != nil {
 		api.JSONErrorStatus(w, http.StatusInternalServerError, errors.New("generating state failed"))
+
 		return
 	}
 
 	setStateCookie(w, state)
 
 	http.Redirect(w, r, oauth2Config.AuthCodeURL(state), http.StatusFound)
+
 	return
 }
 
@@ -262,11 +265,13 @@ func AuthorizeBlockedUser() func(http.Handler) http.Handler {
 			user, ok := busdb.UserFromContext(r.Context())
 			if !ok {
 				api.JSONErrorStatus(w, http.StatusInternalServerError, errors.New("no user in context"))
+
 				return
 			}
 
 			if user.Blocked {
 				api.JSONErrorStatus(w, http.StatusForbidden, errors.New("user is blocked"))
+
 				return
 			}
 
@@ -281,11 +286,13 @@ func AuthorizeRole(roles []string) func(http.Handler) http.Handler {
 			user, ok := busdb.UserFromContext(r.Context())
 			if !ok {
 				api.JSONErrorStatus(w, http.StatusInternalServerError, errors.New("no user in context"))
+
 				return
 			}
 
 			if !role.UserHasRoles(user, role.FromStrings(roles)) {
 				api.JSONErrorStatus(w, http.StatusForbidden, fmt.Errorf("missing role %s has %s", roles, user.Roles))
+
 				return
 			}
 
@@ -299,17 +306,20 @@ func callback(config *AuthConfig) http.HandlerFunc {
 		state, err := stateCookie(r)
 		if err != nil || state == "" {
 			api.JSONErrorStatus(w, http.StatusInternalServerError, errors.New("state missing"))
+
 			return
 		}
 
 		if state != r.URL.Query().Get("state") {
 			api.JSONErrorStatus(w, http.StatusInternalServerError, errors.New("state mismatch"))
+
 			return
 		}
 
 		oauth2Token, err := config.OAuth2.Exchange(r.Context(), r.URL.Query().Get("code"))
 		if err != nil {
 			api.JSONErrorStatus(w, http.StatusInternalServerError, fmt.Errorf("oauth2 exchange failed: %w", err))
+
 			return
 		}
 
@@ -317,12 +327,14 @@ func callback(config *AuthConfig) http.HandlerFunc {
 		rawIDToken, ok := oauth2Token.Extra("id_token").(string)
 		if !ok {
 			api.JSONErrorStatus(w, http.StatusInternalServerError, errors.New("missing id token"))
+
 			return
 		}
 
 		claims, apiError := verifyClaims(r, config, rawIDToken)
 		if apiError != nil {
 			api.JSONErrorStatus(w, apiError.Status, apiError.Internal)
+
 			return
 		}
 
@@ -337,10 +349,11 @@ func state() (string, error) {
 	if _, err := rand.Read(rnd); err != nil {
 		return "", err
 	}
+
 	return base64.URLEncoding.EncodeToString(rnd), nil
 }
 
-func verifyClaims(r *http.Request, config *AuthConfig, rawIDToken string) (map[string]interface{}, *api.HTTPError) {
+func verifyClaims(r *http.Request, config *AuthConfig, rawIDToken string) (map[string]any, *api.HTTPError) {
 	verifier, err := config.Verifier(r.Context())
 	if err != nil {
 		return nil, &api.HTTPError{Status: http.StatusUnauthorized, Internal: fmt.Errorf("could not verify: %w", err)}
@@ -350,9 +363,10 @@ func verifyClaims(r *http.Request, config *AuthConfig, rawIDToken string) (map[s
 		return nil, &api.HTTPError{Status: http.StatusInternalServerError, Internal: fmt.Errorf("could not verify bearer token: %w", err)}
 	}
 
-	var claims map[string]interface{}
+	var claims map[string]any
 	if err := authToken.Claims(&claims); err != nil {
 		return nil, &api.HTTPError{Status: http.StatusInternalServerError, Internal: fmt.Errorf("failed to parse claims: %w", err)}
 	}
+
 	return claims, nil
 }

backup.go

@@ -41,7 +41,10 @@ func Backup(catalystStorage *storage.Storage, c *database.Config, writer io.Writ
 	archive := zip.NewWriter(writer)
 	defer archive.Close()
 
-	archive.SetComment(GetVersion())
+	err := archive.SetComment(GetVersion())
+	if err != nil {
+		return err
+	}
 
 	// S3
 	if err := backupS3(catalystStorage, archive); err != nil {
@@ -86,6 +89,7 @@ func backupS3(catalystStorage *storage.Storage, archive *zip.Writer) error {
 			}
 		}
 	}
+
 	return nil
 }
 
@@ -105,6 +109,7 @@ func backupArango(c *database.Config, archive *zip.Writer) error {
 
 func zipDump(dir string, archive *zip.Writer) error {
 	fsys := os.DirFS(dir)
+
 	return fs.WalkDir(fsys, ".", func(p string, d fs.DirEntry, err error) error {
 		if err != nil {
 			return err
@@ -127,6 +132,7 @@ func zipDump(dir string, archive *zip.Writer) error {
 		if _, err := io.Copy(a, f); err != nil {
 			return err
 		}
+
 		return nil
 	})
 }
@@ -144,5 +150,6 @@ func arangodump(dir string, config *database.Config) error {
 		"--server.database", name,
 	}
 	cmd := exec.Command("arangodump", args...)
+
 	return cmd.Run()
 }

bus/bus.go

@@ -50,7 +50,7 @@ func New(c *Config) (*Bus, error) {
 	return &Bus{config: c, client: client}, err
 }
 
-func (b *Bus) jsonPublish(msg interface{}, channel, key string) error {
+func (b *Bus) jsonPublish(msg any, channel, key string) error {
 	payload, err := json.Marshal(msg)
 	if err != nil {
 		return err
@@ -65,5 +65,6 @@ func (b *Bus) safeSubscribe(key, channel string, handler func(c *emitter.Client,
 			log.Printf("Recovered %s in channel %s\n", r, channel)
 		}
 	}()
+
 	return b.client.Subscribe(key, channel, handler)
 }

bus/databaseupdate.go

@@ -35,6 +35,7 @@ func (b *Bus) SubscribeDatabaseUpdate(f func(msg *DatabaseUpdateMsg)) error {
 		var msg DatabaseUpdateMsg
 		if err := json.Unmarshal(m.Payload(), &msg); err != nil {
 			log.Println(err)
+
 			return
 		}
 		go f(&msg)

bus/job.go

@@ -18,7 +18,7 @@ type JobMsg struct {
 	Message    *model.Message `json:"message"`
 }
 
-func (b *Bus) PublishJob(id, automation string, payload interface{}, context *model.Context, origin *model.Origin) error {
+func (b *Bus) PublishJob(id, automation string, payload any, context *model.Context, origin *model.Origin) error {
 	return b.jsonPublish(&JobMsg{
 		ID:         id,
 		Automation: automation,
@@ -35,6 +35,7 @@ func (b *Bus) SubscribeJob(f func(msg *JobMsg)) error {
 		var msg JobMsg
 		if err := json.Unmarshal(m.Payload(), &msg); err != nil {
 			log.Println(err)
+
 			return
 		}
 		go f(&msg)

bus/request.go

@@ -29,6 +29,7 @@ func (b *Bus) SubscribeRequest(f func(msg *RequestMsg)) error {
 		msg := &RequestMsg{}
 		if err := json.Unmarshal(m.Payload(), msg); err != nil {
 			log.Println(err)
+
 			return
 		}
 		go f(msg)

bus/result.go

@@ -12,12 +12,12 @@ import (
 const channelResult = "result"
 
 type ResultMsg struct {
-	Automation string                 `json:"automation"`
-	Data       map[string]interface{} `json:"data,omitempty"`
-	Target     *model.Origin          `json:"target"`
+	Automation string         `json:"automation"`
+	Data       map[string]any `json:"data,omitempty"`
+	Target     *model.Origin  `json:"target"`
 }
 
-func (b *Bus) PublishResult(automation string, data map[string]interface{}, target *model.Origin) error {
+func (b *Bus) PublishResult(automation string, data map[string]any, target *model.Origin) error {
 	return b.jsonPublish(&ResultMsg{Automation: automation, Data: data, Target: target}, channelResult, b.config.resultBusKey)
 }
 
@@ -26,6 +26,7 @@ func (b *Bus) SubscribeResult(f func(msg *ResultMsg)) error {
 		msg := &ResultMsg{}
 		if err := json.Unmarshal(m.Payload(), msg); err != nil {
 			log.Println(err)
+
 			return
 		}
 		go f(msg)

busservice/busservice.go

@@ -21,7 +21,6 @@ type busService struct {
 }
 
 func New(apiURL, apikey, network string, catalystBus *bus.Bus, db *database.Database) error {
-
 	h := &busService{db: db, apiURL: apiURL, apiKey: apikey, network: network, catalystBus: catalystBus}
 
 	if err := catalystBus.SubscribeRequest(h.logRequest); err != nil {
@@ -40,6 +39,7 @@ func New(apiURL, apikey, network string, catalystBus *bus.Bus, db *database.Data
 func busContext() context.Context {
 	// TODO: change roles?
 	bot := &model.UserResponse{ID: "bot", Roles: []string{role.Admin}}
+
 	return busdb.UserContext(context.Background(), bot)
 }
 

busservice/docker.go

@@ -59,13 +59,15 @@ func pullImage(ctx context.Context, cli *client.Client, image string) (string, e
 
 	buf := &bytes.Buffer{}
 	_, err = io.Copy(buf, reader)
+
 	return buf.String(), err
 }
 
 func copyFile(ctx context.Context, cli *client.Client, path string, contentString string, id string) error {
 	tarBuf := &bytes.Buffer{}
 	tw := tar.NewWriter(tarBuf)
-	if err := tw.WriteHeader(&tar.Header{Name: path, Mode: 0755, Size: int64(len(contentString))}); err != nil {
+	header := &tar.Header{Name: path, Mode: 0o755, Size: int64(len(contentString))}
+	if err := tw.WriteHeader(header); err != nil {
 		return err
 	}
 
@@ -90,7 +92,12 @@ func runDocker(ctx context.Context, jobID, containerID string, db *database.Data
 		return nil, nil, err
 	}
 
-	defer cli.ContainerRemove(ctx, containerID, types.ContainerRemoveOptions{Force: true})
+	defer func(cli *client.Client, ctx context.Context, containerID string, options types.ContainerRemoveOptions) {
+		err := cli.ContainerRemove(ctx, containerID, options)
+		if err != nil {
+			log.Println(err)
+		}
+	}(cli, ctx, containerID, types.ContainerRemoveOptions{Force: true})
 
 	if err := cli.ContainerStart(ctx, containerID, types.ContainerStartOptions{}); err != nil {
 		return nil, nil, err
@@ -123,13 +130,16 @@ func streamStdErr(ctx context.Context, cli *client.Client, jobID, containerID st
 		err := scanLines(ctx, jobID, containerLogs, stderrBuf, db)
 		if err != nil {
 			log.Println(err)
+
 			return
 		}
 		if err := containerLogs.Close(); err != nil {
 			log.Println(err)
+
 			return
 		}
 	}()
+
 	return stderrBuf, nil
 }
 
@@ -139,24 +149,28 @@ func scanLines(ctx context.Context, jobID string, input io.ReadCloser, output io
 		_, err := stdcopy.StdCopy(w, w, input)
 		if err != nil {
 			log.Println(err)
+
 			return
 		}
 		if err := w.Close(); err != nil {
 			log.Println(err)
+
 			return
 		}
 	}()
 	s := bufio.NewScanner(r)
 	for s.Scan() {
 		b := s.Bytes()
-		output.Write(b)
-		output.Write([]byte("\n"))
+		_, _ = output.Write(b)
+		_, _ = output.Write([]byte("\n"))
 
 		if err := db.JobLogAppend(ctx, jobID, string(b)+"\n"); err != nil {
 			log.Println(err)
+
 			continue
 		}
 	}
+
 	return s.Err()
 }
 
@@ -172,6 +186,7 @@ func waitForContainer(ctx context.Context, cli *client.Client, containerID strin
 			return fmt.Errorf("container returned status code %d: stderr: %s", exitStatus.StatusCode, stderrBuf.String())
 		}
 	}
+
 	return nil
 }
 

busservice/job.go

@@ -19,17 +19,20 @@ func (h *busService) handleJob(automationMsg *bus.JobMsg) {
 	})
 	if err != nil {
 		log.Println(err)
+
 		return
 	}
 
 	automation, err := h.db.AutomationGet(ctx, automationMsg.Automation)
 	if err != nil {
 		log.Println(err)
+
 		return
 	}
 
 	if automation.Script == "" {
 		log.Println("automation is empty")
+
 		return
 	}
 
@@ -39,11 +42,17 @@ func (h *busService) handleJob(automationMsg *bus.JobMsg) {
 	automationMsg.Message.Secrets["catalyst_apikey"] = h.apiKey
 	automationMsg.Message.Secrets["catalyst_apiurl"] = h.apiURL
 
-	scriptMessage, _ := json.Marshal(automationMsg.Message)
+	scriptMessage, err := json.Marshal(automationMsg.Message)
+	if err != nil {
+		log.Println(err)
+
+		return
+	}
 
 	containerID, logs, err := createContainer(ctx, automation.Image, automation.Script, string(scriptMessage), h.network)
 	if err != nil {
 		log.Println(err)
+
 		return
 	}
 
@@ -55,18 +64,19 @@ func (h *busService) handleJob(automationMsg *bus.JobMsg) {
 		Status:    job.Status,
 	}); err != nil {
 		log.Println(err)
+
 		return
 	}
 
-	var result map[string]interface{}
+	var result map[string]any
 
 	stdout, _, err := runDocker(ctx, automationMsg.ID, containerID, h.db)
 	if err != nil {
-		result = map[string]interface{}{"error": fmt.Sprintf("error running script %s %s", err, string(stdout))}
+		result = map[string]any{"error": fmt.Sprintf("error running script %s %s", err, string(stdout))}
 	} else {
-		var data map[string]interface{}
+		var data map[string]any
 		if err := json.Unmarshal(stdout, &data); err != nil {
-			result = map[string]interface{}{"error": string(stdout)}
+			result = map[string]any{"error": string(stdout)}
 		} else {
 			result = data
 		}
@@ -78,6 +88,7 @@ func (h *busService) handleJob(automationMsg *bus.JobMsg) {
 
 	if err := h.db.JobComplete(ctx, automationMsg.ID, result); err != nil {
 		log.Println(err)
+
 		return
 	}
 }

caql/blevebuilder.go

@@ -8,7 +8,7 @@ import (
 	"github.com/SecurityBrewery/catalyst/generated/caql/parser"
 )
 
-var TooComplexError = errors.New("unsupported features for index queries, use advanced search instead")
+var ErrTooComplex = errors.New("unsupported features for index queries, use advanced search instead")
 
 type bleveBuilder struct {
 	*parser.BaseCAQLParserListener
@@ -35,8 +35,9 @@ func (s *bleveBuilder) pop() (n string) {
 	return
 }
 
-func (s *bleveBuilder) binaryPop() (interface{}, interface{}) {
+func (s *bleveBuilder) binaryPop() (any, any) {
 	right, left := s.pop(), s.pop()
+
 	return left, right
 }
 
@@ -48,9 +49,7 @@ func (s *bleveBuilder) ExitExpression(ctx *parser.ExpressionContext) {
 	case ctx.Reference() != nil:
 		// pass
 	case ctx.Operator_unary() != nil:
-		s.err = TooComplexError
-		return
-
+		s.err = ErrTooComplex
 	case ctx.T_PLUS() != nil:
 		fallthrough
 	case ctx.T_MINUS() != nil:
@@ -60,13 +59,9 @@ func (s *bleveBuilder) ExitExpression(ctx *parser.ExpressionContext) {
 	case ctx.T_DIV() != nil:
 		fallthrough
 	case ctx.T_MOD() != nil:
-		s.err = TooComplexError
-		return
-
+		s.err = ErrTooComplex
 	case ctx.T_RANGE() != nil:
-		s.err = TooComplexError
-		return
-
+		s.err = ErrTooComplex
 	case ctx.T_LT() != nil && ctx.GetEq_op() == nil:
 		left, right := s.binaryPop()
 		s.push(fmt.Sprintf("%s:<%s", left, right))
@@ -79,64 +74,46 @@ func (s *bleveBuilder) ExitExpression(ctx *parser.ExpressionContext) {
 	case ctx.T_GE() != nil && ctx.GetEq_op() == nil:
 		left, right := s.binaryPop()
 		s.push(fmt.Sprintf("%s:>=%s", left, right))
-
 	case ctx.T_IN() != nil && ctx.GetEq_op() == nil:
-		s.err = TooComplexError
-		return
-
+		s.err = ErrTooComplex
 	case ctx.T_EQ() != nil && ctx.GetEq_op() == nil:
 		left, right := s.binaryPop()
 		s.push(fmt.Sprintf("%s:%s", left, right))
 	case ctx.T_NE() != nil && ctx.GetEq_op() == nil:
 		left, right := s.binaryPop()
 		s.push(fmt.Sprintf("-%s:%s", left, right))
-
 	case ctx.T_ALL() != nil && ctx.GetEq_op() != nil:
 		fallthrough
 	case ctx.T_ANY() != nil && ctx.GetEq_op() != nil:
 		fallthrough
 	case ctx.T_NONE() != nil && ctx.GetEq_op() != nil:
-		s.err = TooComplexError
-		return
-
+		s.err = ErrTooComplex
 	case ctx.T_ALL() != nil && ctx.T_NOT() != nil && ctx.T_IN() != nil:
 		fallthrough
 	case ctx.T_ANY() != nil && ctx.T_NOT() != nil && ctx.T_IN() != nil:
 		fallthrough
 	case ctx.T_NONE() != nil && ctx.T_NOT() != nil && ctx.T_IN() != nil:
-		s.err = TooComplexError
-		return
-
+		s.err = ErrTooComplex
 	case ctx.T_LIKE() != nil:
 		s.err = errors.New("index queries are like queries by default")
-		return
-
 	case ctx.T_REGEX_MATCH() != nil:
 		left, right := s.binaryPop()
 		if ctx.T_NOT() != nil {
-			s.err = TooComplexError
-			return
+			s.err = ErrTooComplex
 		} else {
 			s.push(fmt.Sprintf("%s:/%s/", left, right))
 		}
 	case ctx.T_REGEX_NON_MATCH() != nil:
 		s.err = errors.New("index query cannot contain regex non matches, use advanced search instead")
-		return
-
 	case ctx.T_AND() != nil:
 		left, right := s.binaryPop()
 		s.push(fmt.Sprintf("%s %s", left, right))
 	case ctx.T_OR() != nil:
 		s.err = errors.New("index query cannot contain OR, use advanced search instead")
-		return
-
 	case ctx.T_QUESTION() != nil && len(ctx.AllExpression()) == 3:
 		s.err = errors.New("index query cannot contain ternary operations, use advanced search instead")
-		return
 	case ctx.T_QUESTION() != nil && len(ctx.AllExpression()) == 2:
 		s.err = errors.New("index query cannot contain ternary operations, use advanced search instead")
-		return
-
 	default:
 		panic("unknown expression")
 	}
@@ -152,17 +129,13 @@ func (s *bleveBuilder) ExitReference(ctx *parser.ReferenceContext) {
 	case ctx.T_STRING() != nil:
 		s.push(ctx.T_STRING().GetText())
 	case ctx.Compound_value() != nil:
-		s.err = TooComplexError
-		return
+		s.err = ErrTooComplex
 	case ctx.Function_call() != nil:
-		s.err = TooComplexError
-		return
+		s.err = ErrTooComplex
 	case ctx.T_OPEN() != nil:
-		s.err = TooComplexError
-		return
+		s.err = ErrTooComplex
 	case ctx.T_ARRAY_OPEN() != nil:
-		s.err = TooComplexError
-		return
+		s.err = ErrTooComplex
 	default:
 		panic(fmt.Sprintf("unexpected value: %s", ctx.GetText()))
 	}

caql/blevebuilder_test.go

@@ -1,10 +1,14 @@
-package caql
+package caql_test
 
 import (
 	"testing"
+
+	"github.com/SecurityBrewery/catalyst/caql"
 )
 
 func TestBleveBuilder(t *testing.T) {
+	t.Parallel()
+
 	tests := []struct {
 		name           string
 		saql           string
@@ -18,15 +22,20 @@ func TestBleveBuilder(t *testing.T) {
 		{name: "Search 4", saql: `title == 'malware' AND 'wannacry'`, wantBleve: `title:"malware" "wannacry"`},
 	}
 	for _, tt := range tests {
-		parser := &Parser{}
+		tt := tt
+
+		parser := &caql.Parser{}
 
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			expr, err := parser.Parse(tt.saql)
 			if (err != nil) != tt.wantParseErr {
 				t.Errorf("Parse() error = %v, wantErr %v", err, tt.wantParseErr)
 				if expr != nil {
 					t.Error(expr.String())
 				}
+
 				return
 			}
 			if err != nil {
@@ -37,6 +46,7 @@ func TestBleveBuilder(t *testing.T) {
 			if (err != nil) != tt.wantRebuildErr {
 				t.Error(expr.String())
 				t.Errorf("String() error = %v, wantErr %v", err, tt.wantParseErr)
+
 				return
 			}
 			if err != nil {

caql/builder.go

@@ -5,6 +5,8 @@ import (
 	"strconv"
 	"strings"
 
+	"golang.org/x/exp/slices"
+
 	"github.com/SecurityBrewery/catalyst/generated/caql/parser"
 )
 
@@ -40,6 +42,7 @@ func (s *aqlBuilder) pop() (n string) {
 
 func (s *aqlBuilder) binaryPop() (string, string) {
 	right, left := s.pop(), s.pop()
+
 	return left, right
 }
 
@@ -181,8 +184,10 @@ func (s *aqlBuilder) toBoolString(v string) string {
 		if err != nil {
 			panic("invalid search " + err.Error())
 		}
+
 		return fmt.Sprintf(`d._key IN ["%s"]`, strings.Join(ids, `","`))
 	}
+
 	return v
 }
 
@@ -246,7 +251,7 @@ func (s *aqlBuilder) ExitFunction_call(ctx *parser.Function_callContext) {
 	}
 	parameter := strings.Join(array, ", ")
 
-	if !stringSliceContains(functionNames, strings.ToUpper(ctx.T_STRING().GetText())) {
+	if !slices.Contains(functionNames, strings.ToUpper(ctx.T_STRING().GetText())) {
 		panic("unknown function")
 	}
 

caql/function.go

@@ -16,7 +16,6 @@ import (
 
 func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 	switch strings.ToUpper(ctx.T_STRING().GetText()) {
-
 	default:
 		s.appendErrors(errors.New("unknown function"))
 
@@ -26,8 +25,8 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		if len(ctx.AllExpression()) == 3 {
 			u = s.pop().(bool)
 		}
-		seen := map[interface{}]bool{}
-		values, anyArray := s.pop().([]interface{}), s.pop().([]interface{})
+		seen := map[any]bool{}
+		values, anyArray := s.pop().([]any), s.pop().([]any)
 
 		if u {
 			for _, e := range anyArray {
@@ -45,18 +44,18 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		s.push(anyArray)
 	case "COUNT_DISTINCT", "COUNT_UNIQUE":
 		count := 0
-		seen := map[interface{}]bool{}
-		array := s.pop().([]interface{})
+		seen := map[any]bool{}
+		array := s.pop().([]any)
 		for _, e := range array {
 			_, ok := seen[e]
 			if !ok {
 				seen[e] = true
-				count += 1
+				count++
 			}
 		}
 		s.push(float64(count))
 	case "FIRST":
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		if len(array) == 0 {
 			s.push(nil)
 		} else {
@@ -65,16 +64,16 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 	// case "FLATTEN":
 	// case "INTERLEAVE":
 	case "INTERSECTION":
-		iset := New(s.pop().([]interface{})...)
+		iset := NewSet(s.pop().([]any)...)
 
 		for i := 1; i < len(ctx.AllExpression()); i++ {
-			iset = iset.Intersection(New(s.pop().([]interface{})...))
+			iset = iset.Intersection(NewSet(s.pop().([]any)...))
 		}
 
 		s.push(iset.Values())
 	// case "JACCARD":
 	case "LAST":
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		if len(array) == 0 {
 			s.push(nil)
 		} else {
@@ -94,9 +93,9 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 			s.push(float64(len(fmt.Sprint(v))))
 		case string:
 			s.push(float64(utf8.RuneCountInString(v)))
-		case []interface{}:
+		case []any:
 			s.push(float64(len(v)))
-		case map[string]interface{}:
+		case map[string]any:
 			s.push(float64(len(v)))
 		default:
 			panic("unknown type")
@@ -104,7 +103,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 	case "MINUS":
 		var sets []*Set
 		for i := 0; i < len(ctx.AllExpression()); i++ {
-			sets = append(sets, New(s.pop().([]interface{})...))
+			sets = append(sets, NewSet(s.pop().([]any)...))
 		}
 
 		iset := sets[len(sets)-1]
@@ -116,7 +115,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		s.push(iset.Values())
 	case "NTH":
 		pos := s.pop().(float64)
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		if int(pos) >= len(array) || pos < 0 {
 			s.push(nil)
 		} else {
@@ -124,16 +123,16 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		}
 	// case "OUTERSECTION":
 	// 	array := s.pop().([]interface{})
-	// 	union := New(array...)
-	// 	intersection := New(s.pop().([]interface{})...)
+	// 	union := NewSet(array...)
+	// 	intersection := NewSet(s.pop().([]interface{})...)
 	// 	for i := 1; i < len(ctx.AllExpression()); i++ {
 	// 		array = s.pop().([]interface{})
-	// 		union = union.Union(New(array...))
-	// 		intersection = intersection.Intersection(New(array...))
+	// 		union = union.Union(NewSet(array...))
+	// 		intersection = intersection.Intersection(NewSet(array...))
 	// 	}
 	// 	s.push(union.Minus(intersection).Values())
 	case "POP":
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		s.push(array[:len(array)-1])
 	case "POSITION", "CONTAINS_ARRAY":
 		returnIndex := false
@@ -141,7 +140,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 			returnIndex = s.pop().(bool)
 		}
 		search := s.pop()
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 
 		for idx, e := range array {
 			if e == search {
@@ -164,7 +163,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 			u = s.pop().(bool)
 		}
 		element := s.pop()
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 
 		if u && contains(array, element) {
 			s.push(array)
@@ -173,13 +172,13 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		}
 	case "REMOVE_NTH":
 		position := s.pop().(float64)
-		anyArray := s.pop().([]interface{})
+		anyArray := s.pop().([]any)
 
 		if position < 0 {
 			position = float64(len(anyArray) + int(position))
 		}
 
-		result := []interface{}{}
+		result := []any{}
 		for idx, e := range anyArray {
 			if idx != int(position) {
 				result = append(result, e)
@@ -193,7 +192,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		}
 		replaceValue := s.pop().(string)
 		position := s.pop().(float64)
-		anyArray := s.pop().([]interface{})
+		anyArray := s.pop().([]any)
 
 		if position < 0 {
 			position = float64(len(anyArray) + int(position))
@@ -224,8 +223,8 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 			limit = s.pop().(float64)
 		}
 		value := s.pop()
-		array := s.pop().([]interface{})
-		result := []interface{}{}
+		array := s.pop().([]any)
+		result := []any{}
 		for idx, e := range array {
 			if e != value || float64(idx) > limit {
 				result = append(result, e)
@@ -233,9 +232,9 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		}
 		s.push(result)
 	case "REMOVE_VALUES":
-		values := s.pop().([]interface{})
-		array := s.pop().([]interface{})
-		result := []interface{}{}
+		values := s.pop().([]any)
+		array := s.pop().([]any)
+		result := []any{}
 		for _, e := range array {
 			if !contains(values, e) {
 				result = append(result, e)
@@ -243,14 +242,14 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		}
 		s.push(result)
 	case "REVERSE":
-		array := s.pop().([]interface{})
-		var reverse []interface{}
+		array := s.pop().([]any)
+		var reverse []any
 		for _, e := range array {
-			reverse = append([]interface{}{e}, reverse...)
+			reverse = append([]any{e}, reverse...)
 		}
 		s.push(reverse)
 	case "SHIFT":
-		s.push(s.pop().([]interface{})[1:])
+		s.push(s.pop().([]any)[1:])
 	case "SLICE":
 		length := float64(-1)
 		full := true
@@ -259,7 +258,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 			full = false
 		}
 		start := int64(s.pop().(float64))
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 
 		if start < 0 {
 			start = int64(len(array)) + start
@@ -276,43 +275,43 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		}
 		s.push(array[start:end])
 	case "SORTED":
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		sort.Slice(array, func(i, j int) bool { return lt(array[i], array[j]) })
 		s.push(array)
 	case "SORTED_UNIQUE":
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		sort.Slice(array, func(i, j int) bool { return lt(array[i], array[j]) })
 		s.push(unique(array))
 	case "UNION":
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 
 		for i := 1; i < len(ctx.AllExpression()); i++ {
-			array = append(array, s.pop().([]interface{})...)
+			array = append(array, s.pop().([]any)...)
 		}
 
 		sort.Slice(array, func(i, j int) bool { return lt(array[i], array[j]) })
 		s.push(array)
 	case "UNION_DISTINCT":
-		iset := New(s.pop().([]interface{})...)
+		iset := NewSet(s.pop().([]any)...)
 
 		for i := 1; i < len(ctx.AllExpression()); i++ {
-			iset = iset.Union(New(s.pop().([]interface{})...))
+			iset = iset.Union(NewSet(s.pop().([]any)...))
 		}
 
 		s.push(unique(iset.Values()))
 	case "UNIQUE":
-		s.push(unique(s.pop().([]interface{})))
+		s.push(unique(s.pop().([]any)))
 	case "UNSHIFT":
 		u := false
 		if len(ctx.AllExpression()) == 3 {
 			u = s.pop().(bool)
 		}
 		element := s.pop()
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		if u && contains(array, element) {
 			s.push(array)
 		} else {
-			s.push(append([]interface{}{element}, array...))
+			s.push(append([]any{element}, array...))
 		}
 
 	// Bit https://www.arangodb.com/docs/stable/aql/functions-bit.html
@@ -367,8 +366,8 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		if len(ctx.AllExpression()) >= 2 {
 			removeInternal = s.pop().(bool)
 		}
-		var keys []interface{}
-		for k := range s.pop().(map[string]interface{}) {
+		var keys []any
+		for k := range s.pop().(map[string]any) {
 			isInternalKey := strings.HasPrefix(k, "_")
 			if !removeInternal || !isInternalKey {
 				keys = append(keys, k)
@@ -379,20 +378,20 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 	// case "COUNT":
 	case "HAS":
 		right, left := s.pop(), s.pop()
-		_, ok := left.(map[string]interface{})[right.(string)]
+		_, ok := left.(map[string]any)[right.(string)]
 		s.push(ok)
 	// case "KEEP":
 	// case "LENGTH":
 	// case "MATCHES":
 	case "MERGE":
-		var docs []map[string]interface{}
+		var docs []map[string]any
 		if len(ctx.AllExpression()) == 1 {
-			for _, doc := range s.pop().([]interface{}) {
-				docs = append([]map[string]interface{}{doc.(map[string]interface{})}, docs...)
+			for _, doc := range s.pop().([]any) {
+				docs = append([]map[string]any{doc.(map[string]any)}, docs...)
 			}
 		} else {
 			for i := 0; i < len(ctx.AllExpression()); i++ {
-				docs = append(docs, s.pop().(map[string]interface{}))
+				docs = append(docs, s.pop().(map[string]any))
 			}
 		}
 
@@ -404,9 +403,9 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		}
 		s.push(doc)
 	case "MERGE_RECURSIVE":
-		var doc map[string]interface{}
+		var doc map[string]any
 		for i := 0; i < len(ctx.AllExpression()); i++ {
-			err := mergo.Merge(&doc, s.pop().(map[string]interface{}))
+			err := mergo.Merge(&doc, s.pop().(map[string]any))
 			if err != nil {
 				panic(err)
 			}
@@ -421,8 +420,8 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		if len(ctx.AllExpression()) == 2 {
 			removeInternal = s.pop().(bool)
 		}
-		var values []interface{}
-		for k, v := range s.pop().(map[string]interface{}) {
+		var values []any
+		for k, v := range s.pop().(map[string]any) {
 			isInternalKey := strings.HasPrefix(k, "_")
 			if !removeInternal || !isInternalKey {
 				values = append(values, v)
@@ -458,10 +457,10 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 	case "AVERAGE", "AVG":
 		count := 0
 		sum := float64(0)
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		for _, element := range array {
 			if element != nil {
-				count += 1
+				count++
 				sum += toNumber(element)
 			}
 		}
@@ -506,7 +505,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 	case "MAX":
 		var set bool
 		var max float64
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		for _, element := range array {
 			if element != nil {
 				if !set || toNumber(element) > max {
@@ -521,7 +520,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 			s.push(nil)
 		}
 	case "MEDIAN":
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		var numbers []float64
 		for _, element := range array {
 			if f, ok := element.(float64); ok {
@@ -544,7 +543,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 	case "MIN":
 		var set bool
 		var min float64
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		for _, element := range array {
 			if element != nil {
 				if !set || toNumber(element) < min {
@@ -566,7 +565,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		s.push(math.Pow(left.(float64), right.(float64)))
 	case "PRODUCT":
 		product := float64(1)
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		for _, element := range array {
 			if element != nil {
 				product *= toNumber(element)
@@ -578,7 +577,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 	case "RAND":
 		s.push(rand.Float64())
 	case "RANGE":
-		var array []interface{}
+		var array []any
 		var start, end, step float64
 		if len(ctx.AllExpression()) == 2 {
 			right, left := s.pop(), s.pop()
@@ -612,7 +611,7 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 	// case "STDDEV":
 	case "SUM":
 		sum := float64(0)
-		array := s.pop().([]interface{})
+		array := s.pop().([]any)
 		for _, element := range array {
 			sum += toNumber(element)
 		}
@@ -691,7 +690,6 @@ func (s *aqlInterpreter) function(ctx *parser.Function_callContext) {
 		// case "IS_IPV4":
 		// case "IS_KEY":
 		// case "TYPENAME":
-
 	}
 }
 
@@ -705,6 +703,7 @@ func unique(array []interface{}) []interface{} {
 			filtered = append(filtered, e)
 		}
 	}
+
 	return filtered
 }
 
@@ -714,15 +713,7 @@ func contains(values []interface{}, e interface{}) bool {
 			return true
 		}
 	}
-	return false
-}
 
-func stringSliceContains(values []string, e string) bool {
-	for _, v := range values {
-		if e == v {
-			return true
-		}
-	}
 	return false
 }
 
@@ -747,4 +738,5 @@ var functionNames = []string{
 	"REGEX_REPLACE", "REVERSE", "RIGHT", "RTRIM", "SHA1", "SHA512", "SOUNDEX", "SPLIT", "STARTS_WITH", "SUBSTITUTE",
 	"SUBSTRING", "TOKENS", "TO_BASE64", "TO_HEX", "TRIM", "UPPER", "UUID", "TO_BOOL", "TO_NUMBER", "TO_STRING",
 	"TO_ARRAY", "TO_LIST", "IS_NULL", "IS_BOOL", "IS_NUMBER", "IS_STRING", "IS_ARRAY", "IS_LIST", "IS_OBJECT",
-	"IS_DOCUMENT", "IS_DATESTRING", "IS_IPV4", "IS_KEY", "TYPENAME"}
+	"IS_DOCUMENT", "IS_DATESTRING", "IS_IPV4", "IS_KEY", "TYPENAME",
+}

caql/function_test.go

@@ -1,18 +1,22 @@
-package caql
+package caql_test
 
 import (
 	"encoding/json"
 	"math"
 	"reflect"
 	"testing"
+
+	"github.com/SecurityBrewery/catalyst/caql"
 )
 
 func TestFunctions(t *testing.T) {
+	t.Parallel()
+
 	tests := []struct {
 		name           string
 		saql           string
 		wantRebuild    string
-		wantValue      interface{}
+		wantValue      any
 		wantParseErr   bool
 		wantRebuildErr bool
 		wantEvalErr    bool
@@ -266,13 +270,13 @@ func TestFunctions(t *testing.T) {
 		{name: "RADIANS", saql: `RADIANS(0)`, wantRebuild: `RADIANS(0)`, wantValue: 0},
 		// {name: "RAND", saql: `RAND()`, wantRebuild: `RAND()`, wantValue: 0.3503170117504508},
 		// {name: "RAND", saql: `RAND()`, wantRebuild: `RAND()`, wantValue: 0.6138226173882478},
-		{name: "RANGE", saql: `RANGE(1, 4)`, wantRebuild: `RANGE(1, 4)`, wantValue: []interface{}{float64(1), float64(2), float64(3), float64(4)}},
-		{name: "RANGE", saql: `RANGE(1, 4, 2)`, wantRebuild: `RANGE(1, 4, 2)`, wantValue: []interface{}{float64(1), float64(3)}},
-		{name: "RANGE", saql: `RANGE(1, 4, 3)`, wantRebuild: `RANGE(1, 4, 3)`, wantValue: []interface{}{float64(1), float64(4)}},
-		{name: "RANGE", saql: `RANGE(1.5, 2.5)`, wantRebuild: `RANGE(1.5, 2.5)`, wantValue: []interface{}{float64(1), float64(2)}},
-		{name: "RANGE", saql: `RANGE(1.5, 2.5, 1)`, wantRebuild: `RANGE(1.5, 2.5, 1)`, wantValue: []interface{}{1.5, 2.5}},
-		{name: "RANGE", saql: `RANGE(1.5, 2.5, 0.5)`, wantRebuild: `RANGE(1.5, 2.5, 0.5)`, wantValue: []interface{}{1.5, 2.0, 2.5}},
-		{name: "RANGE", saql: `RANGE(-0.75, 1.1, 0.5)`, wantRebuild: `RANGE(-0.75, 1.1, 0.5)`, wantValue: []interface{}{-0.75, -0.25, 0.25, 0.75}},
+		{name: "RANGE", saql: `RANGE(1, 4)`, wantRebuild: `RANGE(1, 4)`, wantValue: []any{float64(1), float64(2), float64(3), float64(4)}},
+		{name: "RANGE", saql: `RANGE(1, 4, 2)`, wantRebuild: `RANGE(1, 4, 2)`, wantValue: []any{float64(1), float64(3)}},
+		{name: "RANGE", saql: `RANGE(1, 4, 3)`, wantRebuild: `RANGE(1, 4, 3)`, wantValue: []any{float64(1), float64(4)}},
+		{name: "RANGE", saql: `RANGE(1.5, 2.5)`, wantRebuild: `RANGE(1.5, 2.5)`, wantValue: []any{float64(1), float64(2)}},
+		{name: "RANGE", saql: `RANGE(1.5, 2.5, 1)`, wantRebuild: `RANGE(1.5, 2.5, 1)`, wantValue: []any{1.5, 2.5}},
+		{name: "RANGE", saql: `RANGE(1.5, 2.5, 0.5)`, wantRebuild: `RANGE(1.5, 2.5, 0.5)`, wantValue: []any{1.5, 2.0, 2.5}},
+		{name: "RANGE", saql: `RANGE(-0.75, 1.1, 0.5)`, wantRebuild: `RANGE(-0.75, 1.1, 0.5)`, wantValue: []any{-0.75, -0.25, 0.25, 0.75}},
 		{name: "ROUND", saql: `ROUND(2.49)`, wantRebuild: `ROUND(2.49)`, wantValue: 2},
 		{name: "ROUND", saql: `ROUND(2.50)`, wantRebuild: `ROUND(2.50)`, wantValue: 3},
 		{name: "ROUND", saql: `ROUND(-2.50)`, wantRebuild: `ROUND(-2.50)`, wantValue: -2},
@@ -299,15 +303,20 @@ func TestFunctions(t *testing.T) {
 		{name: "Function Error 3", saql: `ABS("abs")`, wantRebuild: `ABS("abs")`, wantEvalErr: true},
 	}
 	for _, tt := range tests {
-		parser := &Parser{}
+		tt := tt
+
+		parser := &caql.Parser{}
 
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			expr, err := parser.Parse(tt.saql)
 			if (err != nil) != tt.wantParseErr {
 				t.Errorf("Parse() error = %v, wantErr %v", err, tt.wantParseErr)
 				if expr != nil {
 					t.Error(expr.String())
 				}
+
 				return
 			}
 			if err != nil {
@@ -318,6 +327,7 @@ func TestFunctions(t *testing.T) {
 			if (err != nil) != tt.wantRebuildErr {
 				t.Error(expr.String())
 				t.Errorf("String() error = %v, wantErr %v", err, tt.wantParseErr)
+
 				return
 			}
 			if err != nil {
@@ -327,18 +337,19 @@ func TestFunctions(t *testing.T) {
 				t.Errorf("String() got = %v, want %v", got, tt.wantRebuild)
 			}
 
-			var myJson map[string]interface{}
+			var myJSON map[string]any
 			if tt.values != "" {
-				err = json.Unmarshal([]byte(tt.values), &myJson)
+				err = json.Unmarshal([]byte(tt.values), &myJSON)
 				if err != nil {
 					t.Fatal(err)
 				}
 			}
 
-			value, err := expr.Eval(myJson)
+			value, err := expr.Eval(myJSON)
 			if (err != nil) != tt.wantEvalErr {
 				t.Error(expr.String())
 				t.Errorf("Parse() error = %v, wantErr %v", err, tt.wantParseErr)
+
 				return
 			}
 			if err != nil {
@@ -367,14 +378,15 @@ func TestFunctions(t *testing.T) {
 	}
 }
 
-func jsonParse(s string) interface{} {
+func jsonParse(s string) any {
 	if s == "" {
 		return nil
 	}
-	var j interface{}
+	var j any
 	err := json.Unmarshal([]byte(s), &j)
 	if err != nil {
 		panic(s + err.Error())
 	}
+
 	return j
 }

caql/interpreter.go

@@ -10,22 +10,23 @@ import (
 
 type aqlInterpreter struct {
 	*parser.BaseCAQLParserListener
-	values map[string]interface{}
-	stack  []interface{}
+	values map[string]any
+	stack  []any
 	errs   []error
 }
 
 // push is a helper function for pushing new node to the listener Stack.
-func (s *aqlInterpreter) push(i interface{}) {
+func (s *aqlInterpreter) push(i any) {
 	s.stack = append(s.stack, i)
 }
 
 // pop is a helper function for poping a node from the listener Stack.
-func (s *aqlInterpreter) pop() (n interface{}) {
+func (s *aqlInterpreter) pop() (n any) {
 	// Check that we have nodes in the stack.
 	size := len(s.stack)
 	if size < 1 {
 		s.appendErrors(ErrStack)
+
 		return
 	}
 
@@ -35,8 +36,9 @@ func (s *aqlInterpreter) pop() (n interface{}) {
 	return
 }
 
-func (s *aqlInterpreter) binaryPop() (interface{}, interface{}) {
+func (s *aqlInterpreter) binaryPop() (any, any) {
 	right, left := s.pop(), s.pop()
+
 	return left, right
 }
 
@@ -54,17 +56,14 @@ func (s *aqlInterpreter) ExitExpression(ctx *parser.ExpressionContext) {
 		s.push(plus(s.binaryPop()))
 	case ctx.T_MINUS() != nil:
 		s.push(minus(s.binaryPop()))
-
 	case ctx.T_TIMES() != nil:
 		s.push(times(s.binaryPop()))
 	case ctx.T_DIV() != nil:
 		s.push(div(s.binaryPop()))
 	case ctx.T_MOD() != nil:
 		s.push(mod(s.binaryPop()))
-
 	case ctx.T_RANGE() != nil:
 		s.push(aqlrange(s.binaryPop()))
-
 	case ctx.T_LT() != nil && ctx.GetEq_op() == nil:
 		s.push(lt(s.binaryPop()))
 	case ctx.T_GT() != nil && ctx.GetEq_op() == nil:
@@ -73,35 +72,30 @@ func (s *aqlInterpreter) ExitExpression(ctx *parser.ExpressionContext) {
 		s.push(le(s.binaryPop()))
 	case ctx.T_GE() != nil && ctx.GetEq_op() == nil:
 		s.push(ge(s.binaryPop()))
-
 	case ctx.T_IN() != nil && ctx.GetEq_op() == nil:
 		s.push(maybeNot(ctx, in(s.binaryPop())))
-
 	case ctx.T_EQ() != nil && ctx.GetEq_op() == nil:
 		s.push(eq(s.binaryPop()))
 	case ctx.T_NE() != nil && ctx.GetEq_op() == nil:
 		s.push(ne(s.binaryPop()))
-
 	case ctx.T_ALL() != nil && ctx.GetEq_op() != nil:
 		right, left := s.pop(), s.pop()
-		s.push(all(left.([]interface{}), getOp(ctx.GetEq_op().GetTokenType()), right))
+		s.push(all(left.([]any), getOp(ctx.GetEq_op().GetTokenType()), right))
 	case ctx.T_ANY() != nil && ctx.GetEq_op() != nil:
 		right, left := s.pop(), s.pop()
-		s.push(any(left.([]interface{}), getOp(ctx.GetEq_op().GetTokenType()), right))
+		s.push(anyElement(left.([]any), getOp(ctx.GetEq_op().GetTokenType()), right))
 	case ctx.T_NONE() != nil && ctx.GetEq_op() != nil:
 		right, left := s.pop(), s.pop()
-		s.push(none(left.([]interface{}), getOp(ctx.GetEq_op().GetTokenType()), right))
-
+		s.push(none(left.([]any), getOp(ctx.GetEq_op().GetTokenType()), right))
 	case ctx.T_ALL() != nil && ctx.T_NOT() != nil && ctx.T_IN() != nil:
 		right, left := s.pop(), s.pop()
-		s.push(all(left.([]interface{}), in, right))
+		s.push(all(left.([]any), in, right))
 	case ctx.T_ANY() != nil && ctx.T_NOT() != nil && ctx.T_IN() != nil:
 		right, left := s.pop(), s.pop()
-		s.push(any(left.([]interface{}), in, right))
+		s.push(anyElement(left.([]any), in, right))
 	case ctx.T_NONE() != nil && ctx.T_NOT() != nil && ctx.T_IN() != nil:
 		right, left := s.pop(), s.pop()
-		s.push(none(left.([]interface{}), in, right))
-
+		s.push(none(left.([]any), in, right))
 	case ctx.T_LIKE() != nil:
 		m, err := like(s.binaryPop())
 		s.appendErrors(err)
@@ -114,21 +108,18 @@ func (s *aqlInterpreter) ExitExpression(ctx *parser.ExpressionContext) {
 		m, err := regexNonMatch(s.binaryPop())
 		s.appendErrors(err)
 		s.push(maybeNot(ctx, m))
-
 	case ctx.T_AND() != nil:
 		s.push(and(s.binaryPop()))
 	case ctx.T_OR() != nil:
 		s.push(or(s.binaryPop()))
-
 	case ctx.T_QUESTION() != nil && len(ctx.AllExpression()) == 3:
 		right, middle, left := s.pop(), s.pop(), s.pop()
 		s.push(ternary(left, middle, right))
 	case ctx.T_QUESTION() != nil && len(ctx.AllExpression()) == 2:
 		right, left := s.pop(), s.pop()
 		s.push(ternary(left, nil, right))
-
 	default:
-		panic("unkown expression")
+		panic("unknown expression")
 	}
 }
 
@@ -159,7 +150,7 @@ func (s *aqlInterpreter) ExitReference(ctx *parser.ReferenceContext) {
 	case ctx.DOT() != nil:
 		reference := s.pop()
 
-		s.push(reference.(map[string]interface{})[ctx.T_STRING().GetText()])
+		s.push(reference.(map[string]any)[ctx.T_STRING().GetText()])
 	case ctx.T_STRING() != nil:
 		s.push(s.getVar(ctx.T_STRING().GetText()))
 	case ctx.Compound_value() != nil:
@@ -175,14 +166,15 @@ func (s *aqlInterpreter) ExitReference(ctx *parser.ReferenceContext) {
 		if f, ok := key.(float64); ok {
 			index := int(f)
 			if index < 0 {
-				index = len(reference.([]interface{})) + index
+				index = len(reference.([]any)) + index
 			}
 
-			s.push(reference.([]interface{})[index])
+			s.push(reference.([]any)[index])
+
 			return
 		}
 
-		s.push(reference.(map[string]interface{})[key.(string)])
+		s.push(reference.(map[string]any)[key.(string)])
 	default:
 		panic(fmt.Sprintf("unexpected value: %s", ctx.GetText()))
 	}
@@ -239,17 +231,17 @@ func (s *aqlInterpreter) ExitValue_literal(ctx *parser.Value_literalContext) {
 
 // ExitArray is called when production array is exited.
 func (s *aqlInterpreter) ExitArray(ctx *parser.ArrayContext) {
-	array := []interface{}{}
+	array := []any{}
 	for range ctx.AllExpression() {
 		// prepend element
-		array = append([]interface{}{s.pop()}, array...)
+		array = append([]any{s.pop()}, array...)
 	}
 	s.push(array)
 }
 
 // ExitObject is called when production object is exited.
 func (s *aqlInterpreter) ExitObject(ctx *parser.ObjectContext) {
-	object := map[string]interface{}{}
+	object := map[string]any{}
 	for range ctx.AllObject_element() {
 		key, value := s.pop(), s.pop()
 
@@ -290,7 +282,7 @@ func (s *aqlInterpreter) ExitObject_element_name(ctx *parser.Object_element_name
 	}
 }
 
-func (s *aqlInterpreter) getVar(identifier string) interface{} {
+func (s *aqlInterpreter) getVar(identifier string) any {
 	v, ok := s.values[identifier]
 	if !ok {
 		s.appendErrors(ErrUndefined)
@@ -303,10 +295,11 @@ func maybeNot(ctx *parser.ExpressionContext, m bool) bool {
 	if ctx.T_NOT() != nil {
 		return !m
 	}
+
 	return m
 }
 
-func getOp(tokenType int) func(left, right interface{}) bool {
+func getOp(tokenType int) func(left, right any) bool {
 	switch tokenType {
 	case parser.CAQLLexerT_EQ:
 		return eq
@@ -323,33 +316,36 @@ func getOp(tokenType int) func(left, right interface{}) bool {
 	case parser.CAQLLexerT_IN:
 		return in
 	default:
-		panic("unkown token type")
+		panic("unknown token type")
 	}
 }
 
-func all(slice []interface{}, op func(interface{}, interface{}) bool, expr interface{}) bool {
+func all(slice []any, op func(any, any) bool, expr any) bool {
 	for _, e := range slice {
 		if !op(e, expr) {
 			return false
 		}
 	}
+
 	return true
 }
 
-func any(slice []interface{}, op func(interface{}, interface{}) bool, expr interface{}) bool {
+func anyElement(slice []any, op func(any, any) bool, expr any) bool {
 	for _, e := range slice {
 		if op(e, expr) {
 			return true
 		}
 	}
+
 	return false
 }
 
-func none(slice []interface{}, op func(interface{}, interface{}) bool, expr interface{}) bool {
+func none(slice []any, op func(any, any) bool, expr any) bool {
 	for _, e := range slice {
 		if op(e, expr) {
 			return false
 		}
 	}
+
 	return true
 }

caql/operations.go

@@ -10,21 +10,23 @@ import (
 
 // Logical operators https://www.arangodb.com/docs/3.7/aql/operators.html#logical-operators
 
-func or(left, right interface{}) interface{} {
+func or(left, right any) any {
 	if toBool(left) {
 		return left
 	}
+
 	return right
 }
 
-func and(left, right interface{}) interface{} {
+func and(left, right any) any {
 	if !toBool(left) {
 		return left
 	}
+
 	return right
 }
 
-func toBool(i interface{}) bool {
+func toBool(i any) bool {
 	switch v := i.(type) {
 	case nil:
 		return false
@@ -36,9 +38,9 @@ func toBool(i interface{}) bool {
 		return v != 0
 	case string:
 		return v != ""
-	case []interface{}:
+	case []any:
 		return true
-	case map[string]interface{}:
+	case map[string]any:
 		return true
 	default:
 		panic("bool conversion failed")
@@ -47,15 +49,15 @@ func toBool(i interface{}) bool {
 
 // Arithmetic operators https://www.arangodb.com/docs/3.7/aql/operators.html#arithmetic-operators
 
-func plus(left, right interface{}) float64 {
+func plus(left, right any) float64 {
 	return toNumber(left) + toNumber(right)
 }
 
-func minus(left, right interface{}) float64 {
+func minus(left, right any) float64 {
 	return toNumber(left) - toNumber(right)
 }
 
-func times(left, right interface{}) float64 {
+func times(left, right any) float64 {
 	return round(toNumber(left) * toNumber(right))
 }
 
@@ -63,19 +65,20 @@ func round(r float64) float64 {
 	return math.Round(r*100000) / 100000
 }
 
-func div(left, right interface{}) float64 {
+func div(left, right any) float64 {
 	b := toNumber(right)
 	if b == 0 {
 		return 0
 	}
+
 	return round(toNumber(left) / b)
 }
 
-func mod(left, right interface{}) float64 {
+func mod(left, right any) float64 {
 	return math.Mod(toNumber(left), toNumber(right))
 }
 
-func toNumber(i interface{}) float64 {
+func toNumber(i any) float64 {
 	switch v := i.(type) {
 	case nil:
 		return 0
@@ -83,6 +86,7 @@ func toNumber(i interface{}) float64 {
 		if v {
 			return 1
 		}
+
 		return 0
 	case float64:
 		switch {
@@ -91,22 +95,25 @@ func toNumber(i interface{}) float64 {
 		case math.IsInf(v, 0):
 			return 0
 		}
+
 		return v
 	case string:
 		f, err := strconv.ParseFloat(strings.TrimSpace(v), 64)
 		if err != nil {
 			return 0
 		}
+
 		return f
-	case []interface{}:
+	case []any:
 		if len(v) == 0 {
 			return 0
 		}
 		if len(v) == 1 {
 			return toNumber(v[0])
 		}
+
 		return 0
-	case map[string]interface{}:
+	case map[string]any:
 		return 0
 	default:
 		panic("number conversion error")
@@ -116,7 +123,7 @@ func toNumber(i interface{}) float64 {
 // Logical operators https://www.arangodb.com/docs/3.7/aql/operators.html#logical-operators
 // Order https://www.arangodb.com/docs/3.7/aql/fundamentals-type-value-order.html
 
-func eq(left, right interface{}) bool {
+func eq(left, right any) bool {
 	leftV, rightV := typeValue(left), typeValue(right)
 	if leftV != rightV {
 		return false
@@ -126,15 +133,15 @@ func eq(left, right interface{}) bool {
 		return true
 	case bool, float64, string:
 		return left == right
-	case []interface{}:
-		ra := right.([]interface{})
+	case []any:
+		ra := right.([]any)
 		max := len(l)
 		if len(ra) > max {
 			max = len(ra)
 		}
 		for i := 0; i < max; i++ {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if len(l) > i {
 				li = l[i]
 			}
@@ -146,13 +153,14 @@ func eq(left, right interface{}) bool {
 				return false
 			}
 		}
+
 		return true
-	case map[string]interface{}:
-		ro := right.(map[string]interface{})
+	case map[string]any:
+		ro := right.(map[string]any)
 
 		for _, key := range keys(l, ro) {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if lv, ok := l[key]; ok {
 				li = lv
 			}
@@ -164,17 +172,18 @@ func eq(left, right interface{}) bool {
 				return false
 			}
 		}
+
 		return true
 	default:
 		panic("unknown type")
 	}
 }
 
-func ne(left, right interface{}) bool {
+func ne(left, right any) bool {
 	return !eq(left, right)
 }
 
-func lt(left, right interface{}) bool {
+func lt(left, right any) bool {
 	leftV, rightV := typeValue(left), typeValue(right)
 	if leftV != rightV {
 		return leftV < rightV
@@ -190,15 +199,15 @@ func lt(left, right interface{}) bool {
 		return l < right.(float64)
 	case string:
 		return l < right.(string)
-	case []interface{}:
-		ra := right.([]interface{})
+	case []any:
+		ra := right.([]any)
 		max := len(l)
 		if len(ra) > max {
 			max = len(ra)
 		}
 		for i := 0; i < max; i++ {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if len(l) > i {
 				li = l[i]
 			}
@@ -210,13 +219,14 @@ func lt(left, right interface{}) bool {
 				return lt(li, rai)
 			}
 		}
+
 		return false
-	case map[string]interface{}:
-		ro := right.(map[string]interface{})
+	case map[string]any:
+		ro := right.(map[string]any)
 
 		for _, key := range keys(l, ro) {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if lv, ok := l[key]; ok {
 				li = lv
 			}
@@ -228,16 +238,17 @@ func lt(left, right interface{}) bool {
 				return lt(li, rai)
 			}
 		}
+
 		return false
 	default:
 		panic("unknown type")
 	}
 }
 
-func keys(l map[string]interface{}, ro map[string]interface{}) []string {
+func keys(l map[string]any, ro map[string]any) []string {
 	var keys []string
 	seen := map[string]bool{}
-	for _, a := range []map[string]interface{}{l, ro} {
+	for _, a := range []map[string]any{l, ro} {
 		for k := range a {
 			if _, ok := seen[k]; !ok {
 				seen[k] = true
@@ -246,10 +257,11 @@ func keys(l map[string]interface{}, ro map[string]interface{}) []string {
 		}
 	}
 	sort.Strings(keys)
+
 	return keys
 }
 
-func gt(left, right interface{}) bool {
+func gt(left, right any) bool {
 	leftV, rightV := typeValue(left), typeValue(right)
 	if leftV != rightV {
 		return leftV > rightV
@@ -265,15 +277,15 @@ func gt(left, right interface{}) bool {
 		return l > right.(float64)
 	case string:
 		return l > right.(string)
-	case []interface{}:
-		ra := right.([]interface{})
+	case []any:
+		ra := right.([]any)
 		max := len(l)
 		if len(ra) > max {
 			max = len(ra)
 		}
 		for i := 0; i < max; i++ {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if len(l) > i {
 				li = l[i]
 			}
@@ -285,13 +297,14 @@ func gt(left, right interface{}) bool {
 				return gt(li, rai)
 			}
 		}
+
 		return false
-	case map[string]interface{}:
-		ro := right.(map[string]interface{})
+	case map[string]any:
+		ro := right.(map[string]any)
 
 		for _, key := range keys(l, ro) {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if lv, ok := l[key]; ok {
 				li = lv
 			}
@@ -303,13 +316,14 @@ func gt(left, right interface{}) bool {
 				return gt(li, rai)
 			}
 		}
+
 		return false
 	default:
 		panic("unknown type")
 	}
 }
 
-func le(left, right interface{}) bool {
+func le(left, right any) bool {
 	leftV, rightV := typeValue(left), typeValue(right)
 	if leftV != rightV {
 		return leftV <= rightV
@@ -325,15 +339,15 @@ func le(left, right interface{}) bool {
 		return l <= right.(float64)
 	case string:
 		return l <= right.(string)
-	case []interface{}:
-		ra := right.([]interface{})
+	case []any:
+		ra := right.([]any)
 		max := len(l)
 		if len(ra) > max {
 			max = len(ra)
 		}
 		for i := 0; i < max; i++ {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if len(l) > i {
 				li = l[i]
 			}
@@ -345,13 +359,14 @@ func le(left, right interface{}) bool {
 				return le(li, rai)
 			}
 		}
+
 		return true
-	case map[string]interface{}:
-		ro := right.(map[string]interface{})
+	case map[string]any:
+		ro := right.(map[string]any)
 
 		for _, key := range keys(l, ro) {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if lv, ok := l[key]; ok {
 				li = lv
 			}
@@ -363,13 +378,14 @@ func le(left, right interface{}) bool {
 				return lt(li, rai)
 			}
 		}
+
 		return true
 	default:
 		panic("unknown type")
 	}
 }
 
-func ge(left, right interface{}) bool {
+func ge(left, right any) bool {
 	leftV, rightV := typeValue(left), typeValue(right)
 	if leftV != rightV {
 		return leftV >= rightV
@@ -385,15 +401,15 @@ func ge(left, right interface{}) bool {
 		return l >= right.(float64)
 	case string:
 		return l >= right.(string)
-	case []interface{}:
-		ra := right.([]interface{})
+	case []any:
+		ra := right.([]any)
 		max := len(l)
 		if len(ra) > max {
 			max = len(ra)
 		}
 		for i := 0; i < max; i++ {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if len(l) > i {
 				li = l[i]
 			}
@@ -405,13 +421,14 @@ func ge(left, right interface{}) bool {
 				return ge(li, rai)
 			}
 		}
+
 		return true
-	case map[string]interface{}:
-		ro := right.(map[string]interface{})
+	case map[string]any:
+		ro := right.(map[string]any)
 
 		for _, key := range keys(l, ro) {
-			var li interface{} = nil
-			var rai interface{} = nil
+			var li any
+			var rai any
 			if lv, ok := l[key]; ok {
 				li = lv
 			}
@@ -423,14 +440,15 @@ func ge(left, right interface{}) bool {
 				return gt(li, rai)
 			}
 		}
+
 		return true
 	default:
 		panic("unknown type")
 	}
 }
 
-func in(left, right interface{}) bool {
-	a, ok := right.([]interface{})
+func in(left, right any) bool {
+	a, ok := right.([]any)
 	if !ok {
 		return false
 	}
@@ -439,23 +457,25 @@ func in(left, right interface{}) bool {
 			return true
 		}
 	}
+
 	return false
 }
 
-func like(left, right interface{}) (bool, error) {
+func like(left, right any) (bool, error) {
 	return match(right.(string), left.(string))
 }
 
-func regexMatch(left, right interface{}) (bool, error) {
+func regexMatch(left, right any) (bool, error) {
 	return regexp.Match(right.(string), []byte(left.(string)))
 }
 
-func regexNonMatch(left, right interface{}) (bool, error) {
+func regexNonMatch(left, right any) (bool, error) {
 	m, err := regexp.Match(right.(string), []byte(left.(string)))
+
 	return !m, err
 }
 
-func typeValue(v interface{}) int {
+func typeValue(v any) int {
 	switch v.(type) {
 	case nil:
 		return 0
@@ -465,9 +485,9 @@ func typeValue(v interface{}) int {
 		return 2
 	case string:
 		return 3
-	case []interface{}:
+	case []any:
 		return 4
-	case map[string]interface{}:
+	case map[string]any:
 		return 5
 	default:
 		panic("unknown type")
@@ -476,22 +496,25 @@ func typeValue(v interface{}) int {
 
 // Ternary operator https://www.arangodb.com/docs/3.7/aql/operators.html#ternary-operator
 
-func ternary(left, middle, right interface{}) interface{} {
+func ternary(left, middle, right any) any {
 	if toBool(left) {
 		if middle != nil {
 			return middle
 		}
+
 		return left
 	}
+
 	return right
 }
 
 // Range operators https://www.arangodb.com/docs/3.7/aql/operators.html#range-operator
 
-func aqlrange(left, right interface{}) []float64 {
+func aqlrange(left, right any) []float64 {
 	var v []float64
 	for i := int(left.(float64)); i <= int(right.(float64)); i++ {
 		v = append(v, float64(i))
 	}
+
 	return v
 }

caql/parser.go

@@ -21,7 +21,7 @@ func (p *Parser) Parse(aql string) (t *Tree, err error) {
 			err = fmt.Errorf("%s", r)
 		}
 	}()
-	// Setup the input
+	// Set up the input
 	inputStream := antlr.NewInputStream(aql)
 
 	errorListener := &errorListener{}
@@ -52,7 +52,7 @@ type Tree struct {
 	prefix       string
 }
 
-func (t *Tree) Eval(values map[string]interface{}) (i interface{}, err error) {
+func (t *Tree) Eval(values map[string]any) (i any, err error) {
 	defer func() {
 		if r := recover(); r != nil {
 			err = fmt.Errorf("%s", r)
@@ -65,6 +65,7 @@ func (t *Tree) Eval(values map[string]interface{}) (i interface{}, err error) {
 	if interpreter.errs != nil {
 		return nil, interpreter.errs[0]
 	}
+
 	return interpreter.stack[0], nil
 }
 
@@ -103,7 +104,7 @@ type errorListener struct {
 	errs []error
 }
 
-func (el *errorListener) SyntaxError(recognizer antlr.Recognizer, offendingSymbol interface{}, line, column int, msg string, e antlr.RecognitionException) {
+func (el *errorListener) SyntaxError(recognizer antlr.Recognizer, offendingSymbol any, line, column int, msg string, e antlr.RecognitionException) {
 	el.errs = append(el.errs, fmt.Errorf("line "+strconv.Itoa(line)+":"+strconv.Itoa(column)+" "+msg))
 }
 

caql/rql_test.go

@@ -1,9 +1,11 @@
-package caql
+package caql_test
 
 import (
 	"encoding/json"
 	"reflect"
 	"testing"
+
+	"github.com/SecurityBrewery/catalyst/caql"
 )
 
 type MockSearcher struct{}
@@ -13,11 +15,13 @@ func (m MockSearcher) Search(_ string) (ids []string, err error) {
 }
 
 func TestParseSAQLEval(t *testing.T) {
+	t.Parallel()
+
 	tests := []struct {
 		name           string
 		saql           string
 		wantRebuild    string
-		wantValue      interface{}
+		wantValue      any
 		wantParseErr   bool
 		wantRebuildErr bool
 		wantEvalErr    bool
@@ -89,15 +93,15 @@ func TestParseSAQLEval(t *testing.T) {
 		// {name: "String 9", saql: `'this is a longer string.'`, wantRebuild: `"this is a longer string."`, wantValue: "this is a longer string."},
 		// {name: "String 10", saql: `'the path separator on Windows is \\'`, wantRebuild: `"the path separator on Windows is \\"`, wantValue: `the path separator on Windows is \`},
 
-		{name: "Array 1", saql: "[]", wantRebuild: "[]", wantValue: []interface{}{}},
-		{name: "Array 2", saql: `[true]`, wantRebuild: `[true]`, wantValue: []interface{}{true}},
-		{name: "Array 3", saql: `[1, 2, 3]`, wantRebuild: `[1, 2, 3]`, wantValue: []interface{}{float64(1), float64(2), float64(3)}},
+		{name: "Array 1", saql: "[]", wantRebuild: "[]", wantValue: []any{}},
+		{name: "Array 2", saql: `[true]`, wantRebuild: `[true]`, wantValue: []any{true}},
+		{name: "Array 3", saql: `[1, 2, 3]`, wantRebuild: `[1, 2, 3]`, wantValue: []any{float64(1), float64(2), float64(3)}},
 		{
 			name: "Array 4", saql: `[-99, "yikes!", [false, ["no"], []], 1]`, wantRebuild: `[-99, "yikes!", [false, ["no"], []], 1]`,
-			wantValue: []interface{}{-99.0, "yikes!", []interface{}{false, []interface{}{"no"}, []interface{}{}}, float64(1)},
+			wantValue: []any{-99.0, "yikes!", []any{false, []any{"no"}, []any{}}, float64(1)},
 		},
-		{name: "Array 5", saql: `[["fox", "marshal"]]`, wantRebuild: `[["fox", "marshal"]]`, wantValue: []interface{}{[]interface{}{"fox", "marshal"}}},
-		{name: "Array 6", saql: `[1, 2, 3,]`, wantRebuild: `[1, 2, 3]`, wantValue: []interface{}{float64(1), float64(2), float64(3)}},
+		{name: "Array 5", saql: `[["fox", "marshal"]]`, wantRebuild: `[["fox", "marshal"]]`, wantValue: []any{[]any{"fox", "marshal"}}},
+		{name: "Array 6", saql: `[1, 2, 3,]`, wantRebuild: `[1, 2, 3]`, wantValue: []any{float64(1), float64(2), float64(3)}},
 
 		{name: "Array Error 1", saql: "(1,2,3)", wantParseErr: true},
 		{name: "Array Access 1", saql: "u.friends[0]", wantRebuild: "u.friends[0]", wantValue: 7, values: `{"u": {"friends": [7,8,9]}}`},
@@ -105,14 +109,14 @@ func TestParseSAQLEval(t *testing.T) {
 		{name: "Array Access 3", saql: "u.friends[-1]", wantRebuild: "u.friends[-1]", wantValue: 9, values: `{"u": {"friends": [7,8,9]}}`},
 		{name: "Array Access 4", saql: "u.friends[-2]", wantRebuild: "u.friends[-2]", wantValue: 8, values: `{"u": {"friends": [7,8,9]}}`},
 
-		{name: "Object 1", saql: "{}", wantRebuild: "{}", wantValue: map[string]interface{}{}},
-		{name: "Object 2", saql: `{a: 1}`, wantRebuild: "{a: 1}", wantValue: map[string]interface{}{"a": float64(1)}},
-		{name: "Object 3", saql: `{'a': 1}`, wantRebuild: `{'a': 1}`, wantValue: map[string]interface{}{"a": float64(1)}},
-		{name: "Object 4", saql: `{"a": 1}`, wantRebuild: `{"a": 1}`, wantValue: map[string]interface{}{"a": float64(1)}},
-		{name: "Object 5", saql: `{'return': 1}`, wantRebuild: `{'return': 1}`, wantValue: map[string]interface{}{"return": float64(1)}},
-		{name: "Object 6", saql: `{"return": 1}`, wantRebuild: `{"return": 1}`, wantValue: map[string]interface{}{"return": float64(1)}},
-		{name: "Object 9", saql: `{a: 1,}`, wantRebuild: "{a: 1}", wantValue: map[string]interface{}{"a": float64(1)}},
-		{name: "Object 10", saql: `{"a": 1,}`, wantRebuild: `{"a": 1}`, wantValue: map[string]interface{}{"a": float64(1)}},
+		{name: "Object 1", saql: "{}", wantRebuild: "{}", wantValue: map[string]any{}},
+		{name: "Object 2", saql: `{a: 1}`, wantRebuild: "{a: 1}", wantValue: map[string]any{"a": float64(1)}},
+		{name: "Object 3", saql: `{'a': 1}`, wantRebuild: `{'a': 1}`, wantValue: map[string]any{"a": float64(1)}},
+		{name: "Object 4", saql: `{"a": 1}`, wantRebuild: `{"a": 1}`, wantValue: map[string]any{"a": float64(1)}},
+		{name: "Object 5", saql: `{'return': 1}`, wantRebuild: `{'return': 1}`, wantValue: map[string]any{"return": float64(1)}},
+		{name: "Object 6", saql: `{"return": 1}`, wantRebuild: `{"return": 1}`, wantValue: map[string]any{"return": float64(1)}},
+		{name: "Object 9", saql: `{a: 1,}`, wantRebuild: "{a: 1}", wantValue: map[string]any{"a": float64(1)}},
+		{name: "Object 10", saql: `{"a": 1,}`, wantRebuild: `{"a": 1}`, wantValue: map[string]any{"a": float64(1)}},
 		// {"Object 8", "{`return`: 1}", `{"return": 1}`, true},
 		// {"Object 7", "{´return´: 1}", `{"return": 1}`, true},
 		{name: "Object Error 1: return is a keyword", saql: `{like: 1}`, wantParseErr: true},
@@ -272,7 +276,7 @@ func TestParseSAQLEval(t *testing.T) {
 		{name: "Arithmetic 17", saql: `23 * {}`, wantRebuild: `23 * {}`, wantValue: 0},
 		{name: "Arithmetic 18", saql: `5 * [7]`, wantRebuild: `5 * [7]`, wantValue: 35},
 		{name: "Arithmetic 19", saql: `24 / "12"`, wantRebuild: `24 / "12"`, wantValue: 2},
-		{name: "Arithmetic Error 1: Divison by zero", saql: `1 / 0`, wantRebuild: `1 / 0`, wantValue: 0},
+		{name: "Arithmetic Error 1: Division by zero", saql: `1 / 0`, wantRebuild: `1 / 0`, wantValue: 0},
 
 		// https://www.arangodb.com/docs/3.7/aql/operators.html#ternary-operator
 		{name: "Ternary 1", saql: `u.age > 15 || u.active == true ? u.userId : null`, wantRebuild: `u.age > 15 OR u.active == true ? u.userId : null`, wantValue: 45, values: `{"u": {"active": true, "age": 2, "userId": 45}}`},
@@ -287,20 +291,24 @@ func TestParseSAQLEval(t *testing.T) {
 		{name: "Security 2", saql: `doc.value == 1 || true INSERT {foo: "bar"} IN collection //`, wantParseErr: true},
 
 		// https://www.arangodb.com/docs/3.7/aql/operators.html#operator-precedence
-		{name: "Precendence", saql: `2 > 15 && "a" != ""`, wantRebuild: `2 > 15 AND "a" != ""`, wantValue: false},
+		{name: "Precedence", saql: `2 > 15 && "a" != ""`, wantRebuild: `2 > 15 AND "a" != ""`, wantValue: false},
 	}
 	for _, tt := range tests {
-		parser := &Parser{
+		tt := tt
+		parser := &caql.Parser{
 			Searcher: &MockSearcher{},
 		}
 
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			expr, err := parser.Parse(tt.saql)
 			if (err != nil) != tt.wantParseErr {
 				t.Errorf("Parse() error = %v, wantErr %v", err, tt.wantParseErr)
 				if expr != nil {
 					t.Error(expr.String())
 				}
+
 				return
 			}
 			if err != nil {
@@ -311,6 +319,7 @@ func TestParseSAQLEval(t *testing.T) {
 			if (err != nil) != tt.wantRebuildErr {
 				t.Error(expr.String())
 				t.Errorf("String() error = %v, wantErr %v", err, tt.wantParseErr)
+
 				return
 			}
 			if err != nil {
@@ -320,18 +329,19 @@ func TestParseSAQLEval(t *testing.T) {
 				t.Errorf("String() got = %v, want %v", got, tt.wantRebuild)
 			}
 
-			var myJson map[string]interface{}
+			var myJSON map[string]any
 			if tt.values != "" {
-				err = json.Unmarshal([]byte(tt.values), &myJson)
+				err = json.Unmarshal([]byte(tt.values), &myJSON)
 				if err != nil {
 					t.Fatal(err)
 				}
 			}
 
-			value, err := expr.Eval(myJson)
+			value, err := expr.Eval(myJSON)
 			if (err != nil) != tt.wantEvalErr {
 				t.Error(expr.String())
 				t.Errorf("Parse() error = %v, wantErr %v", err, tt.wantParseErr)
+
 				return
 			}
 			if err != nil {

caql/set.go

@@ -22,19 +22,18 @@
 
 package caql
 
-import "sort"
-
-type (
-	Set struct {
-		hash map[interface{}]nothing
-	}
-
-	nothing struct{}
+import (
+	"sort"
 )
 
-// Create a new set
-func New(initial ...interface{}) *Set {
-	s := &Set{make(map[interface{}]nothing)}
+type Set struct {
+	hash map[any]nothing
+}
+
+type nothing struct{}
+
+func NewSet(initial ...any) *Set {
+	s := &Set{make(map[any]nothing)}
 
 	for _, v := range initial {
 		s.Insert(v)
@@ -43,9 +42,8 @@ func New(initial ...interface{}) *Set {
 	return s
 }
 
-// Find the difference between two sets
 func (s *Set) Difference(set *Set) *Set {
-	n := make(map[interface{}]nothing)
+	n := make(map[any]nothing)
 
 	for k := range s.hash {
 		if _, exists := set.hash[k]; !exists {
@@ -56,27 +54,18 @@ func (s *Set) Difference(set *Set) *Set {
 	return &Set{n}
 }
 
-// Call f for each item in the set
-func (s *Set) Do(f func(interface{})) {
-	for k := range s.hash {
-		f(k)
-	}
-}
-
-// Test to see whether or not the element is in the set
-func (s *Set) Has(element interface{}) bool {
+func (s *Set) Has(element any) bool {
 	_, exists := s.hash[element]
+
 	return exists
 }
 
-// Add an element to the set
-func (s *Set) Insert(element interface{}) {
+func (s *Set) Insert(element any) {
 	s.hash[element] = nothing{}
 }
 
-// Find the intersection of two sets
 func (s *Set) Intersection(set *Set) *Set {
-	n := make(map[interface{}]nothing)
+	n := make(map[any]nothing)
 
 	for k := range s.hash {
 		if _, exists := set.hash[k]; exists {
@@ -87,23 +76,20 @@ func (s *Set) Intersection(set *Set) *Set {
 	return &Set{n}
 }
 
-// Return the number of items in the set
 func (s *Set) Len() int {
 	return len(s.hash)
 }
 
-// Test whether or not this set is a proper subset of "set"
 func (s *Set) ProperSubsetOf(set *Set) bool {
 	return s.SubsetOf(set) && s.Len() < set.Len()
 }
 
-// Remove an element from the set
-func (s *Set) Remove(element interface{}) {
+func (s *Set) Remove(element any) {
 	delete(s.hash, element)
 }
 
 func (s *Set) Minus(set *Set) *Set {
-	n := make(map[interface{}]nothing)
+	n := make(map[any]nothing)
 	for k := range s.hash {
 		n[k] = nothing{}
 	}
@@ -115,7 +101,6 @@ func (s *Set) Minus(set *Set) *Set {
 	return &Set{n}
 }
 
-// Test whether or not this set is a subset of "set"
 func (s *Set) SubsetOf(set *Set) bool {
 	if s.Len() > set.Len() {
 		return false
@@ -125,12 +110,12 @@ func (s *Set) SubsetOf(set *Set) bool {
 			return false
 		}
 	}
+
 	return true
 }
 
-// Find the union of two sets
 func (s *Set) Union(set *Set) *Set {
-	n := make(map[interface{}]nothing)
+	n := make(map[any]nothing)
 
 	for k := range s.hash {
 		n[k] = nothing{}
@@ -142,8 +127,8 @@ func (s *Set) Union(set *Set) *Set {
 	return &Set{n}
 }
 
-func (s *Set) Values() []interface{} {
-	values := []interface{}{}
+func (s *Set) Values() []any {
+	values := []any{}
 
 	for k := range s.hash {
 		values = append(values, k)

caql/set_test.go

@@ -27,7 +27,9 @@ import (
 )
 
 func Test(t *testing.T) {
-	s := New()
+	t.Parallel()
+
+	s := NewSet()
 
 	s.Insert(5)
 
@@ -50,8 +52,8 @@ func Test(t *testing.T) {
 	}
 
 	// Difference
-	s1 := New(1, 2, 3, 4, 5, 6)
-	s2 := New(4, 5, 6)
+	s1 := NewSet(1, 2, 3, 4, 5, 6)
+	s2 := NewSet(4, 5, 6)
 	s3 := s1.Difference(s2)
 
 	if s3.Len() != 3 {
@@ -73,7 +75,7 @@ func Test(t *testing.T) {
 	}
 
 	// Union
-	s4 := New(7, 8, 9)
+	s4 := NewSet(7, 8, 9)
 	s3 = s2.Union(s4)
 
 	if s3.Len() != 6 {
@@ -92,5 +94,4 @@ func Test(t *testing.T) {
 	if s1.ProperSubsetOf(s1) {
 		t.Errorf("set should not be a subset of itself")
 	}
-
 }

caql/unquote.go

@@ -39,8 +39,10 @@ func unquote(s string) (string, error) {
 					buf = append(buf, s[i])
 				}
 			}
+
 			return string(buf), nil
 		}
+
 		return s, nil
 	}
 	if quote != '"' && quote != '\'' {
@@ -75,5 +77,6 @@ func unquote(s string) (string, error) {
 			buf = append(buf, runeTmp[:n]...)
 		}
 	}
+
 	return string(buf), nil
 }

caql/unquote_test.go

@@ -8,26 +8,25 @@
 package caql
 
 import (
+	"errors"
 	"strconv"
 	"testing"
 )
 
 type quoteTest struct {
-	in      string
-	out     string
-	ascii   string
-	graphic string
+	in  string
+	out string
 }
 
 var quotetests = []quoteTest{
-	{in: "\a\b\f\r\n\t\v", out: `"\a\b\f\r\n\t\v"`, ascii: `"\a\b\f\r\n\t\v"`, graphic: `"\a\b\f\r\n\t\v"`},
-	{"\\", `"\\"`, `"\\"`, `"\\"`},
-	{"abc\xffdef", `"abc\xffdef"`, `"abc\xffdef"`, `"abc\xffdef"`},
-	{"\u263a", `"☺"`, `"\u263a"`, `"☺"`},
-	{"\U0010ffff", `"\U0010ffff"`, `"\U0010ffff"`, `"\U0010ffff"`},
-	{"\x04", `"\x04"`, `"\x04"`, `"\x04"`},
+	{in: "\a\b\f\r\n\t\v", out: `"\a\b\f\r\n\t\v"`},
+	{"\\", `"\\"`},
+	{"abc\xffdef", `"abc\xffdef"`},
+	{"\u263a", `"☺"`},
+	{"\U0010ffff", `"\U0010ffff"`},
+	{"\x04", `"\x04"`},
 	// Some non-printable but graphic runes. Final column is double-quoted.
-	{"!\u00a0!\u2000!\u3000!", `"!\u00a0!\u2000!\u3000!"`, `"!\u00a0!\u2000!\u3000!"`, "\"!\u00a0!\u2000!\u3000!\""},
+	{"!\u00a0!\u2000!\u3000!", `"!\u00a0!\u2000!\u3000!"`},
 }
 
 type unQuoteTest struct {
@@ -104,6 +103,8 @@ var misquoted = []string{
 }
 
 func TestUnquote(t *testing.T) {
+	t.Parallel()
+
 	for _, tt := range unquotetests {
 		if out, err := unquote(tt.in); err != nil || out != tt.out {
 			t.Errorf("unquote(%#q) = %q, %v want %q, nil", tt.in, out, err, tt.out)
@@ -118,7 +119,7 @@ func TestUnquote(t *testing.T) {
 	}
 
 	for _, s := range misquoted {
-		if out, err := unquote(s); out != "" || err != strconv.ErrSyntax {
+		if out, err := unquote(s); out != "" || !errors.Is(err, strconv.ErrSyntax) {
 			t.Errorf("unquote(%#q) = %q, %v want %q, %v", s, out, err, "", strconv.ErrSyntax)
 		}
 	}

caql/wildcard.go

@@ -48,6 +48,7 @@ Pattern:
 		// using the star
 		if ok && (len(t) == 0 || len(pattern) > 0) {
 			name = t
+
 			continue
 		}
 		if err != nil {
@@ -64,6 +65,7 @@ Pattern:
 						continue
 					}
 					name = t
+
 					continue Pattern
 				}
 				if err != nil {
@@ -79,8 +81,10 @@ Pattern:
 				return false, err
 			}
 		}
+
 		return false, nil
 	}
+
 	return len(name) == 0, nil
 }
 
@@ -104,6 +108,7 @@ Scan:
 			break Scan
 		}
 	}
+
 	return star, pattern[0:i], pattern[i:]
 }
 
@@ -120,7 +125,6 @@ func matchChunk(chunk, s string) (rest string, ok bool, err error) {
 			failed = true
 		}
 		switch chunk[0] {
-
 		case '_':
 			if !failed {
 				if s[0] == '/' {
@@ -130,14 +134,13 @@ func matchChunk(chunk, s string) (rest string, ok bool, err error) {
 				s = s[n:]
 			}
 			chunk = chunk[1:]
-
 		case '\\':
 			chunk = chunk[1:]
 			if len(chunk) == 0 {
 				return "", false, ErrBadPattern
 			}
-			fallthrough
 
+			fallthrough
 		default:
 			if !failed {
 				if chunk[0] != s[0] {
@@ -151,5 +154,6 @@ func matchChunk(chunk, s string) (rest string, ok bool, err error) {
 	if failed {
 		return "", false, nil
 	}
+
 	return s, true, nil
 }

caql/wildcard_test.go

@@ -7,7 +7,10 @@
 
 package caql
 
-import "testing"
+import (
+	"errors"
+	"testing"
+)
 
 type MatchTest struct {
 	pattern, s string
@@ -41,9 +44,11 @@ var matchTests = []MatchTest{
 }
 
 func TestMatch(t *testing.T) {
+	t.Parallel()
+
 	for _, tt := range matchTests {
 		ok, err := match(tt.pattern, tt.s)
-		if ok != tt.match || err != tt.err {
+		if ok != tt.match || !errors.Is(err, tt.err) {
 			t.Errorf("match(%#q, %#q) = %v, %v want %v, %v", tt.pattern, tt.s, ok, err, tt.match, tt.err)
 		}
 	}

cmd/cmd.go

@@ -4,6 +4,7 @@ import (
 	"github.com/alecthomas/kong"
 	kongyaml "github.com/alecthomas/kong-yaml"
 	"github.com/coreos/go-oidc/v3/oidc"
+	"golang.org/x/exp/slices"
 	"golang.org/x/oauth2"
 
 	"github.com/SecurityBrewery/catalyst"
@@ -62,7 +63,7 @@ func MapConfig(cli CLI) (*catalyst.Config, error) {
 	roles = append(roles, role.Explodes(cli.AuthDefaultRoles)...)
 	roles = role.Explodes(role.Strings(roles))
 
-	scopes := unique(append([]string{oidc.ScopeOpenID, "profile", "email"}, cli.OIDCScopes...))
+	scopes := slices.Compact(append([]string{oidc.ScopeOpenID, "profile", "email"}, cli.OIDCScopes...))
 	config := &catalyst.Config{
 		IndexPath:       cli.IndexPath,
 		Network:         cli.Network,
@@ -83,17 +84,6 @@ func MapConfig(cli CLI) (*catalyst.Config, error) {
 		Bus:           &bus.Config{Host: cli.EmitterIOHost, Key: cli.EmitterIORKey, APIUrl: cli.CatalystAddress + "/api"},
 		InitialAPIKey: cli.InitialAPIKey,
 	}
+
 	return config, nil
 }
-
-func unique(l []string) []string {
-	keys := make(map[string]bool)
-	var list []string
-	for _, entry := range l {
-		if _, value := keys[entry]; !value {
-			keys[entry] = true
-			list = append(list, entry)
-		}
-	}
-	return list
-}

cookie.go

@@ -5,6 +5,7 @@ import (
 	"encoding/json"
 	"errors"
 	"fmt"
+	"log"
 	"net/http"
 )
 
@@ -22,15 +23,21 @@ func stateCookie(r *http.Request) (string, error) {
 	if err != nil {
 		return "", err
 	}
+
 	return stateCookie.Value, nil
 }
 
-func setClaimsCookie(w http.ResponseWriter, claims map[string]interface{}) {
-	b, _ := json.Marshal(claims)
+func setClaimsCookie(w http.ResponseWriter, claims map[string]any) {
+	b, err := json.Marshal(claims)
+	if err != nil {
+		log.Println(err)
+
+		return
+	}
 	http.SetCookie(w, &http.Cookie{Name: userSessionCookie, Value: base64.StdEncoding.EncodeToString(b)})
 }
 
-func claimsCookie(r *http.Request) (map[string]interface{}, bool, error) {
+func claimsCookie(r *http.Request) (map[string]any, bool, error) {
 	userCookie, err := r.Cookie(userSessionCookie)
 	if err != nil {
 		return nil, true, nil
@@ -41,9 +48,10 @@ func claimsCookie(r *http.Request) (map[string]interface{}, bool, error) {
 		return nil, false, fmt.Errorf("could not decode cookie: %w", err)
 	}
 
-	var claims map[string]interface{}
+	var claims map[string]any
 	if err := json.Unmarshal(b, &claims); err != nil {
 		return nil, false, errors.New("claims not in session")
 	}
+
 	return claims, false, err
 }

dag/dag.go

@@ -25,6 +25,9 @@ package dag
 import (
 	"errors"
 	"sort"
+
+	"golang.org/x/exp/maps"
+	"golang.org/x/exp/slices"
 )
 
 type Graph struct {
@@ -52,6 +55,7 @@ func (g *Graph) AddNode(name string) error {
 	}
 	g.outputs[name] = make(map[string]struct{})
 	g.inputs[name] = 0
+
 	return nil
 }
 
@@ -61,6 +65,7 @@ func (g *Graph) AddNodes(names ...string) error {
 			return err
 		}
 	}
+
 	return nil
 }
 
@@ -101,7 +106,9 @@ func (g *Graph) Toposort() ([]string, error) {
 		L = append(L, n)
 
 		ms := make([]string, len(outputs[n]))
-		for _, k := range keys(outputs[n]) {
+		keys := maps.Keys(outputs[n])
+		slices.Sort(keys)
+		for _, k := range keys {
 			m := k
 			// i := outputs[n][m]
 			// ms[i-1] = m
@@ -130,15 +137,6 @@ func (g *Graph) Toposort() ([]string, error) {
 	return L, nil
 }
 
-func keys(m map[string]struct{}) []string {
-	var keys []string
-	for k := range m {
-		keys = append(keys, k)
-	}
-	sort.Strings(keys)
-	return keys
-}
-
 func (g *Graph) GetParents(id string) []string {
 	var parents []string
 	for node, targets := range g.outputs {
@@ -147,6 +145,7 @@ func (g *Graph) GetParents(id string) []string {
 		}
 	}
 	sort.Strings(parents)
+
 	return parents
 }
 
@@ -160,5 +159,6 @@ func (g *Graph) GetRoot() (string, error) {
 	if len(roots) != 1 {
 		return "", errors.New("more than one root")
 	}
+
 	return roots[0], nil
 }

dag/dag_test.go

@@ -20,23 +20,17 @@
 // IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
 // CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
 
-package dag
+package dag_test
 
 import (
 	"reflect"
 	"testing"
 
 	"github.com/stretchr/testify/assert"
-)
+	"golang.org/x/exp/slices"
 
-func index(s []string, v string) int {
-	for i, s := range s {
-		if s == v {
-			return i
-		}
-	}
-	return -1
-}
+	"github.com/SecurityBrewery/catalyst/dag"
+)
 
 type Edge struct {
 	From string
@@ -44,13 +38,17 @@ type Edge struct {
 }
 
 func TestDuplicatedNode(t *testing.T) {
-	graph := NewGraph()
+	t.Parallel()
+
+	graph := dag.NewGraph()
 	assert.NoError(t, graph.AddNode("a"))
 	assert.Error(t, graph.AddNode("a"))
 }
 
 func TestWikipedia(t *testing.T) {
-	graph := NewGraph()
+	t.Parallel()
+
+	graph := dag.NewGraph()
 	assert.NoError(t, graph.AddNodes("2", "3", "5", "7", "8", "9", "10", "11"))
 
 	edges := []Edge{
@@ -79,27 +77,30 @@ func TestWikipedia(t *testing.T) {
 	}
 
 	for _, e := range edges {
-		if i, j := index(result, e.From), index(result, e.To); i > j {
+		if i, j := slices.Index(result, e.From), slices.Index(result, e.To); i > j {
 			t.Errorf("dependency failed: not satisfy %v(%v) > %v(%v)", e.From, i, e.To, j)
 		}
 	}
 }
 
 func TestCycle(t *testing.T) {
-	graph := NewGraph()
+	t.Parallel()
+
+	graph := dag.NewGraph()
 	assert.NoError(t, graph.AddNodes("1", "2", "3"))
 
 	assert.NoError(t, graph.AddEdge("1", "2"))
 	assert.NoError(t, graph.AddEdge("2", "3"))
 	assert.NoError(t, graph.AddEdge("3", "1"))
 
-	_, err := graph.Toposort()
-	if err == nil {
+	if _, err := graph.Toposort(); err == nil {
 		t.Errorf("closed path not detected in closed pathed graph")
 	}
 }
 
 func TestGraph_GetParents(t *testing.T) {
+	t.Parallel()
+
 	type fields struct {
 		nodes []string
 		edges map[string]string
@@ -117,8 +118,11 @@ func TestGraph_GetParents(t *testing.T) {
 		{"parents 3", fields{nodes: []string{"1", "2", "3"}, edges: map[string]string{"1": "3", "2": "3"}}, args{id: "3"}, []string{"1", "2"}},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
-			g := NewGraph()
+			t.Parallel()
+
+			g := dag.NewGraph()
 			for _, node := range tt.fields.nodes {
 				assert.NoError(t, g.AddNode(node))
 			}
@@ -134,7 +138,9 @@ func TestGraph_GetParents(t *testing.T) {
 }
 
 func TestDAG_AddNode(t *testing.T) {
-	dag := NewGraph()
+	t.Parallel()
+
+	dag := dag.NewGraph()
 
 	v := "1"
 	assert.NoError(t, dag.AddNode(v))
@@ -143,7 +149,9 @@ func TestDAG_AddNode(t *testing.T) {
 }
 
 func TestDAG_AddEdge(t *testing.T) {
-	dag := NewGraph()
+	t.Parallel()
+
+	dag := dag.NewGraph()
 	assert.NoError(t, dag.AddNode("0"))
 	assert.NoError(t, dag.AddNode("1"))
 	assert.NoError(t, dag.AddNode("2"))
@@ -162,7 +170,9 @@ func TestDAG_AddEdge(t *testing.T) {
 }
 
 func TestDAG_GetParents(t *testing.T) {
-	dag := NewGraph()
+	t.Parallel()
+
+	dag := dag.NewGraph()
 	assert.NoError(t, dag.AddNode("1"))
 	assert.NoError(t, dag.AddNode("2"))
 	assert.NoError(t, dag.AddNode("3"))
@@ -176,7 +186,9 @@ func TestDAG_GetParents(t *testing.T) {
 }
 
 func TestDAG_GetDescendants(t *testing.T) {
-	dag := NewGraph()
+	t.Parallel()
+
+	dag := dag.NewGraph()
 	assert.NoError(t, dag.AddNode("1"))
 	assert.NoError(t, dag.AddNode("2"))
 	assert.NoError(t, dag.AddNode("3"))
@@ -188,7 +200,9 @@ func TestDAG_GetDescendants(t *testing.T) {
 }
 
 func TestDAG_Topsort(t *testing.T) {
-	dag := NewGraph()
+	t.Parallel()
+
+	dag := dag.NewGraph()
 	assert.NoError(t, dag.AddNode("1"))
 	assert.NoError(t, dag.AddNode("2"))
 	assert.NoError(t, dag.AddNode("3"))
@@ -203,7 +217,9 @@ func TestDAG_Topsort(t *testing.T) {
 }
 
 func TestDAG_TopsortStable(t *testing.T) {
-	dag := NewGraph()
+	t.Parallel()
+
+	dag := dag.NewGraph()
 	assert.NoError(t, dag.AddNode("1"))
 	assert.NoError(t, dag.AddNode("2"))
 	assert.NoError(t, dag.AddNode("3"))
@@ -216,7 +232,9 @@ func TestDAG_TopsortStable(t *testing.T) {
 }
 
 func TestDAG_TopsortStable2(t *testing.T) {
-	dag := NewGraph()
+	t.Parallel()
+
+	dag := dag.NewGraph()
 
 	assert.NoError(t, dag.AddNodes("block-ioc", "block-iocs", "block-sender", "board", "fetch-iocs", "escalate", "extract-iocs", "mail-available", "search-email-gateway"))
 	assert.NoError(t, dag.AddEdge("block-iocs", "block-ioc"))

database/artifact.go

@@ -23,7 +23,7 @@ func (db *Database) ArtifactGet(ctx context.Context, id int64, name string) (*mo
 	FOR a in NOT_NULL(d.artifacts, [])
 	FILTER a.name == @name
 	RETURN a`
-	cursor, _, err := db.Query(ctx, query, mergeMaps(ticketFilterVars, map[string]interface{}{
+	cursor, _, err := db.Query(ctx, query, mergeMaps(ticketFilterVars, map[string]any{
 		"@collection": TicketCollectionName,
 		"ID":          fmt.Sprint(id),
 		"name":        name,
@@ -55,7 +55,8 @@ func (db *Database) ArtifactUpdate(ctx context.Context, id int64, name string, a
 	LET newartifacts = APPEND(REMOVE_VALUE(d.artifacts, a), @artifact)
 	UPDATE d WITH { "artifacts": newartifacts } IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{
 		"@collection": TicketCollectionName,
 		"ID":          id,
 		"name":        name,
@@ -69,7 +70,7 @@ func (db *Database) ArtifactUpdate(ctx context.Context, id int64, name string, a
 }
 
 func (db *Database) EnrichArtifact(ctx context.Context, id int64, name string, enrichmentForm *model.EnrichmentForm) (*model.TicketWithTickets, error) {
-	enrichment := model.Enrichment{time.Now().UTC(), enrichmentForm.Data, enrichmentForm.Name}
+	enrichment := model.Enrichment{Created: time.Now().UTC(), Data: enrichmentForm.Data, Name: enrichmentForm.Name}
 
 	ticketFilterQuery, ticketFilterVars, err := db.Hooks.TicketWriteFilter(ctx)
 	if err != nil {
@@ -85,7 +86,8 @@ func (db *Database) EnrichArtifact(ctx context.Context, id int64, name string, e
 	LET newartifacts = APPEND(REMOVE_VALUE(d.artifacts, a), MERGE(a, { "enrichments": newenrichments }))
 	UPDATE d WITH { "artifacts": newartifacts } IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{
 		"@collection":    TicketCollectionName,
 		"ID":             id,
 		"name":           name,

database/automation.go

@@ -10,7 +10,7 @@ import (
 	"github.com/SecurityBrewery/catalyst/generated/model"
 )
 
-func toAutomation(doc *model.AutomationForm) interface{} {
+func toAutomation(doc *model.AutomationForm) *model.Automation {
 	return &model.Automation{
 		Image:  doc.Image,
 		Script: doc.Script,
@@ -72,12 +72,13 @@ func (db *Database) AutomationUpdate(ctx context.Context, id string, automation
 
 func (db *Database) AutomationDelete(ctx context.Context, id string) error {
 	_, err := db.automationCollection.RemoveDocument(ctx, id)
+
 	return err
 }
 
 func (db *Database) AutomationList(ctx context.Context) ([]*model.AutomationResponse, error) {
 	query := "FOR d IN @@collection SORT d._key ASC RETURN UNSET(d, 'script')"
-	cursor, _, err := db.Query(ctx, query, map[string]interface{}{"@collection": AutomationCollectionName}, busdb.ReadOperation)
+	cursor, _, err := db.Query(ctx, query, map[string]any{"@collection": AutomationCollectionName}, busdb.ReadOperation)
 	if err != nil {
 		return nil, err
 	}

database/busdb/busdb.go

@@ -40,10 +40,12 @@ type Operation struct {
 	Ids  []driver.DocumentID
 }
 
-var CreateOperation = &Operation{Type: bus.DatabaseEntryCreated}
-var ReadOperation = &Operation{Type: bus.DatabaseEntryRead}
+var (
+	CreateOperation = &Operation{Type: bus.DatabaseEntryCreated}
+	ReadOperation   = &Operation{Type: bus.DatabaseEntryRead}
+)
 
-func (db BusDatabase) Query(ctx context.Context, query string, vars map[string]interface{}, operation *Operation) (cur driver.Cursor, logs *model.LogEntry, err error) {
+func (db *BusDatabase) Query(ctx context.Context, query string, vars map[string]any, operation *Operation) (cur driver.Cursor, logs *model.LogEntry, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	cur, err = db.internal.Query(ctx, query, vars)
@@ -61,31 +63,31 @@ func (db BusDatabase) Query(ctx context.Context, query string, vars map[string]i
 	return cur, logs, err
 }
 
-func (db BusDatabase) Remove(ctx context.Context) (err error) {
+func (db *BusDatabase) Remove(ctx context.Context) (err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	return db.internal.Remove(ctx)
 }
 
-func (db BusDatabase) Collection(ctx context.Context, name string) (col driver.Collection, err error) {
+func (db *BusDatabase) Collection(ctx context.Context, name string) (col driver.Collection, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	return db.internal.Collection(ctx, name)
 }
 
-type Collection struct {
+type Collection[T any] struct {
 	internal driver.Collection
 	db       *BusDatabase
 }
 
-func NewCollection(internal driver.Collection, db *BusDatabase) *Collection {
-	return &Collection{internal: internal, db: db}
+func NewCollection[T any](internal driver.Collection, db *BusDatabase) *Collection[T] {
+	return &Collection[T]{internal: internal, db: db}
 }
 
-func (c Collection) CreateDocument(ctx, newctx context.Context, key string, document interface{}) (meta driver.DocumentMeta, err error) {
+func (c *Collection[T]) CreateDocument(ctx, newctx context.Context, key string, document *T) (meta driver.DocumentMeta, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
-	meta, err = c.internal.CreateDocument(newctx, &Keyed{Key: key, Doc: document})
+	meta, err = c.internal.CreateDocument(newctx, &Keyed[T]{Key: key, Doc: document})
 	if err != nil {
 		return meta, err
 	}
@@ -94,10 +96,11 @@ func (c Collection) CreateDocument(ctx, newctx context.Context, key string, docu
 	if err != nil {
 		return meta, err
 	}
+
 	return meta, nil
 }
 
-func (c Collection) CreateEdge(ctx, newctx context.Context, edge *driver.EdgeDocument) (meta driver.DocumentMeta, err error) {
+func (c *Collection[T]) CreateEdge(ctx, newctx context.Context, edge *driver.EdgeDocument) (meta driver.DocumentMeta, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	meta, err = c.internal.CreateDocument(newctx, edge)
@@ -109,10 +112,11 @@ func (c Collection) CreateEdge(ctx, newctx context.Context, edge *driver.EdgeDoc
 	if err != nil {
 		return meta, err
 	}
+
 	return meta, nil
 }
 
-func (c Collection) CreateEdges(ctx context.Context, edges []*driver.EdgeDocument) (meta driver.DocumentMetaSlice, err error) {
+func (c *Collection[T]) CreateEdges(ctx context.Context, edges []*driver.EdgeDocument) (meta driver.DocumentMetaSlice, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	metas, errs, err := c.internal.CreateDocuments(ctx, edges)
@@ -136,13 +140,13 @@ func (c Collection) CreateEdges(ctx context.Context, edges []*driver.EdgeDocumen
 	return metas, nil
 }
 
-func (c Collection) DocumentExists(ctx context.Context, id string) (exists bool, err error) {
+func (c *Collection[T]) DocumentExists(ctx context.Context, id string) (exists bool, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	return c.internal.DocumentExists(ctx, id)
 }
 
-func (c Collection) ReadDocument(ctx context.Context, key string, result interface{}) (meta driver.DocumentMeta, err error) {
+func (c *Collection[T]) ReadDocument(ctx context.Context, key string, result *T) (meta driver.DocumentMeta, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	meta, err = c.internal.ReadDocument(ctx, key, result)
@@ -150,7 +154,7 @@ func (c Collection) ReadDocument(ctx context.Context, key string, result interfa
 	return
 }
 
-func (c Collection) UpdateDocument(ctx context.Context, key string, update interface{}) (meta driver.DocumentMeta, err error) {
+func (c *Collection[T]) UpdateDocument(ctx context.Context, key string, update any) (meta driver.DocumentMeta, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	meta, err = c.internal.UpdateDocument(ctx, key, update)
@@ -161,7 +165,7 @@ func (c Collection) UpdateDocument(ctx context.Context, key string, update inter
 	return meta, c.db.bus.PublishDatabaseUpdate([]driver.DocumentID{meta.ID}, bus.DatabaseEntryUpdated)
 }
 
-func (c Collection) ReplaceDocument(ctx context.Context, key string, document interface{}) (meta driver.DocumentMeta, err error) {
+func (c *Collection[T]) ReplaceDocument(ctx context.Context, key string, document *T) (meta driver.DocumentMeta, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	meta, err = c.internal.ReplaceDocument(ctx, key, document)
@@ -172,13 +176,13 @@ func (c Collection) ReplaceDocument(ctx context.Context, key string, document in
 	return meta, c.db.bus.PublishDatabaseUpdate([]driver.DocumentID{meta.ID}, bus.DatabaseEntryUpdated)
 }
 
-func (c Collection) RemoveDocument(ctx context.Context, formatInt string) (meta driver.DocumentMeta, err error) {
+func (c *Collection[T]) RemoveDocument(ctx context.Context, formatInt string) (meta driver.DocumentMeta, err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	return c.internal.RemoveDocument(ctx, formatInt)
 }
 
-func (c Collection) Truncate(ctx context.Context) (err error) {
+func (c *Collection[T]) Truncate(ctx context.Context) (err error) {
 	defer func() { err = toHTTPErr(err) }()
 
 	return c.internal.Truncate(ctx)
@@ -190,7 +194,9 @@ func toHTTPErr(err error) error {
 		if errors.As(err, &ae) {
 			return &api.HTTPError{Status: ae.Code, Internal: err}
 		}
+
 		return err
 	}
+
 	return nil
 }

database/busdb/context.go

@@ -8,9 +8,11 @@ import (
 	"github.com/SecurityBrewery/catalyst/role"
 )
 
+type contextKey string
+
 const (
-	userContextKey  = "user"
-	groupContextKey = "groups"
+	userContextKey  contextKey = "user"
+	groupContextKey contextKey = "groups"
 )
 
 func SetContext(r *http.Request, user *model.UserResponse) *http.Request {
@@ -25,10 +27,12 @@ func SetGroupContext(r *http.Request, groups []string) *http.Request {
 
 func UserContext(ctx context.Context, user *model.UserResponse) context.Context {
 	user.Roles = role.Strings(role.Explodes(user.Roles))
+
 	return context.WithValue(ctx, userContextKey, user)
 }
 
 func UserFromContext(ctx context.Context) (*model.UserResponse, bool) {
 	u, ok := ctx.Value(userContextKey).(*model.UserResponse)
+
 	return u, ok
 }

database/busdb/keyed.go

@@ -2,18 +2,18 @@ package busdb
 
 import "encoding/json"
 
-type Keyed struct {
+type Keyed[T any] struct {
 	Key string
-	Doc interface{}
+	Doc *T
 }
 
-func (p Keyed) MarshalJSON() ([]byte, error) {
+func (p *Keyed[T]) MarshalJSON() ([]byte, error) {
 	b, err := json.Marshal(p.Doc)
 	if err != nil {
 		panic(err)
 	}
 
-	var m map[string]interface{}
+	var m map[string]any
 	err = json.Unmarshal(b, &m)
 	if err != nil {
 		panic(err)

database/busdb/log.go

@@ -3,6 +3,7 @@ package busdb
 import (
 	"context"
 	"errors"
+	"log"
 	"strings"
 
 	"github.com/arangodb/go-driver"
@@ -45,7 +46,12 @@ func (db *BusDatabase) LogBatchCreate(ctx context.Context, logentries []*model.L
 		}
 	}
 	if ids != nil {
-		go db.bus.PublishDatabaseUpdate(ids, bus.DatabaseEntryCreated)
+		go func() {
+			err := db.bus.PublishDatabaseUpdate(ids, bus.DatabaseEntryCreated)
+			if err != nil {
+				log.Println(err)
+			}
+		}()
 	}
 
 	_, errs, err := db.logCollection.CreateDocuments(ctx, logentries)
@@ -62,7 +68,7 @@ func (db *BusDatabase) LogBatchCreate(ctx context.Context, logentries []*model.L
 
 func (db *BusDatabase) LogList(ctx context.Context, reference string) ([]*model.LogEntry, error) {
 	query := "FOR d IN @@collection FILTER d.reference == @reference SORT d.created DESC RETURN d"
-	cursor, err := db.internal.Query(ctx, query, map[string]interface{}{
+	cursor, err := db.internal.Query(ctx, query, map[string]any{
 		"@collection": LogCollectionName,
 		"reference":   reference,
 	})

database/dashboard.go

@@ -72,12 +72,13 @@ func (db *Database) DashboardUpdate(ctx context.Context, id string, dashboard *m
 
 func (db *Database) DashboardDelete(ctx context.Context, id string) error {
 	_, err := db.dashboardCollection.RemoveDocument(ctx, id)
+
 	return err
 }
 
 func (db *Database) DashboardList(ctx context.Context) ([]*model.DashboardResponse, error) {
 	query := "FOR d IN @@collection RETURN d"
-	cursor, _, err := db.Query(ctx, query, map[string]interface{}{"@collection": DashboardCollectionName}, busdb.ReadOperation)
+	cursor, _, err := db.Query(ctx, query, map[string]any{"@collection": DashboardCollectionName}, busdb.ReadOperation)
 	if err != nil {
 		return nil, err
 	}
@@ -103,15 +104,16 @@ func (db *Database) parseWidgets(dashboard *model.Dashboard) error {
 
 		_, err := parser.Parse(widget.Aggregation)
 		if err != nil {
-			return fmt.Errorf("invalid aggregation query (%s): syntax error\n", widget.Aggregation)
+			return fmt.Errorf("invalid aggregation query (%s): syntax error", widget.Aggregation)
 		}
 
 		if widget.Filter != nil {
 			_, err := parser.Parse(*widget.Filter)
 			if err != nil {
-				return fmt.Errorf("invalid filter query (%s): syntax error\n", *widget.Filter)
+				return fmt.Errorf("invalid filter query (%s): syntax error", *widget.Filter)
 			}
 		}
 	}
+
 	return nil
 }

database/db.go

@@ -11,6 +11,7 @@ import (
 	"github.com/SecurityBrewery/catalyst/bus"
 	"github.com/SecurityBrewery/catalyst/database/busdb"
 	"github.com/SecurityBrewery/catalyst/database/migrations"
+	"github.com/SecurityBrewery/catalyst/generated/model"
 	"github.com/SecurityBrewery/catalyst/hooks"
 	"github.com/SecurityBrewery/catalyst/index"
 )
@@ -38,18 +39,18 @@ type Database struct {
 	bus   *bus.Bus
 	Hooks *hooks.Hooks
 
-	templateCollection   *busdb.Collection
-	ticketCollection     *busdb.Collection
-	playbookCollection   *busdb.Collection
-	automationCollection *busdb.Collection
-	userdataCollection   *busdb.Collection
-	userCollection       *busdb.Collection
-	tickettypeCollection *busdb.Collection
-	jobCollection        *busdb.Collection
-	settingsCollection   *busdb.Collection
-	dashboardCollection  *busdb.Collection
+	templateCollection   *busdb.Collection[model.TicketTemplate]
+	ticketCollection     *busdb.Collection[model.Ticket]
+	playbookCollection   *busdb.Collection[model.PlaybookTemplate]
+	automationCollection *busdb.Collection[model.Automation]
+	userdataCollection   *busdb.Collection[model.UserData]
+	userCollection       *busdb.Collection[model.User]
+	tickettypeCollection *busdb.Collection[model.TicketType]
+	jobCollection        *busdb.Collection[model.Job]
+	settingsCollection   *busdb.Collection[model.Settings]
+	dashboardCollection  *busdb.Collection[model.Dashboard]
 
-	relatedCollection *busdb.Collection
+	relatedCollection *busdb.Collection[driver.EdgeDocument]
 	// containsCollection *busdb.Collection
 }
 
@@ -145,17 +146,17 @@ func New(ctx context.Context, index *index.Index, bus *bus.Bus, hooks *hooks.Hoo
 		bus:                  bus,
 		Index:                index,
 		Hooks:                hooks,
-		templateCollection:   busdb.NewCollection(templateCollection, hookedDB),
-		ticketCollection:     busdb.NewCollection(ticketCollection, hookedDB),
-		playbookCollection:   busdb.NewCollection(playbookCollection, hookedDB),
-		automationCollection: busdb.NewCollection(automationCollection, hookedDB),
-		relatedCollection:    busdb.NewCollection(relatedCollection, hookedDB),
-		userdataCollection:   busdb.NewCollection(userdataCollection, hookedDB),
-		userCollection:       busdb.NewCollection(userCollection, hookedDB),
-		tickettypeCollection: busdb.NewCollection(tickettypeCollection, hookedDB),
-		jobCollection:        busdb.NewCollection(jobCollection, hookedDB),
-		settingsCollection:   busdb.NewCollection(settingsCollection, hookedDB),
-		dashboardCollection:  busdb.NewCollection(dashboardCollection, hookedDB),
+		templateCollection:   busdb.NewCollection[model.TicketTemplate](templateCollection, hookedDB),
+		ticketCollection:     busdb.NewCollection[model.Ticket](ticketCollection, hookedDB),
+		playbookCollection:   busdb.NewCollection[model.PlaybookTemplate](playbookCollection, hookedDB),
+		automationCollection: busdb.NewCollection[model.Automation](automationCollection, hookedDB),
+		userdataCollection:   busdb.NewCollection[model.UserData](userdataCollection, hookedDB),
+		userCollection:       busdb.NewCollection[model.User](userCollection, hookedDB),
+		tickettypeCollection: busdb.NewCollection[model.TicketType](tickettypeCollection, hookedDB),
+		jobCollection:        busdb.NewCollection[model.Job](jobCollection, hookedDB),
+		settingsCollection:   busdb.NewCollection[model.Settings](settingsCollection, hookedDB),
+		dashboardCollection:  busdb.NewCollection[model.Dashboard](dashboardCollection, hookedDB),
+		relatedCollection:    busdb.NewCollection[driver.EdgeDocument](relatedCollection, hookedDB),
 	}
 
 	return db, nil
@@ -194,16 +195,16 @@ func SetupDB(ctx context.Context, client driver.Client, dbName string) (driver.D
 }
 
 func (db *Database) Truncate(ctx context.Context) {
-	db.templateCollection.Truncate(ctx)
-	db.ticketCollection.Truncate(ctx)
-	db.playbookCollection.Truncate(ctx)
-	db.automationCollection.Truncate(ctx)
-	db.userdataCollection.Truncate(ctx)
-	db.userCollection.Truncate(ctx)
-	db.tickettypeCollection.Truncate(ctx)
-	db.jobCollection.Truncate(ctx)
-	db.relatedCollection.Truncate(ctx)
-	db.settingsCollection.Truncate(ctx)
-	db.dashboardCollection.Truncate(ctx)
+	_ = db.templateCollection.Truncate(ctx)
+	_ = db.ticketCollection.Truncate(ctx)
+	_ = db.playbookCollection.Truncate(ctx)
+	_ = db.automationCollection.Truncate(ctx)
+	_ = db.userdataCollection.Truncate(ctx)
+	_ = db.userCollection.Truncate(ctx)
+	_ = db.tickettypeCollection.Truncate(ctx)
+	_ = db.jobCollection.Truncate(ctx)
+	_ = db.relatedCollection.Truncate(ctx)
+	_ = db.settingsCollection.Truncate(ctx)
+	_ = db.dashboardCollection.Truncate(ctx)
 	// db.containsCollection.Truncate(ctx)
 }

database/job.go

@@ -38,7 +38,7 @@ func (db *Database) toJobResponse(ctx context.Context, key string, doc *model.Jo
 		inspect, err := cli.ContainerInspect(ctx, key)
 		if err != nil || inspect.State == nil {
 			if update {
-				db.JobUpdate(ctx, key, &model.JobUpdate{
+				_, _ = db.JobUpdate(ctx, key, &model.JobUpdate{
 					Status:  doc.Status,
 					Running: false,
 				})
@@ -46,7 +46,7 @@ func (db *Database) toJobResponse(ctx context.Context, key string, doc *model.Jo
 		} else if doc.Status != inspect.State.Status {
 			status = inspect.State.Status
 			if update {
-				db.JobUpdate(ctx, key, &model.JobUpdate{
+				_, _ = db.JobUpdate(ctx, key, &model.JobUpdate{
 					Status:  status,
 					Running: doc.Running,
 				})
@@ -107,7 +107,7 @@ func (db *Database) JobUpdate(ctx context.Context, id string, job *model.JobUpda
 func (db *Database) JobLogAppend(ctx context.Context, id string, logLine string) error {
 	query := `LET d = DOCUMENT(@@collection, @ID)
 	UPDATE d WITH { "log": CONCAT(NOT_NULL(d.log, ""), @logline) } IN @@collection`
-	cur, _, err := db.Query(ctx, query, map[string]interface{}{
+	cur, _, err := db.Query(ctx, query, map[string]any{
 		"@collection": JobCollectionName,
 		"ID":          id,
 		"logline":     logLine,
@@ -125,10 +125,10 @@ func (db *Database) JobLogAppend(ctx context.Context, id string, logLine string)
 	return nil
 }
 
-func (db *Database) JobComplete(ctx context.Context, id string, out interface{}) error {
+func (db *Database) JobComplete(ctx context.Context, id string, out any) error {
 	query := `LET d = DOCUMENT(@@collection, @ID)
 	UPDATE d WITH { "output": @out, "status": "completed", "running": false } IN @@collection`
-	cur, _, err := db.Query(ctx, query, map[string]interface{}{
+	cur, _, err := db.Query(ctx, query, map[string]any{
 		"@collection": JobCollectionName,
 		"ID":          id,
 		"out":         out,
@@ -148,12 +148,13 @@ func (db *Database) JobComplete(ctx context.Context, id string, out interface{})
 
 func (db *Database) JobDelete(ctx context.Context, id string) error {
 	_, err := db.jobCollection.RemoveDocument(ctx, id)
+
 	return err
 }
 
 func (db *Database) JobList(ctx context.Context) ([]*model.JobResponse, error) {
 	query := "FOR d IN @@collection RETURN d"
-	cursor, _, err := db.Query(ctx, query, map[string]interface{}{"@collection": JobCollectionName}, busdb.ReadOperation)
+	cursor, _, err := db.Query(ctx, query, map[string]any{"@collection": JobCollectionName}, busdb.ReadOperation)
 	if err != nil {
 		return nil, err
 	}
@@ -188,24 +189,24 @@ func publishJobMapping(id, automation string, contextStructs *model.Context, ori
 	return publishJob(id, automation, contextStructs, origin, msg, db)
 }
 
-func publishJob(id, automation string, contextStructs *model.Context, origin *model.Origin, payload map[string]interface{}, db *Database) error {
+func publishJob(id, automation string, contextStructs *model.Context, origin *model.Origin, payload map[string]any, db *Database) error {
 	return db.bus.PublishJob(id, automation, payload, contextStructs, origin)
 }
 
-func generatePayload(msgMapping map[string]string, contextStructs *model.Context) (map[string]interface{}, error) {
-	contextJson, err := json.Marshal(contextStructs)
+func generatePayload(msgMapping map[string]string, contextStructs *model.Context) (map[string]any, error) {
+	contextJSON, err := json.Marshal(contextStructs)
 	if err != nil {
 		return nil, err
 	}
 
-	automationContext := map[string]interface{}{}
-	err = json.Unmarshal(contextJson, &automationContext)
+	automationContext := map[string]any{}
+	err = json.Unmarshal(contextJSON, &automationContext)
 	if err != nil {
 		return nil, err
 	}
 
 	parser := caql.Parser{}
-	msg := map[string]interface{}{}
+	msg := map[string]any{}
 	for arg, expr := range msgMapping {
 		tree, err := parser.Parse(expr)
 		if err != nil {
@@ -218,5 +219,6 @@ func generatePayload(msgMapping map[string]string, contextStructs *model.Context
 		}
 		msg[arg] = v
 	}
+
 	return msg, nil
 }

database/migrations/migrations.go

@@ -32,34 +32,34 @@ func generateMigrations() ([]Migration, error) {
 
 		&createGraph{ID: "create-ticket-graph", Name: "Graph", EdgeDefinitions: []driver.EdgeDefinition{{Collection: "related", From: []string{"tickets"}, To: []string{"tickets"}}}},
 
-		&createDocument{ID: "create-template-default", Collection: "templates", Document: &busdb.Keyed{Key: "default", Doc: model.TicketTemplate{Schema: DefaultTemplateSchema, Name: "Default"}}},
-		&createDocument{ID: "create-automation-vt.hash", Collection: "automations", Document: &busdb.Keyed{Key: "vt.hash", Doc: model.Automation{Image: "docker.io/python:3", Script: VTHashAutomation}}},
-		&createDocument{ID: "create-automation-comment", Collection: "automations", Document: &busdb.Keyed{Key: "comment", Doc: model.Automation{Image: "docker.io/python:3", Script: CommentAutomation}}},
-		&createDocument{ID: "create-automation-hash.sha1", Collection: "automations", Document: &busdb.Keyed{Key: "hash.sha1", Doc: model.Automation{Image: "docker.io/python:3", Script: SHA1HashAutomation}}},
-		&createDocument{ID: "create-playbook-malware", Collection: "playbooks", Document: &busdb.Keyed{Key: "malware", Doc: model.PlaybookTemplate{Name: "Malware", Yaml: MalwarePlaybook}}},
-		&createDocument{ID: "create-playbook-phishing", Collection: "playbooks", Document: &busdb.Keyed{Key: "phishing", Doc: model.PlaybookTemplate{Name: "Phishing", Yaml: PhishingPlaybook}}},
-		&createDocument{ID: "create-tickettype-alert", Collection: "tickettypes", Document: &busdb.Keyed{Key: "alert", Doc: model.TicketType{Name: "Alerts", Icon: "mdi-alert", DefaultTemplate: "default", DefaultPlaybooks: []string{}, DefaultGroups: nil}}},
-		&createDocument{ID: "create-tickettype-incident", Collection: "tickettypes", Document: &busdb.Keyed{Key: "incident", Doc: model.TicketType{Name: "Incidents", Icon: "mdi-radioactive", DefaultTemplate: "default", DefaultPlaybooks: []string{}, DefaultGroups: nil}}},
-		&createDocument{ID: "create-tickettype-investigation", Collection: "tickettypes", Document: &busdb.Keyed{Key: "investigation", Doc: model.TicketType{Name: "Forensic Investigations", Icon: "mdi-fingerprint", DefaultTemplate: "default", DefaultPlaybooks: []string{}, DefaultGroups: nil}}},
-		&createDocument{ID: "create-tickettype-hunt", Collection: "tickettypes", Document: &busdb.Keyed{Key: "hunt", Doc: model.TicketType{Name: "Threat Hunting", Icon: "mdi-target", DefaultTemplate: "default", DefaultPlaybooks: []string{}, DefaultGroups: nil}}},
+		&createDocument[busdb.Keyed[model.TicketTemplate]]{ID: "create-template-default", Collection: "templates", Document: &busdb.Keyed[model.TicketTemplate]{Key: "default", Doc: &model.TicketTemplate{Schema: DefaultTemplateSchema, Name: "Default"}}},
+		&createDocument[busdb.Keyed[model.Automation]]{ID: "create-automation-vt.hash", Collection: "automations", Document: &busdb.Keyed[model.Automation]{Key: "vt.hash", Doc: &model.Automation{Image: "docker.io/python:3", Script: VTHashAutomation}}},
+		&createDocument[busdb.Keyed[model.Automation]]{ID: "create-automation-comment", Collection: "automations", Document: &busdb.Keyed[model.Automation]{Key: "comment", Doc: &model.Automation{Image: "docker.io/python:3", Script: CommentAutomation}}},
+		&createDocument[busdb.Keyed[model.Automation]]{ID: "create-automation-hash.sha1", Collection: "automations", Document: &busdb.Keyed[model.Automation]{Key: "hash.sha1", Doc: &model.Automation{Image: "docker.io/python:3", Script: SHA1HashAutomation}}},
+		&createDocument[busdb.Keyed[model.PlaybookTemplate]]{ID: "create-playbook-malware", Collection: "playbooks", Document: &busdb.Keyed[model.PlaybookTemplate]{Key: "malware", Doc: &model.PlaybookTemplate{Name: "Malware", Yaml: MalwarePlaybook}}},
+		&createDocument[busdb.Keyed[model.PlaybookTemplate]]{ID: "create-playbook-phishing", Collection: "playbooks", Document: &busdb.Keyed[model.PlaybookTemplate]{Key: "phishing", Doc: &model.PlaybookTemplate{Name: "Phishing", Yaml: PhishingPlaybook}}},
+		&createDocument[busdb.Keyed[model.TicketType]]{ID: "create-tickettype-alert", Collection: "tickettypes", Document: &busdb.Keyed[model.TicketType]{Key: "alert", Doc: &model.TicketType{Name: "Alerts", Icon: "mdi-alert", DefaultTemplate: "default", DefaultPlaybooks: []string{}, DefaultGroups: nil}}},
+		&createDocument[busdb.Keyed[model.TicketType]]{ID: "create-tickettype-incident", Collection: "tickettypes", Document: &busdb.Keyed[model.TicketType]{Key: "incident", Doc: &model.TicketType{Name: "Incidents", Icon: "mdi-radioactive", DefaultTemplate: "default", DefaultPlaybooks: []string{}, DefaultGroups: nil}}},
+		&createDocument[busdb.Keyed[model.TicketType]]{ID: "create-tickettype-investigation", Collection: "tickettypes", Document: &busdb.Keyed[model.TicketType]{Key: "investigation", Doc: &model.TicketType{Name: "Forensic Investigations", Icon: "mdi-fingerprint", DefaultTemplate: "default", DefaultPlaybooks: []string{}, DefaultGroups: nil}}},
+		&createDocument[busdb.Keyed[model.TicketType]]{ID: "create-tickettype-hunt", Collection: "tickettypes", Document: &busdb.Keyed[model.TicketType]{Key: "hunt", Doc: &model.TicketType{Name: "Threat Hunting", Icon: "mdi-target", DefaultTemplate: "default", DefaultPlaybooks: []string{}, DefaultGroups: nil}}},
 
 		&updateSchema{ID: "update-automation-collection-1", Name: "automations", DataType: "automation", Schema: `{"properties":{"image":{"type":"string"},"script":{"type":"string"}},"required":["image","script"],"type":"object"}`},
-		&updateDocument{ID: "update-automation-vt.hash-1", Collection: "automations", Key: "vt.hash", Document: model.Automation{Image: "docker.io/python:3", Script: VTHashAutomation, Schema: pointer.String(`{"title":"Input","type":"object","properties":{"default":{"type":"string","title":"Value"}},"required":["default"]}`), Type: []string{"global", "artifact", "playbook"}}},
-		&updateDocument{ID: "update-automation-comment-1", Collection: "automations", Key: "comment", Document: model.Automation{Image: "docker.io/python:3", Script: CommentAutomation, Type: []string{"playbook"}}},
-		&updateDocument{ID: "update-automation-hash.sha1-1", Collection: "automations", Key: "hash.sha1", Document: model.Automation{Image: "docker.io/python:3", Script: SHA1HashAutomation, Schema: pointer.String(`{"title":"Input","type":"object","properties":{"default":{"type":"string","title":"Value"}},"required":["default"]}`), Type: []string{"global", "artifact", "playbook"}}},
+		&updateDocument[model.Automation]{ID: "update-automation-vt.hash-1", Collection: "automations", Key: "vt.hash", Document: &model.Automation{Image: "docker.io/python:3", Script: VTHashAutomation, Schema: pointer.String(`{"title":"Input","type":"object","properties":{"default":{"type":"string","title":"Value"}},"required":["default"]}`), Type: []string{"global", "artifact", "playbook"}}},
+		&updateDocument[model.Automation]{ID: "update-automation-comment-1", Collection: "automations", Key: "comment", Document: &model.Automation{Image: "docker.io/python:3", Script: CommentAutomation, Type: []string{"playbook"}}},
+		&updateDocument[model.Automation]{ID: "update-automation-hash.sha1-1", Collection: "automations", Key: "hash.sha1", Document: &model.Automation{Image: "docker.io/python:3", Script: SHA1HashAutomation, Schema: pointer.String(`{"title":"Input","type":"object","properties":{"default":{"type":"string","title":"Value"}},"required":["default"]}`), Type: []string{"global", "artifact", "playbook"}}},
 
 		&createCollection{ID: "create-job-collection", Name: "jobs", DataType: "job", Schema: `{"properties":{"automation":{"type":"string"},"log":{"type":"string"},"payload":{},"origin":{"properties":{"artifact_origin":{"properties":{"artifact":{"type":"string"},"ticket_id":{"format":"int64","type":"integer"}},"required":["artifact","ticket_id"],"type":"object"},"task_origin":{"properties":{"playbook_id":{"type":"string"},"task_id":{"type":"string"},"ticket_id":{"format":"int64","type":"integer"}},"required":["playbook_id","task_id","ticket_id"],"type":"object"}},"type":"object"},"output":{"properties":{},"type":"object"},"running":{"type":"boolean"},"status":{"type":"string"}},"required":["automation","running","status"],"type":"object"}`},
 
-		&createDocument{ID: "create-playbook-simple", Collection: "playbooks", Document: &busdb.Keyed{Key: "simple", Doc: model.PlaybookTemplate{Name: "Simple", Yaml: SimplePlaybook}}},
+		&createDocument[busdb.Keyed[model.PlaybookTemplate]]{ID: "create-playbook-simple", Collection: "playbooks", Document: &busdb.Keyed[model.PlaybookTemplate]{Key: "simple", Doc: &model.PlaybookTemplate{Name: "Simple", Yaml: SimplePlaybook}}},
 
 		&createCollection{ID: "create-settings-collection", Name: "settings", DataType: "settings", Schema: `{"type":"object","properties":{"artifactStates":{"title":"Artifact States","items":{"type":"object","properties":{"color":{"title":"Color","type":"string","enum":["error","info","success","warning"]},"icon":{"title":"Icon (https://materialdesignicons.com)","type":"string"},"id":{"title":"ID","type":"string"},"name":{"title":"Name","type":"string"}},"required":["id","name","icon"]},"type":"array"},"artifactKinds":{"title":"Artifact Kinds","items":{"type":"object","properties":{"color":{"title":"Color","type":"string","enum":["error","info","success","warning"]},"icon":{"title":"Icon (https://materialdesignicons.com)","type":"string"},"id":{"title":"ID","type":"string"},"name":{"title":"Name","type":"string"}},"required":["id","name","icon"]},"type":"array"},"timeformat":{"title":"Time Format","type":"string"}},"required":["timeformat","artifactKinds","artifactStates"]}`},
-		&createDocument{ID: "create-settings-global", Collection: "settings", Document: &busdb.Keyed{Key: "global", Doc: model.Settings{ArtifactStates: []*model.Type{{Icon: "mdi-help-circle-outline", ID: "unknown", Name: "Unknown", Color: pointer.String(model.TypeColorInfo)}, {Icon: "mdi-skull", ID: "malicious", Name: "Malicious", Color: pointer.String(model.TypeColorError)}, {Icon: "mdi-check", ID: "clean", Name: "Clean", Color: pointer.String(model.TypeColorSuccess)}}, ArtifactKinds: []*model.Type{{Icon: "mdi-server", ID: "asset", Name: "Asset"}, {Icon: "mdi-bullseye", ID: "ioc", Name: "IOC"}}, Timeformat: "YYYY-MM-DDThh:mm:ss"}}},
+		&createDocument[busdb.Keyed[model.Settings]]{ID: "create-settings-global", Collection: "settings", Document: &busdb.Keyed[model.Settings]{Key: "global", Doc: &model.Settings{ArtifactStates: []*model.Type{{Icon: "mdi-help-circle-outline", ID: "unknown", Name: "Unknown", Color: pointer.String(model.TypeColorInfo)}, {Icon: "mdi-skull", ID: "malicious", Name: "Malicious", Color: pointer.String(model.TypeColorError)}, {Icon: "mdi-check", ID: "clean", Name: "Clean", Color: pointer.String(model.TypeColorSuccess)}}, ArtifactKinds: []*model.Type{{Icon: "mdi-server", ID: "asset", Name: "Asset"}, {Icon: "mdi-bullseye", ID: "ioc", Name: "IOC"}}, Timeformat: "YYYY-MM-DDThh:mm:ss"}}},
 
 		&updateSchema{ID: "update-ticket-collection", Name: "tickets", DataType: "ticket", Schema: `{"properties":{"artifacts":{"items":{"properties":{"enrichments":{"additionalProperties":{"properties":{"created":{"format":"date-time","type":"string"},"data":{"example":{"hash":"b7a067a742c20d07a7456646de89bc2d408a1153"},"properties":{},"type":"object"},"name":{"example":"hash.sha1","type":"string"}},"required":["created","data","name"],"type":"object"},"type":"object"},"name":{"example":"2.2.2.2","type":"string"},"status":{"example":"Unknown","type":"string"},"type":{"type":"string"},"kind":{"type":"string"}},"required":["name"],"type":"object"},"type":"array"},"comments":{"items":{"properties":{"created":{"format":"date-time","type":"string"},"creator":{"type":"string"},"message":{"type":"string"}},"required":["created","creator","message"],"type":"object"},"type":"array"},"created":{"format":"date-time","type":"string"},"details":{"example":{"description":"my little incident"},"properties":{},"type":"object"},"files":{"items":{"properties":{"key":{"example":"myfile","type":"string"},"name":{"example":"notes.docx","type":"string"}},"required":["key","name"],"type":"object"},"type":"array"},"modified":{"format":"date-time","type":"string"},"name":{"example":"WannyCry","type":"string"},"owner":{"example":"bob","type":"string"},"playbooks":{"additionalProperties":{"properties":{"name":{"example":"Phishing","type":"string"},"tasks":{"additionalProperties":{"properties":{"automation":{"type":"string"},"closed":{"format":"date-time","type":"string"},"created":{"format":"date-time","type":"string"},"data":{"properties":{},"type":"object"},"done":{"type":"boolean"},"join":{"example":false,"type":"boolean"},"payload":{"additionalProperties":{"type":"string"},"type":"object"},"name":{"example":"Inform user","type":"string"},"next":{"additionalProperties":{"type":"string"},"type":"object"},"owner":{"type":"string"},"schema":{"properties":{},"type":"object"},"type":{"enum":["task","input","automation"],"example":"task","type":"string"}},"required":["created","done","name","type"],"type":"object"},"type":"object"}},"required":["name","tasks"],"type":"object"},"type":"object"},"read":{"example":["bob"],"items":{"type":"string"},"type":"array"},"references":{"items":{"properties":{"href":{"example":"https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2017-0144","type":"string"},"name":{"example":"CVE-2017-0144","type":"string"}},"required":["href","name"],"type":"object"},"type":"array"},"schema":{"example":"{}","type":"string"},"status":{"example":"open","type":"string"},"type":{"example":"incident","type":"string"},"write":{"example":["alice"],"items":{"type":"string"},"type":"array"}},"required":["created","modified","name","schema","status","type"],"type":"object"}`},
 
 		&createCollection{ID: "create-dashboard-collection", Name: "dashboards", DataType: "dashboards", Schema: `{"type":"object","properties":{"name":{"type":"string"},"widgets":{"items":{"type":"object","properties":{"aggregation":{"type":"string"},"filter":{"type":"string"},"name":{"type":"string"},"type":{"enum":[ "bar", "line", "pie" ]},"width": { "type": "integer", "minimum": 1, "maximum": 12 }},"required":["name","aggregation", "type", "width"]},"type":"array"}},"required":["name","widgets"]}`},
 
-		&updateDocument{ID: "update-settings-global-1", Collection: "settings", Key: "global", Document: &model.Settings{ArtifactStates: []*model.Type{{Icon: "mdi-help-circle-outline", ID: "unknown", Name: "Unknown", Color: pointer.String(model.TypeColorInfo)}, {Icon: "mdi-skull", ID: "malicious", Name: "Malicious", Color: pointer.String(model.TypeColorError)}, {Icon: "mdi-check", ID: "clean", Name: "Clean", Color: pointer.String(model.TypeColorSuccess)}}, ArtifactKinds: []*model.Type{{Icon: "mdi-server", ID: "asset", Name: "Asset"}, {Icon: "mdi-bullseye", ID: "ioc", Name: "IOC"}}, Timeformat: "yyyy-MM-dd hh:mm:ss"}},
+		&updateDocument[model.Settings]{ID: "update-settings-global-1", Collection: "settings", Key: "global", Document: &model.Settings{ArtifactStates: []*model.Type{{Icon: "mdi-help-circle-outline", ID: "unknown", Name: "Unknown", Color: pointer.String(model.TypeColorInfo)}, {Icon: "mdi-skull", ID: "malicious", Name: "Malicious", Color: pointer.String(model.TypeColorError)}, {Icon: "mdi-check", ID: "clean", Name: "Clean", Color: pointer.String(model.TypeColorSuccess)}}, ArtifactKinds: []*model.Type{{Icon: "mdi-server", ID: "asset", Name: "Asset"}, {Icon: "mdi-bullseye", ID: "ioc", Name: "IOC"}}, Timeformat: "yyyy-MM-dd hh:mm:ss"}},
 	}, nil
 }
 
@@ -67,6 +67,7 @@ func loadSchema(dataType, jsonschema string) (*driver.CollectionSchemaOptions, e
 	ticketCollectionSchema := &driver.CollectionSchemaOptions{Level: driver.CollectionSchemaLevelStrict, Message: fmt.Sprintf("Validation of %s failed", dataType)}
 
 	err := ticketCollectionSchema.LoadRule([]byte(jsonschema))
+
 	return ticketCollectionSchema, err
 }
 
@@ -101,6 +102,7 @@ func PerformMigrations(ctx context.Context, db driver.Database) error {
 			}
 		}
 	}
+
 	return nil
 }
 
@@ -171,41 +173,43 @@ func (m *createGraph) Migrate(ctx context.Context, db driver.Database) error {
 	_, err := db.CreateGraph(ctx, m.Name, &driver.CreateGraphOptions{
 		EdgeDefinitions: m.EdgeDefinitions,
 	})
+
 	return err
 }
 
-type createDocument struct {
+type createDocument[T any] struct {
 	ID         string
 	Collection string
-	Document   interface{}
+	Document   *T
 }
 
-func (m *createDocument) MID() string {
+func (m *createDocument[T]) MID() string {
 	return m.ID
 }
 
-func (m *createDocument) Migrate(ctx context.Context, driver driver.Database) error {
+func (m *createDocument[T]) Migrate(ctx context.Context, driver driver.Database) error {
 	collection, err := driver.Collection(ctx, m.Collection)
 	if err != nil {
 		return err
 	}
 
 	_, err = collection.CreateDocument(ctx, m.Document)
+
 	return err
 }
 
-type updateDocument struct {
+type updateDocument[T any] struct {
 	ID         string
 	Collection string
 	Key        string
-	Document   interface{}
+	Document   *T
 }
 
-func (m *updateDocument) MID() string {
+func (m *updateDocument[T]) MID() string {
 	return m.ID
 }
 
-func (m *updateDocument) Migrate(ctx context.Context, driver driver.Database) error {
+func (m *updateDocument[T]) Migrate(ctx context.Context, driver driver.Database) error {
 	collection, err := driver.Collection(ctx, m.Collection)
 	if err != nil {
 		return err
@@ -218,9 +222,11 @@ func (m *updateDocument) Migrate(ctx context.Context, driver driver.Database) er
 
 	if !exists {
 		_, err = collection.CreateDocument(ctx, m.Document)
+
 		return err
 	}
 
 	_, err = collection.ReplaceDocument(ctx, m.Key, m.Document)
+
 	return err
 }

database/playbook.go

@@ -22,7 +22,7 @@ type PlaybookYAML struct {
 type TaskYAML struct {
 	Name       string            `yaml:"name"`
 	Type       string            `yaml:"type"`
-	Schema     interface{}       `yaml:"schema"`
+	Schema     any               `yaml:"schema"`
 	Automation string            `yaml:"automation"`
 	Payload    map[string]string `yaml:"payload"`
 	Next       map[string]string `yaml:"next"`
@@ -42,6 +42,7 @@ func toPlaybooks(docs []*model.PlaybookTemplateForm) (map[string]*model.Playbook
 			playbooks[strcase.ToKebab(playbook.Name)] = playbook
 		}
 	}
+
 	return playbooks, nil
 }
 
@@ -53,11 +54,17 @@ func toPlaybook(doc *model.PlaybookTemplateForm) (*model.Playbook, error) {
 	}
 	for idx, task := range ticketPlaybook.Tasks {
 		if task.Schema != nil {
-			task.Schema = dyno.ConvertMapI2MapS(task.Schema).(map[string]interface{})
+			schema, ok := dyno.ConvertMapI2MapS(task.Schema).(map[string]any)
+			if ok {
+				task.Schema = schema
+			} else {
+				return nil, errors.New("could not convert schema")
+			}
 		}
 		task.Created = time.Now().UTC()
 		ticketPlaybook.Tasks[idx] = task
 	}
+
 	return ticketPlaybook, nil
 }
 
@@ -84,7 +91,7 @@ func (db *Database) PlaybookCreate(ctx context.Context, playbook *model.Playbook
 	var doc model.PlaybookTemplate
 	newctx := driver.WithReturnNew(ctx, &doc)
 
-	meta, err := db.playbookCollection.CreateDocument(ctx, newctx, strcase.ToKebab(playbookYAML.Name), p)
+	meta, err := db.playbookCollection.CreateDocument(ctx, newctx, strcase.ToKebab(playbookYAML.Name), &p)
 	if err != nil {
 		return nil, err
 	}
@@ -104,6 +111,7 @@ func (db *Database) PlaybookGet(ctx context.Context, id string) (*model.Playbook
 
 func (db *Database) PlaybookDelete(ctx context.Context, id string) error {
 	_, err := db.playbookCollection.RemoveDocument(ctx, id)
+
 	return err
 }
 
@@ -121,7 +129,7 @@ func (db *Database) PlaybookUpdate(ctx context.Context, id string, playbook *mod
 	var doc model.PlaybookTemplate
 	ctx = driver.WithReturnNew(ctx, &doc)
 
-	meta, err := db.playbookCollection.ReplaceDocument(ctx, id, model.PlaybookTemplate{Name: pb.Name, Yaml: playbook.Yaml})
+	meta, err := db.playbookCollection.ReplaceDocument(ctx, id, &model.PlaybookTemplate{Name: pb.Name, Yaml: playbook.Yaml})
 	if err != nil {
 		return nil, err
 	}
@@ -131,7 +139,7 @@ func (db *Database) PlaybookUpdate(ctx context.Context, id string, playbook *mod
 
 func (db *Database) PlaybookList(ctx context.Context) ([]*model.PlaybookTemplateResponse, error) {
 	query := "FOR d IN @@collection RETURN d"
-	cursor, _, err := db.Query(ctx, query, map[string]interface{}{"@collection": PlaybookCollectionName}, busdb.ReadOperation)
+	cursor, _, err := db.Query(ctx, query, map[string]any{"@collection": PlaybookCollectionName}, busdb.ReadOperation)
 	if err != nil {
 		return nil, err
 	}

database/playbookutils.go

@@ -33,6 +33,7 @@ func playbookGraph(playbook *model.Playbook) (*dag.Graph, error) {
 			}
 		}
 	}
+
 	return d, nil
 }
 
@@ -109,6 +110,7 @@ func active(playbook *model.Playbook, taskID string, d *dag.Graph, task *model.T
 				return false, nil
 			}
 		}
+
 		return true, nil
 	}
 
@@ -129,10 +131,11 @@ func active(playbook *model.Playbook, taskID string, d *dag.Graph, task *model.T
 			return true, nil
 		}
 	}
+
 	return false, nil
 }
 
-func evalRequirement(aql string, data interface{}) (bool, error) {
+func evalRequirement(aql string, data any) (bool, error) {
 	if aql == "" {
 		return true, nil
 	}
@@ -143,9 +146,9 @@ func evalRequirement(aql string, data interface{}) (bool, error) {
 		return false, err
 	}
 
-	var dataMap map[string]interface{}
+	var dataMap map[string]any
 	if data != nil {
-		if dataMapX, ok := data.(map[string]interface{}); ok {
+		if dataMapX, ok := data.(map[string]any); ok {
 			dataMap = dataMapX
 		} else {
 			log.Println("wrong data type for task data")
@@ -160,6 +163,7 @@ func evalRequirement(aql string, data interface{}) (bool, error) {
 	if b, ok := v.(bool); ok {
 		return b, nil
 	}
+
 	return false, err
 }
 

database/playbookutils_test.go

@@ -12,11 +12,11 @@ var playbook2 = &model.Playbook{
 	Name: "Phishing",
 	Tasks: map[string]*model.Task{
 		"board": {Next: map[string]string{
-			"escalate":    "boardInvolved == true",
-			"aquire-mail": "boardInvolved == false",
+			"escalate":     "boardInvolved == true",
+			"acquire-mail": "boardInvolved == false",
 		}},
 		"escalate": {},
-		"aquire-mail": {Next: map[string]string{
+		"acquire-mail": {Next: map[string]string{
 			"extract-iocs":         "schemaKey == 'yes'",
 			"block-sender":         "schemaKey == 'yes'",
 			"search-email-gateway": "schemaKey == 'no'",
@@ -34,11 +34,11 @@ var playbook3 = &model.Playbook{
 	Name: "Phishing",
 	Tasks: map[string]*model.Task{
 		"board": {Next: map[string]string{
-			"escalate":    "boardInvolved == true",
-			"aquire-mail": "boardInvolved == false",
-		}, Data: map[string]interface{}{"boardInvolved": true}, Done: true},
+			"escalate":     "boardInvolved == true",
+			"acquire-mail": "boardInvolved == false",
+		}, Data: map[string]any{"boardInvolved": true}, Done: true},
 		"escalate": {},
-		"aquire-mail": {Next: map[string]string{
+		"acquire-mail": {Next: map[string]string{
 			"extract-iocs":         "schemaKey == 'yes'",
 			"block-sender":         "schemaKey == 'yes'",
 			"search-email-gateway": "schemaKey == 'no'",
@@ -71,6 +71,8 @@ var playbook4 = &model.Playbook{
 }
 
 func Test_canBeCompleted(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		playbook *model.Playbook
 		taskID   string
@@ -83,18 +85,22 @@ func Test_canBeCompleted(t *testing.T) {
 	}{
 		{"playbook2 board", args{playbook: playbook2, taskID: "board"}, true, false},
 		{"playbook2 escalate", args{playbook: playbook2, taskID: "escalate"}, false, false},
-		{"playbook2 aquire-mail", args{playbook: playbook2, taskID: "aquire-mail"}, false, false},
+		{"playbook2 acquire-mail", args{playbook: playbook2, taskID: "acquire-mail"}, false, false},
 		{"playbook2 block-ioc", args{playbook: playbook2, taskID: "block-ioc"}, false, false},
 		{"playbook3 board", args{playbook: playbook3, taskID: "board"}, false, false},
 		{"playbook3 escalate", args{playbook: playbook3, taskID: "escalate"}, true, false},
-		{"playbook3 aquire-mail", args{playbook: playbook3, taskID: "aquire-mail"}, false, false},
+		{"playbook3 acquire-mail", args{playbook: playbook3, taskID: "acquire-mail"}, false, false},
 		{"playbook3 block-ioc", args{playbook: playbook3, taskID: "block-ioc"}, false, false},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			got, err := activePlaybook(tt.args.playbook, tt.args.taskID)
 			if (err != nil) != tt.wantErr {
 				t.Errorf("activePlaybook() error = %v, wantErr %v", err, tt.wantErr)
+
 				return
 			}
 			if got != tt.want {
@@ -105,6 +111,8 @@ func Test_canBeCompleted(t *testing.T) {
 }
 
 func Test_playbookOrder(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		playbook *model.Playbook
 	}
@@ -117,10 +125,14 @@ func Test_playbookOrder(t *testing.T) {
 		{"playbook4", args{playbook: playbook4}, []string{"file-or-hash", "enter-hash", "upload", "hash", "virustotal"}, false},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			got, err := toPlaybookResponse(tt.args.playbook)
 			if (err != nil) != tt.wantErr {
 				t.Errorf("activePlaybook() error = %v, wantErr %v", err, tt.wantErr)
+
 				return
 			}
 

database/relationships.go

@@ -20,11 +20,13 @@ func (db *Database) RelatedCreate(ctx context.Context, id, id2 int64) error {
 		From: driver.DocumentID(TicketCollectionName + "/" + strconv.Itoa(int(id))),
 		To:   driver.DocumentID(TicketCollectionName + "/" + strconv.Itoa(int(id2))),
 	})
+
 	return err
 }
 
 func (db *Database) RelatedBatchCreate(ctx context.Context, edges []*driver.EdgeDocument) error {
 	_, err := db.relatedCollection.CreateEdges(ctx, edges)
+
 	return err
 }
 
@@ -33,7 +35,7 @@ func (db *Database) RelatedRemove(ctx context.Context, id, id2 int64) error {
 	FOR d in @@collection
 	FILTER (d._from == @id && d._to == @id2) || (d._to == @id && d._from == @id2)
 	REMOVE d in @@collection`
-	_, _, err := db.Query(ctx, q, map[string]interface{}{
+	_, _, err := db.Query(ctx, q, map[string]any{
 		"@collection": RelatedTicketsCollectionName,
 		"id":          driver.DocumentID(TicketCollectionName + "/" + strconv.Itoa(int(id))),
 		"id2":         driver.DocumentID(TicketCollectionName + "/" + strconv.Itoa(int(id2))),
@@ -44,5 +46,6 @@ func (db *Database) RelatedRemove(ctx context.Context, id, id2 int64) error {
 			driver.DocumentID(TicketCollectionName + "/" + strconv.Itoa(int(id2))),
 		},
 	})
+
 	return err
 }

database/statistics.go

@@ -44,12 +44,12 @@ func (db *Database) Statistics(ctx context.Context) (*model.Statistics, error) {
 	return &statistics, nil
 }
 
-func (db *Database) WidgetData(ctx context.Context, aggregation string, filter *string) (map[string]interface{}, error) {
+func (db *Database) WidgetData(ctx context.Context, aggregation string, filter *string) (map[string]any, error) {
 	parser := &caql.Parser{Searcher: db.Index, Prefix: "d."}
 
 	queryTree, err := parser.Parse(aggregation)
 	if err != nil {
-		return nil, fmt.Errorf("invalid aggregation query (%s): syntax error\n", aggregation)
+		return nil, fmt.Errorf("invalid aggregation query (%s): syntax error", aggregation)
 	}
 	aggregationString, err := queryTree.String()
 	if err != nil {
@@ -61,7 +61,7 @@ func (db *Database) WidgetData(ctx context.Context, aggregation string, filter *
 	if filter != nil && *filter != "" {
 		queryTree, err := parser.Parse(*filter)
 		if err != nil {
-			return nil, fmt.Errorf("invalid filter query (%s): syntax error\n", *filter)
+			return nil, fmt.Errorf("invalid filter query (%s): syntax error", *filter)
 		}
 		filterString, err := queryTree.String()
 		if err != nil {
@@ -82,7 +82,7 @@ func (db *Database) WidgetData(ctx context.Context, aggregation string, filter *
 	}
 	defer cur.Close()
 
-	statistics := map[string]interface{}{}
+	statistics := map[string]any{}
 	if _, err := cur.ReadDocument(ctx, &statistics); err != nil {
 		return nil, err
 	}

database/task.go

@@ -10,10 +10,10 @@ import (
 )
 
 type playbookResponse struct {
-	PlaybookId   string         `json:"playbook_id"`
+	PlaybookID   string         `json:"playbook_id"`
 	PlaybookName string         `json:"playbook_name"`
 	Playbook     model.Playbook `json:"playbook"`
-	TicketId     int64          `json:"ticket_id"`
+	TicketID     int64          `json:"ticket_id"`
 	TicketName   string         `json:"ticket_name"`
 }
 
@@ -28,7 +28,7 @@ func (db *Database) TaskList(ctx context.Context) ([]*model.TaskWithContext, err
 	FILTER d.status == 'open'
 	FOR playbook IN NOT_NULL(VALUES(d.playbooks), [])
 	RETURN { ticket_id: TO_NUMBER(d._key), ticket_name: d.name, playbook_id: POSITION(d.playbooks, playbook, true), playbook_name: playbook.name, playbook: playbook }`
-	cursor, _, err := db.Query(ctx, query, mergeMaps(ticketFilterVars, map[string]interface{}{
+	cursor, _, err := db.Query(ctx, query, mergeMaps(ticketFilterVars, map[string]any{
 		"@collection": TicketCollectionName,
 	}), busdb.ReadOperation)
 	if err != nil {
@@ -53,10 +53,10 @@ func (db *Database) TaskList(ctx context.Context) ([]*model.TaskWithContext, err
 		for _, task := range playbook.Tasks {
 			if task.Active {
 				docs = append(docs, &model.TaskWithContext{
-					PlaybookId:   doc.PlaybookId,
+					PlaybookId:   doc.PlaybookID,
 					PlaybookName: doc.PlaybookName,
 					Task:         task,
-					TicketId:     doc.TicketId,
+					TicketId:     doc.TicketID,
 					TicketName:   doc.TicketName,
 				})
 			}

database/template.go

@@ -62,12 +62,13 @@ func (db *Database) TemplateUpdate(ctx context.Context, id string, template *mod
 
 func (db *Database) TemplateDelete(ctx context.Context, id string) error {
 	_, err := db.templateCollection.RemoveDocument(ctx, id)
+
 	return err
 }
 
 func (db *Database) TemplateList(ctx context.Context) ([]*model.TicketTemplateResponse, error) {
 	query := "FOR d IN @@collection RETURN d"
-	cursor, _, err := db.Query(ctx, query, map[string]interface{}{"@collection": TemplateCollectionName}, busdb.ReadOperation)
+	cursor, _, err := db.Query(ctx, query, map[string]any{"@collection": TemplateCollectionName}, busdb.ReadOperation)
 	if err != nil {
 		return nil, err
 	}

database/template_test.go

@@ -10,16 +10,20 @@ import (
 	"github.com/SecurityBrewery/catalyst/test"
 )
 
-var template1 = &model.TicketTemplateForm{
-	Schema: migrations.DefaultTemplateSchema,
-	Name:   "Template 1",
-}
-var default1 = &model.TicketTemplateForm{
-	Schema: migrations.DefaultTemplateSchema,
-	Name:   "Default",
-}
+var (
+	template1 = &model.TicketTemplateForm{
+		Schema: migrations.DefaultTemplateSchema,
+		Name:   "Template 1",
+	}
+	default1 = &model.TicketTemplateForm{
+		Schema: migrations.DefaultTemplateSchema,
+		Name:   "Default",
+	}
+)
 
 func TestDatabase_TemplateCreate(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		template *model.TicketTemplateForm
 	}
@@ -35,7 +39,10 @@ func TestDatabase_TemplateCreate(t *testing.T) {
 		{name: "Only name", args: args{template: &model.TicketTemplateForm{Name: "name"}}, wantErr: false},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, db, cleanup, err := test.DB(t)
 			if err != nil {
 				t.Fatal(err)
@@ -50,6 +57,8 @@ func TestDatabase_TemplateCreate(t *testing.T) {
 }
 
 func TestDatabase_TemplateDelete(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		id string
 	}
@@ -62,7 +71,10 @@ func TestDatabase_TemplateDelete(t *testing.T) {
 		{name: "Not existing", args: args{"foobar"}, wantErr: true},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, db, cleanup, err := test.DB(t)
 			if err != nil {
 				t.Fatal(err)
@@ -81,6 +93,8 @@ func TestDatabase_TemplateDelete(t *testing.T) {
 }
 
 func TestDatabase_TemplateGet(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		id string
 	}
@@ -94,7 +108,10 @@ func TestDatabase_TemplateGet(t *testing.T) {
 		{name: "Not existing", args: args{id: "foobar"}, wantErr: true},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, db, cleanup, err := test.DB(t)
 			if err != nil {
 				t.Fatal(err)
@@ -108,6 +125,7 @@ func TestDatabase_TemplateGet(t *testing.T) {
 			got, err := db.TemplateGet(test.Context(), tt.args.id)
 			if (err != nil) != tt.wantErr {
 				t.Errorf("TemplateGet() error = %v, wantErr %v", err, tt.wantErr)
+
 				return
 			}
 			if err != nil {
@@ -120,6 +138,8 @@ func TestDatabase_TemplateGet(t *testing.T) {
 }
 
 func TestDatabase_TemplateList(t *testing.T) {
+	t.Parallel()
+
 	tests := []struct {
 		name    string
 		want    []*model.TicketTemplateResponse
@@ -128,7 +148,10 @@ func TestDatabase_TemplateList(t *testing.T) {
 		{name: "Normal", want: []*model.TicketTemplateResponse{{ID: "default", Name: "Default", Schema: migrations.DefaultTemplateSchema}, {ID: "template-1", Name: template1.Name, Schema: template1.Schema}}},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, db, cleanup, err := test.DB(t)
 			if err != nil {
 				t.Fatal(err)
@@ -142,6 +165,7 @@ func TestDatabase_TemplateList(t *testing.T) {
 			got, err := db.TemplateList(test.Context())
 			if (err != nil) != tt.wantErr {
 				t.Errorf("TemplateList() error = %v, wantErr %v", err, tt.wantErr)
+
 				return
 			}
 			assert.Equal(t, got, tt.want)
@@ -150,6 +174,8 @@ func TestDatabase_TemplateList(t *testing.T) {
 }
 
 func TestDatabase_TemplateUpdate(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		id       string
 		template *model.TicketTemplateForm
@@ -163,7 +189,10 @@ func TestDatabase_TemplateUpdate(t *testing.T) {
 		{name: "Not existing", args: args{"foobar", template1}, wantErr: true},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, db, cleanup, err := test.DB(t)
 			if err != nil {
 				t.Fatal(err)

database/ticket.go

@@ -5,6 +5,7 @@ import (
 	"encoding/json"
 	"errors"
 	"fmt"
+	"log"
 	"sort"
 	"strconv"
 	"strings"
@@ -21,7 +22,7 @@ import (
 	"github.com/SecurityBrewery/catalyst/index"
 )
 
-func toTicket(ticketForm *model.TicketForm) (interface{}, error) {
+func toTicket(ticketForm *model.TicketForm) (any, error) {
 	playbooks, err := toPlaybooks(ticketForm.Playbooks)
 	if err != nil {
 		return nil, err
@@ -65,8 +66,9 @@ func toTicket(ticketForm *model.TicketForm) (interface{}, error) {
 		ticket.Status = "open"
 	}
 	if ticketForm.ID != nil {
-		return &busdb.Keyed{Key: strconv.FormatInt(*ticketForm.ID, 10), Doc: ticket}, nil
+		return &busdb.Keyed[model.Ticket]{Key: strconv.FormatInt(*ticketForm.ID, 10), Doc: ticket}, nil
 	}
+
 	return ticket, nil
 }
 
@@ -79,6 +81,7 @@ func toTicketResponses(tickets []*model.TicketSimpleResponse) ([]*model.TicketRe
 		}
 		extendedTickets = append(extendedTickets, tr)
 	}
+
 	return extendedTickets, nil
 }
 
@@ -167,6 +170,7 @@ func toPlaybookResponses(playbooks map[string]*model.Playbook) (map[string]*mode
 			return nil, err
 		}
 	}
+
 	return pr, nil
 }
 
@@ -195,6 +199,7 @@ func toPlaybookResponse(playbook *model.Playbook) (*model.PlaybookResponse, erro
 		re.Tasks[taskID] = rootTask
 		i++
 	}
+
 	return re, nil
 }
 
@@ -204,7 +209,7 @@ func (db *Database) TicketBatchCreate(ctx context.Context, ticketForms []*model.
 		return nil, err
 	}
 
-	var dbTickets []interface{}
+	var dbTickets []any
 	for _, ticketForm := range ticketForms {
 		ticket, err := toTicket(ticketForm)
 		if err != nil {
@@ -231,7 +236,7 @@ func (db *Database) TicketBatchCreate(ctx context.Context, ticketForms []*model.
 	LET noiddoc = UNSET(keyeddoc, "id")
 	INSERT noiddoc INTO @@collection
 	RETURN NEW`
-	apiTickets, _, err := db.ticketListQuery(ctx, query, mergeMaps(map[string]interface{}{
+	apiTickets, _, err := db.ticketListQuery(ctx, query, mergeMaps(map[string]any{
 		"tickets": dbTickets,
 	}, ticketFilterVars), busdb.CreateOperation)
 	if err != nil {
@@ -247,7 +252,11 @@ func (db *Database) TicketBatchCreate(ctx context.Context, ticketForms []*model.
 		ids = append(ids, driver.NewDocumentID(TicketCollectionName, fmt.Sprint(apiTicket.ID)))
 	}
 
-	go db.bus.PublishDatabaseUpdate(ids, bus.DatabaseEntryUpdated)
+	go func() {
+		if err := db.bus.PublishDatabaseUpdate(ids, bus.DatabaseEntryUpdated); err != nil {
+			log.Println(err)
+		}
+	}()
 
 	ticketResponses, err := toTicketResponses(apiTickets)
 	if err != nil {
@@ -294,6 +303,7 @@ func batchIndex(index *index.Index, tickets []*model.TicketSimpleResponse) error
 		}
 	}
 	wg.Wait()
+
 	return nil
 }
 
@@ -306,9 +316,9 @@ func (db *Database) TicketGet(ctx context.Context, ticketID int64) (*model.Ticke
 	return db.ticketGetQuery(ctx, ticketID, `LET d = DOCUMENT(@@collection, @ID) `+ticketFilterQuery+` RETURN d`, ticketFilterVars, busdb.ReadOperation)
 }
 
-func (db *Database) ticketGetQuery(ctx context.Context, ticketID int64, query string, bindVars map[string]interface{}, operation *busdb.Operation) (*model.TicketWithTickets, error) {
+func (db *Database) ticketGetQuery(ctx context.Context, ticketID int64, query string, bindVars map[string]any, operation *busdb.Operation) (*model.TicketWithTickets, error) {
 	if bindVars == nil {
-		bindVars = map[string]interface{}{}
+		bindVars = map[string]any{}
 	}
 	bindVars["@collection"] = TicketCollectionName
 	if ticketID != 0 {
@@ -350,7 +360,7 @@ func (db *Database) ticketGetQuery(ctx context.Context, ticketID int64, query st
 	` + ticketFilterQuery + `
 	RETURN d`
 
-	outTickets, _, err := db.ticketListQuery(ctx, ticketsQuery, mergeMaps(map[string]interface{}{
+	outTickets, _, err := db.ticketListQuery(ctx, ticketsQuery, mergeMaps(map[string]any{
 		"ID":       fmt.Sprint(ticketID),
 		"graph":    TicketArtifactsGraphName,
 		"@tickets": TicketCollectionName,
@@ -368,7 +378,7 @@ func (db *Database) ticketGetQuery(ctx context.Context, ticketID int64, query st
 	` + ticketFilterQuery + `
 	RETURN d`
 
-	inTickets, _, err := db.ticketListQuery(ctx, ticketsQuery, mergeMaps(map[string]interface{}{
+	inTickets, _, err := db.ticketListQuery(ctx, ticketsQuery, mergeMaps(map[string]any{
 		"ID":       fmt.Sprint(ticketID),
 		"graph":    TicketArtifactsGraphName,
 		"@tickets": TicketCollectionName,
@@ -387,7 +397,7 @@ func (db *Database) ticketGetQuery(ctx context.Context, ticketID int64, query st
 	FOR a IN NOT_NULL(d.artifacts, [])
 	FILTER POSITION(@artifacts, a.name)
 	RETURN d`
-	sameArtifactTickets, _, err := db.ticketListQuery(ctx, ticketsQuery, mergeMaps(map[string]interface{}{
+	sameArtifactTickets, _, err := db.ticketListQuery(ctx, ticketsQuery, mergeMaps(map[string]any{
 		"ID":        fmt.Sprint(ticketID),
 		"artifacts": artifactNames,
 	}, ticketFilterVars), busdb.ReadOperation)
@@ -395,7 +405,8 @@ func (db *Database) ticketGetQuery(ctx context.Context, ticketID int64, query st
 		return nil, err
 	}
 
-	tickets := append(outTickets, inTickets...)
+	tickets := outTickets
+	tickets = append(tickets, inTickets...)
 	tickets = append(tickets, sameArtifactTickets...)
 	sort.Slice(tickets, func(i, j int) bool {
 		return tickets[i].ID < tickets[j].ID
@@ -425,7 +436,8 @@ func (db *Database) TicketUpdate(ctx context.Context, ticketID int64, ticket *mo
 	REPLACE d WITH @ticket IN @@collection
 	RETURN NEW`
 	ticket.Modified = time.Now().UTC() // TODO make setable?
-	return db.ticketGetQuery(ctx, ticketID, query, mergeMaps(map[string]interface{}{"ticket": ticket}, ticketFilterVars), &busdb.Operation{
+
+	return db.ticketGetQuery(ctx, ticketID, query, mergeMaps(map[string]any{"ticket": ticket}, ticketFilterVars), &busdb.Operation{
 		Type: bus.DatabaseEntryUpdated, Ids: []driver.DocumentID{
 			driver.NewDocumentID(TicketCollectionName, strconv.FormatInt(ticketID, 10)),
 		},
@@ -447,15 +459,15 @@ func (db *Database) TicketDelete(ctx context.Context, ticketID int64) error {
 }
 
 func (db *Database) TicketList(ctx context.Context, ticketType string, query string, sorts []string, desc []bool, offset, count int64) (*model.TicketList, error) {
-	binVars := map[string]interface{}{}
+	binVars := map[string]any{}
 
-	var typeString = ""
+	typeString := ""
 	if ticketType != "" {
 		typeString = "FILTER d.type == @type "
 		binVars["type"] = ticketType
 	}
 
-	var filterString = ""
+	filterString := ""
 	if query != "" {
 		parser := &caql.Parser{Searcher: db.Index, Prefix: "d."}
 		queryTree, err := parser.Parse(query)
@@ -493,6 +505,7 @@ func (db *Database) TicketList(ctx context.Context, ticketType string, query str
 		RETURN d`
 	// RETURN KEEP(d, "_key", "id", "name", "type", "created")`
 	ticketList, _, err := db.ticketListQuery(ctx, q, mergeMaps(binVars, ticketFilterVars), busdb.ReadOperation)
+
 	return &model.TicketList{
 		Count:   documentCount,
 		Tickets: ticketList,
@@ -500,9 +513,9 @@ func (db *Database) TicketList(ctx context.Context, ticketType string, query str
 	// return map[string]interface{}{"tickets": ticketList, "count": documentCount}, err
 }
 
-func (db *Database) ticketListQuery(ctx context.Context, query string, bindVars map[string]interface{}, operation *busdb.Operation) ([]*model.TicketSimpleResponse, *model.LogEntry, error) {
+func (db *Database) ticketListQuery(ctx context.Context, query string, bindVars map[string]any, operation *busdb.Operation) ([]*model.TicketSimpleResponse, *model.LogEntry, error) {
 	if bindVars == nil {
-		bindVars = map[string]interface{}{}
+		bindVars = map[string]any{}
 	}
 	bindVars["@collection"] = TicketCollectionName
 
@@ -533,9 +546,9 @@ func (db *Database) ticketListQuery(ctx context.Context, query string, bindVars
 	return docs, logEntry, nil
 }
 
-func (db *Database) TicketCount(ctx context.Context, typequery, filterquery string, bindVars map[string]interface{}) (int, error) {
+func (db *Database) TicketCount(ctx context.Context, typequery, filterquery string, bindVars map[string]any) (int, error) {
 	if bindVars == nil {
-		bindVars = map[string]interface{}{}
+		bindVars = map[string]any{}
 	}
 	bindVars["@collection"] = TicketCollectionName
 
@@ -555,10 +568,11 @@ func (db *Database) TicketCount(ctx context.Context, typequery, filterquery stri
 		return 0, err
 	}
 	cursor.Close()
+
 	return documentCount, nil
 }
 
-func sortQuery(paramsSort []string, paramsDesc []bool, bindVars map[string]interface{}) string {
+func sortQuery(paramsSort []string, paramsDesc []bool, bindVars map[string]any) string {
 	sort := ""
 	if len(paramsSort) > 0 {
 		var sorts []string
@@ -572,21 +586,23 @@ func sortQuery(paramsSort []string, paramsDesc []bool, bindVars map[string]inter
 		}
 		sort = "SORT " + strings.Join(sorts, ", ")
 	}
+
 	return sort
 }
 
-func mergeMaps(a map[string]interface{}, b map[string]interface{}) map[string]interface{} {
-	merged := map[string]interface{}{}
+func mergeMaps(a map[string]any, b map[string]any) map[string]any {
+	merged := map[string]any{}
 	for k, v := range a {
 		merged[k] = v
 	}
 	for k, v := range b {
 		merged[k] = v
 	}
+
 	return merged
 }
 
-func validate(e interface{}, schema *gojsonschema.Schema) error {
+func validate(e any, schema *gojsonschema.Schema) error {
 	b, err := json.Marshal(e)
 	if err != nil {
 		return err
@@ -602,7 +618,9 @@ func validate(e interface{}, schema *gojsonschema.Schema) error {
 		for _, e := range res.Errors() {
 			l = append(l, e.String())
 		}
+
 		return fmt.Errorf("validation failed: %v", strings.Join(l, ", "))
 	}
+
 	return nil
 }

database/ticket_field.go

@@ -34,7 +34,8 @@ func (db *Database) AddArtifact(ctx context.Context, id int64, artifact *model.A
 	` + ticketFilterQuery + `
 	UPDATE d WITH { "modified": @now, "artifacts": PUSH(NOT_NULL(d.artifacts, []), @artifact) } IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{"artifact": artifact, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{"artifact": artifact, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
 		Type: bus.DatabaseEntryUpdated,
 		Ids: []driver.DocumentID{
 			driver.DocumentID(fmt.Sprintf("%s/%d", TicketCollectionName, id)),
@@ -57,6 +58,7 @@ func inferType(name string) string {
 	case commonregex.SHA256HexRegex.MatchString(name):
 		return "sha256"
 	}
+
 	return "unknown"
 }
 
@@ -73,7 +75,8 @@ func (db *Database) RemoveArtifact(ctx context.Context, id int64, name string) (
 	LET newartifacts = REMOVE_VALUE(d.artifacts, a)
 	UPDATE d WITH { "modified": @now, "artifacts": newartifacts } IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{"name": name, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{"name": name, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
 		Type: bus.DatabaseEntryUpdated,
 		Ids: []driver.DocumentID{
 			driver.DocumentID(fmt.Sprintf("%s/%d", TicketCollectionName, id)),
@@ -91,7 +94,8 @@ func (db *Database) SetTemplate(ctx context.Context, id int64, schema string) (*
 	` + ticketFilterQuery + `
 	UPDATE d WITH { "schema": @schema } IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{"schema": schema}, ticketFilterVars), &busdb.Operation{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{"schema": schema}, ticketFilterVars), &busdb.Operation{
 		Type: bus.DatabaseEntryUpdated,
 		Ids: []driver.DocumentID{
 			driver.DocumentID(fmt.Sprintf("%s/%d", TicketCollectionName, id)),
@@ -122,7 +126,8 @@ func (db *Database) AddComment(ctx context.Context, id int64, comment *model.Com
 	` + ticketFilterQuery + `
 	UPDATE d WITH { "modified": @now, "comments": PUSH(NOT_NULL(d.comments, []), @comment) } IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{"comment": comment, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{"comment": comment, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
 		Type: bus.DatabaseEntryUpdated,
 		Ids: []driver.DocumentID{
 			driver.DocumentID(fmt.Sprintf("%s/%d", TicketCollectionName, id)),
@@ -140,7 +145,8 @@ func (db *Database) RemoveComment(ctx context.Context, id int64, commentID int64
 	` + ticketFilterQuery + `
 	UPDATE d WITH { "modified": @now, "comments": REMOVE_NTH(d.comments, @commentID) } IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{"commentID": commentID, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{"commentID": commentID, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
 		Type: bus.DatabaseEntryUpdated,
 		Ids: []driver.DocumentID{
 			driver.DocumentID(fmt.Sprintf("%s/%d", TicketCollectionName, id)),
@@ -158,7 +164,8 @@ func (db *Database) SetReferences(ctx context.Context, id int64, references []*m
 	` + ticketFilterQuery + `
 	UPDATE d WITH { "modified": @now, "references": @references } IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{"references": references, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{"references": references, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
 		Type: bus.DatabaseEntryUpdated,
 		Ids: []driver.DocumentID{
 			driver.DocumentID(fmt.Sprintf("%s/%d", TicketCollectionName, id)),
@@ -176,7 +183,8 @@ func (db *Database) AddFile(ctx context.Context, id int64, file *model.File) (*m
 	` + ticketFilterQuery + `
 	UPDATE d WITH { "modified": @now, "files": APPEND(NOT_NULL(d.files, []), [@file]) } IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{"file": file, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{"file": file, "now": time.Now().UTC()}, ticketFilterVars), &busdb.Operation{
 		Type: bus.DatabaseEntryUpdated,
 		Ids: []driver.DocumentID{
 			driver.DocumentID(fmt.Sprintf("%s/%d", TicketCollectionName, id)),
@@ -213,7 +221,7 @@ func (db *Database) AddTicketPlaybook(ctx context.Context, id int64, playbookTem
 	LET newticket = MERGE(d, { "modified": @now, "playbooks": newplaybooks })
 	REPLACE d WITH newticket IN @@collection
 	RETURN NEW`
-	ticket, err := db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{
+	ticket, err := db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{
 		"playbook":   pb,
 		"playbookID": findName(parentTicket.Playbooks, playbookID),
 		"now":        time.Now().UTC(),
@@ -258,6 +266,7 @@ func runRootTask(ticket *model.TicketResponse, playbookID string, db *Database)
 	}
 
 	runNextTasks(ticket.ID, playbookID, root.Next, root.Data, ticket, db)
+
 	return nil
 }
 
@@ -273,7 +282,8 @@ func (db *Database) RemoveTicketPlaybook(ctx context.Context, id int64, playbook
 	LET newplaybooks = UNSET(d.playbooks, @playbookID)
 	REPLACE d WITH MERGE(d, { "modified": @now, "playbooks": newplaybooks }) IN @@collection
 	RETURN NEW`
-	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{
+
+	return db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{
 		"playbookID": playbookID,
 		"now":        time.Now().UTC(),
 	}, ticketFilterVars), &busdb.Operation{

database/ticket_task.go

@@ -41,7 +41,7 @@ func (db *Database) TaskGet(ctx context.Context, id int64, playbookID string, ta
 	}, nil
 }
 
-func (db *Database) TaskComplete(ctx context.Context, id int64, playbookID string, taskID string, data interface{}) (*model.TicketWithTickets, error) {
+func (db *Database) TaskComplete(ctx context.Context, id int64, playbookID string, taskID string, data any) (*model.TicketWithTickets, error) {
 	inc, err := db.TicketGet(ctx, id)
 	if err != nil {
 		return nil, err
@@ -68,7 +68,7 @@ func (db *Database) TaskComplete(ctx context.Context, id int64, playbookID strin
 	
 	UPDATE d WITH { "modified": @now, "playbooks": newplaybooks } IN @@collection
 	RETURN NEW`
-	ticket, err := db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{
+	ticket, err := db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{
 		"playbookID": playbookID,
 		"taskID":     taskID,
 		"data":       data,
@@ -130,7 +130,7 @@ func (db *Database) TaskUpdateOwner(ctx context.Context, id int64, playbookID st
 	
 	UPDATE d WITH { "modified": @now, "playbooks": newplaybooks } IN @@collection
 	RETURN NEW`
-	ticket, err := db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{
+	ticket, err := db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{
 		"playbookID": playbookID,
 		"taskID":     taskID,
 		"owner":      owner,
@@ -148,7 +148,7 @@ func (db *Database) TaskUpdateOwner(ctx context.Context, id int64, playbookID st
 	return ticket, nil
 }
 
-func (db *Database) TaskUpdateData(ctx context.Context, id int64, playbookID string, taskID string, data map[string]interface{}) (*model.TicketWithTickets, error) {
+func (db *Database) TaskUpdateData(ctx context.Context, id int64, playbookID string, taskID string, data map[string]any) (*model.TicketWithTickets, error) {
 	ticketFilterQuery, ticketFilterVars, err := db.Hooks.TicketWriteFilter(ctx)
 	if err != nil {
 		return nil, err
@@ -165,7 +165,7 @@ func (db *Database) TaskUpdateData(ctx context.Context, id int64, playbookID str
 	
 	UPDATE d WITH { "modified": @now, "playbooks": newplaybooks } IN @@collection
 	RETURN NEW`
-	ticket, err := db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]interface{}{
+	ticket, err := db.ticketGetQuery(ctx, id, query, mergeMaps(map[string]any{
 		"playbookID": playbookID,
 		"taskID":     taskID,
 		"data":       data,
@@ -198,7 +198,7 @@ func (db *Database) TaskRun(ctx context.Context, id int64, playbookID string, ta
 	return nil
 }
 
-func runNextTasks(id int64, playbookID string, next map[string]string, data interface{}, ticket *model.TicketResponse, db *Database) {
+func runNextTasks(id int64, playbookID string, next map[string]string, data any, ticket *model.TicketResponse, db *Database) {
 	for nextTaskID, requirement := range next {
 		nextTask := ticket.Playbooks[playbookID].Tasks[nextTaskID]
 		if nextTask.Type == model.TaskTypeAutomation {
@@ -220,5 +220,6 @@ func runTask(ticketID int64, playbookID string, taskID string, task *model.TaskR
 	msgContext := &model.Context{Playbook: playbook, Task: task, Ticket: ticket}
 	origin := &model.Origin{TaskOrigin: &model.TaskOrigin{TaskId: taskID, PlaybookId: playbookID, TicketId: ticketID}}
 	jobID := uuid.NewString()
+
 	return publishJobMapping(jobID, *task.Automation, msgContext, origin, task.Payload, db)
 }

database/tickettype.go

@@ -75,12 +75,13 @@ func (db *Database) TicketTypeUpdate(ctx context.Context, id string, tickettype
 
 func (db *Database) TicketTypeDelete(ctx context.Context, id string) error {
 	_, err := db.tickettypeCollection.RemoveDocument(ctx, id)
+
 	return err
 }
 
 func (db *Database) TicketTypeList(ctx context.Context) ([]*model.TicketTypeResponse, error) {
 	query := "FOR d IN @@collection RETURN d"
-	cursor, _, err := db.Query(ctx, query, map[string]interface{}{"@collection": TicketTypeCollectionName}, busdb.ReadOperation)
+	cursor, _, err := db.Query(ctx, query, map[string]any{"@collection": TicketTypeCollectionName}, busdb.ReadOperation)
 	if err != nil {
 		return nil, err
 	}

database/user.go

@@ -28,6 +28,7 @@ func generateKey() string {
 	for i := range b {
 		b[i] = letters[rand.Intn(len(letters))]
 	}
+
 	return string(b)
 }
 
@@ -78,8 +79,10 @@ func (db *Database) UserGetOrCreate(ctx context.Context, newUser *model.UserForm
 		if err != nil {
 			return nil, err
 		}
+
 		return &model.UserResponse{ID: newUser.ID, Roles: newUser.Roles, Blocked: newUser.Blocked}, nil
 	}
+
 	return user, nil
 }
 
@@ -132,12 +135,13 @@ func (db *Database) UserGet(ctx context.Context, id string) (*model.UserResponse
 
 func (db *Database) UserDelete(ctx context.Context, id string) error {
 	_, err := db.userCollection.RemoveDocument(ctx, id)
+
 	return err
 }
 
 func (db *Database) UserList(ctx context.Context) ([]*model.UserResponse, error) {
 	query := "FOR d IN @@collection RETURN d"
-	cursor, _, err := db.Query(ctx, query, map[string]interface{}{"@collection": UserCollectionName}, busdb.ReadOperation)
+	cursor, _, err := db.Query(ctx, query, map[string]any{"@collection": UserCollectionName}, busdb.ReadOperation)
 	if err != nil {
 		return nil, err
 	}
@@ -163,7 +167,7 @@ func (db *Database) UserByHash(ctx context.Context, sha256 string) (*model.UserR
 	FILTER d.sha256 == @sha256
 	RETURN d`
 
-	cursor, _, err := db.Query(ctx, query, map[string]interface{}{"@collection": UserCollectionName, "sha256": sha256}, busdb.ReadOperation)
+	cursor, _, err := db.Query(ctx, query, map[string]any{"@collection": UserCollectionName, "sha256": sha256}, busdb.ReadOperation)
 	if err != nil {
 		return nil, err
 	}

database/userdata.go

@@ -29,6 +29,7 @@ func (db *Database) UserDataCreate(ctx context.Context, id string, userdata *mod
 	}
 
 	_, err := db.userdataCollection.CreateDocument(ctx, ctx, id, userdata)
+
 	return err
 }
 
@@ -37,6 +38,7 @@ func (db *Database) UserDataGetOrCreate(ctx context.Context, id string, newUserD
 	if err != nil {
 		return toUserDataResponse(id, newUserData), db.UserDataCreate(ctx, id, newUserData)
 	}
+
 	return setting, nil
 }
 
@@ -52,7 +54,7 @@ func (db *Database) UserDataGet(ctx context.Context, id string) (*model.UserData
 
 func (db *Database) UserDataList(ctx context.Context) ([]*model.UserDataResponse, error) {
 	query := "FOR d IN @@collection SORT d.username ASC RETURN d"
-	cursor, _, err := db.Query(ctx, query, map[string]interface{}{"@collection": UserDataCollectionName}, busdb.ReadOperation)
+	cursor, _, err := db.Query(ctx, query, map[string]any{"@collection": UserDataCollectionName}, busdb.ReadOperation)
 	if err != nil {
 		return nil, err
 	}

database/userdata_test.go

@@ -22,6 +22,8 @@ var bobResponse = &model.UserDataResponse{
 }
 
 func TestDatabase_UserDataCreate(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		id      string
 		setting *model.UserData
@@ -37,7 +39,10 @@ func TestDatabase_UserDataCreate(t *testing.T) {
 		{name: "Only settingname", args: args{id: "bob"}, wantErr: true},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, db, cleanup, err := test.DB(t)
 			if err != nil {
 				t.Fatal(err)
@@ -52,6 +57,8 @@ func TestDatabase_UserDataCreate(t *testing.T) {
 }
 
 func TestDatabase_UserDataGet(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		id string
 	}
@@ -65,7 +72,10 @@ func TestDatabase_UserDataGet(t *testing.T) {
 		{name: "Not existing", args: args{id: "foo"}, wantErr: true},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, db, cleanup, err := test.DB(t)
 			if err != nil {
 				t.Fatal(err)
@@ -79,6 +89,7 @@ func TestDatabase_UserDataGet(t *testing.T) {
 			got, err := db.UserDataGet(test.Context(), tt.args.id)
 			if (err != nil) != tt.wantErr {
 				t.Errorf("UserDataGet() error = %v, wantErr %v", err, tt.wantErr)
+
 				return
 			}
 			if err != nil {
@@ -91,6 +102,8 @@ func TestDatabase_UserDataGet(t *testing.T) {
 }
 
 func TestDatabase_UserDataList(t *testing.T) {
+	t.Parallel()
+
 	tests := []struct {
 		name    string
 		want    []*model.UserDataResponse
@@ -99,7 +112,10 @@ func TestDatabase_UserDataList(t *testing.T) {
 		{name: "Normal list", want: []*model.UserDataResponse{bobResponse}},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, db, cleanup, err := test.DB(t)
 			if err != nil {
 				t.Fatal(err)
@@ -113,6 +129,7 @@ func TestDatabase_UserDataList(t *testing.T) {
 			got, err := db.UserDataList(test.Context())
 			if (err != nil) != tt.wantErr {
 				t.Errorf("UserDataList() error = %v, wantErr %v", err, tt.wantErr)
+
 				return
 			}
 
@@ -122,6 +139,8 @@ func TestDatabase_UserDataList(t *testing.T) {
 }
 
 func TestDatabase_UserDataUpdate(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		id      string
 		setting *model.UserData
@@ -135,7 +154,10 @@ func TestDatabase_UserDataUpdate(t *testing.T) {
 		{name: "Not existing", args: args{id: "foo"}, wantErr: true},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, db, cleanup, err := test.DB(t)
 			if err != nil {
 				t.Fatal(err)

file.go

@@ -30,11 +30,13 @@ func tusdUpload(db *database.Database, bus *bus.Bus, client *s3.S3, external str
 		ticketID := chi.URLParam(r, "ticketID")
 		if ticketID == "" {
 			api.JSONErrorStatus(w, http.StatusBadRequest, errors.New("ticketID not given"))
+
 			return
 		}
 
 		if err := storage.CreateBucket(client, ticketID); err != nil {
 			api.JSONErrorStatus(w, http.StatusBadRequest, fmt.Errorf("could not create bucket: %w", err))
+
 			return
 		}
 
@@ -50,6 +52,7 @@ func tusdUpload(db *database.Database, bus *bus.Bus, client *s3.S3, external str
 		})
 		if err != nil {
 			api.JSONErrorStatus(w, http.StatusBadRequest, fmt.Errorf("could not create tusd handler: %w", err))
+
 			return
 		}
 
@@ -73,6 +76,7 @@ func tusdUpload(db *database.Database, bus *bus.Bus, client *s3.S3, external str
 			doc, err := db.AddFile(ctx, id, file)
 			if err != nil {
 				log.Println(err)
+
 				return
 			}
 
@@ -92,7 +96,6 @@ func tusdUpload(db *database.Database, bus *bus.Bus, client *s3.S3, external str
 		default:
 			api.JSONErrorStatus(w, http.StatusInternalServerError, errors.New("unknown method"))
 		}
-
 	}
 }
 
@@ -101,18 +104,21 @@ func upload(db *database.Database, client *s3.S3, uploader *s3manager.Uploader)
 		ticketID := chi.URLParam(r, "ticketID")
 		if ticketID == "" {
 			api.JSONErrorStatus(w, http.StatusBadRequest, errors.New("ticketID not given"))
+
 			return
 		}
 
 		file, header, err := r.FormFile("file")
 		if err != nil {
 			api.JSONErrorStatus(w, http.StatusBadRequest, err)
+
 			return
 		}
 		defer file.Close()
 
 		if err := storage.CreateBucket(client, ticketID); err != nil {
 			api.JSONErrorStatus(w, http.StatusBadRequest, fmt.Errorf("could not create bucket: %w", err))
+
 			return
 		}
 
@@ -123,12 +129,14 @@ func upload(db *database.Database, client *s3.S3, uploader *s3manager.Uploader)
 		})
 		if err != nil {
 			api.JSONErrorStatus(w, http.StatusBadRequest, err)
+
 			return
 		}
 
 		id, err := strconv.ParseInt(ticketID, 10, 64)
 		if err != nil {
 			api.JSONErrorStatus(w, http.StatusBadRequest, err)
+
 			return
 		}
 
@@ -138,6 +146,7 @@ func upload(db *database.Database, client *s3.S3, uploader *s3manager.Uploader)
 		})
 		if err != nil {
 			api.JSONErrorStatus(w, http.StatusBadRequest, err)
+
 			return
 		}
 	}
@@ -148,12 +157,14 @@ func download(downloader *s3manager.Downloader) http.HandlerFunc {
 		ticketID := chi.URLParam(r, "ticketID")
 		if ticketID == "" {
 			api.JSONErrorStatus(w, http.StatusBadRequest, errors.New("ticketID not given"))
+
 			return
 		}
 
 		key := chi.URLParam(r, "key")
 		if key == "" {
 			api.JSONErrorStatus(w, http.StatusBadRequest, errors.New("key not given"))
+
 			return
 		}
 

generated/api/api.go

@@ -118,7 +118,7 @@ func parseQueryOptionalBoolArray(r *http.Request, key string) ([]bool, error) {
 	return parseQueryBoolArray(r, key)
 }
 
-func parseBody(b []byte, i interface{}) error {
+func parseBody(b []byte, i any) error {
 	dec := json.NewDecoder(bytes.NewBuffer(b))
 	err := dec.Decode(i)
 	if err != nil {
@@ -137,7 +137,7 @@ func JSONErrorStatus(w http.ResponseWriter, status int, err error) {
 	w.Write(b)
 }
 
-func response(w http.ResponseWriter, v interface{}, err error) {
+func response(w http.ResponseWriter, v any, err error) {
 	if err != nil {
 		var httpError *HTTPError
 		if errors.As(err, &httpError) {
@@ -172,7 +172,7 @@ func validateSchema(body []byte, schema *gojsonschema.Schema, w http.ResponseWri
 			validationErrors = append(validationErrors, valdiationError.String())
 		}
 
-		b, _ := json.Marshal(map[string]interface{}{"error": "wrong input", "errors": validationErrors})
+		b, _ := json.Marshal(map[string]any{"error": "wrong input", "errors": validationErrors})
 		w.Write(b)
 		return true
 	}

generated/api/server.go

@@ -19,7 +19,7 @@ type Service interface {
 	CurrentUser(context.Context) (*model.UserResponse, error)
 	CurrentUserData(context.Context) (*model.UserDataResponse, error)
 	UpdateCurrentUserData(context.Context, *model.UserData) (*model.UserDataResponse, error)
-	DashboardData(context.Context, string, *string) (map[string]interface{}, error)
+	DashboardData(context.Context, string, *string) (map[string]any, error)
 	ListDashboards(context.Context) ([]*model.DashboardResponse, error)
 	CreateDashboard(context.Context, *model.Dashboard) (*model.DashboardResponse, error)
 	GetDashboard(context.Context, string) (*model.DashboardResponse, error)
@@ -60,8 +60,8 @@ type Service interface {
 	RemoveComment(context.Context, int64, int) (*model.TicketWithTickets, error)
 	AddTicketPlaybook(context.Context, int64, *model.PlaybookTemplateForm) (*model.TicketWithTickets, error)
 	RemoveTicketPlaybook(context.Context, int64, string) (*model.TicketWithTickets, error)
-	SetTaskData(context.Context, int64, string, string, map[string]interface{}) (*model.TicketWithTickets, error)
-	CompleteTask(context.Context, int64, string, string, map[string]interface{}) (*model.TicketWithTickets, error)
+	SetTaskData(context.Context, int64, string, string, map[string]any) (*model.TicketWithTickets, error)
+	CompleteTask(context.Context, int64, string, string, map[string]any) (*model.TicketWithTickets, error)
 	SetTaskOwner(context.Context, int64, string, string, string) (*model.TicketWithTickets, error)
 	RunTask(context.Context, int64, string, string) error
 	SetReferences(context.Context, int64, *model.ReferenceArray) (*model.TicketWithTickets, error)
@@ -901,7 +901,7 @@ func (s *server) setTaskDataHandler(w http.ResponseWriter, r *http.Request) {
 		return
 	}
 
-	var dataP map[string]interface{}
+	var dataP map[string]any
 	if err := parseBody(body, &dataP); err != nil {
 		JSONError(w, err)
 		return
@@ -928,7 +928,7 @@ func (s *server) completeTaskHandler(w http.ResponseWriter, r *http.Request) {
 		return
 	}
 
-	var dataP map[string]interface{}
+	var dataP map[string]any
 	if err := parseBody(body, &dataP); err != nil {
 		JSONError(w, err)
 		return

generated/model/model.go

@@ -251,14 +251,14 @@ type DashboardResponse struct {
 }
 
 type Enrichment struct {
-	Created time.Time              `json:"created"`
-	Data    map[string]interface{} `json:"data"`
-	Name    string                 `json:"name"`
+	Created time.Time      `json:"created"`
+	Data    map[string]any `json:"data"`
+	Name    string         `json:"name"`
 }
 
 type EnrichmentForm struct {
-	Data map[string]interface{} `json:"data"`
-	Name string                 `json:"name"`
+	Data map[string]any `json:"data"`
+	Name string         `json:"name"`
 }
 
 type File struct {
@@ -267,39 +267,39 @@ type File struct {
 }
 
 type Job struct {
-	Automation string                 `json:"automation"`
-	Container  *string                `json:"container,omitempty"`
-	Log        *string                `json:"log,omitempty"`
-	Origin     *Origin                `json:"origin,omitempty"`
-	Output     map[string]interface{} `json:"output,omitempty"`
-	Payload    interface{}            `json:"payload,omitempty"`
-	Running    bool                   `json:"running"`
-	Status     string                 `json:"status"`
+	Automation string         `json:"automation"`
+	Container  *string        `json:"container,omitempty"`
+	Log        *string        `json:"log,omitempty"`
+	Origin     *Origin        `json:"origin,omitempty"`
+	Output     map[string]any `json:"output,omitempty"`
+	Payload    any            `json:"payload,omitempty"`
+	Running    bool           `json:"running"`
+	Status     string         `json:"status"`
 }
 
 type JobForm struct {
-	Automation string      `json:"automation"`
-	Origin     *Origin     `json:"origin,omitempty"`
-	Payload    interface{} `json:"payload,omitempty"`
+	Automation string  `json:"automation"`
+	Origin     *Origin `json:"origin,omitempty"`
+	Payload    any     `json:"payload,omitempty"`
 }
 
 type JobResponse struct {
-	Automation string                 `json:"automation"`
-	Container  *string                `json:"container,omitempty"`
-	ID         string                 `json:"id"`
-	Log        *string                `json:"log,omitempty"`
-	Origin     *Origin                `json:"origin,omitempty"`
-	Output     map[string]interface{} `json:"output,omitempty"`
-	Payload    interface{}            `json:"payload,omitempty"`
-	Status     string                 `json:"status"`
+	Automation string         `json:"automation"`
+	Container  *string        `json:"container,omitempty"`
+	ID         string         `json:"id"`
+	Log        *string        `json:"log,omitempty"`
+	Origin     *Origin        `json:"origin,omitempty"`
+	Output     map[string]any `json:"output,omitempty"`
+	Payload    any            `json:"payload,omitempty"`
+	Status     string         `json:"status"`
 }
 
 type JobUpdate struct {
-	Container *string                `json:"container,omitempty"`
-	Log       *string                `json:"log,omitempty"`
-	Output    map[string]interface{} `json:"output,omitempty"`
-	Running   bool                   `json:"running"`
-	Status    string                 `json:"status"`
+	Container *string        `json:"container,omitempty"`
+	Log       *string        `json:"log,omitempty"`
+	Output    map[string]any `json:"output,omitempty"`
+	Running   bool           `json:"running"`
+	Status    string         `json:"status"`
 }
 
 type LogEntry struct {
@@ -312,7 +312,7 @@ type LogEntry struct {
 
 type Message struct {
 	Context *Context          `json:"context,omitempty"`
-	Payload interface{}       `json:"payload,omitempty"`
+	Payload any               `json:"payload,omitempty"`
 	Secrets map[string]string `json:"secrets,omitempty"`
 }
 
@@ -385,18 +385,18 @@ type Statistics struct {
 }
 
 type Task struct {
-	Automation *string                `json:"automation,omitempty"`
-	Closed     *time.Time             `json:"closed,omitempty"`
-	Created    time.Time              `json:"created"`
-	Data       map[string]interface{} `json:"data,omitempty"`
-	Done       bool                   `json:"done"`
-	Join       *bool                  `json:"join,omitempty"`
-	Name       string                 `json:"name"`
-	Next       map[string]string      `json:"next,omitempty"`
-	Owner      *string                `json:"owner,omitempty"`
-	Payload    map[string]string      `json:"payload,omitempty"`
-	Schema     map[string]interface{} `json:"schema,omitempty"`
-	Type       string                 `json:"type"`
+	Automation *string           `json:"automation,omitempty"`
+	Closed     *time.Time        `json:"closed,omitempty"`
+	Created    time.Time         `json:"created"`
+	Data       map[string]any    `json:"data,omitempty"`
+	Done       bool              `json:"done"`
+	Join       *bool             `json:"join,omitempty"`
+	Name       string            `json:"name"`
+	Next       map[string]string `json:"next,omitempty"`
+	Owner      *string           `json:"owner,omitempty"`
+	Payload    map[string]string `json:"payload,omitempty"`
+	Schema     map[string]any    `json:"schema,omitempty"`
+	Type       string            `json:"type"`
 }
 
 type TaskOrigin struct {
@@ -406,20 +406,20 @@ type TaskOrigin struct {
 }
 
 type TaskResponse struct {
-	Active     bool                   `json:"active"`
-	Automation *string                `json:"automation,omitempty"`
-	Closed     *time.Time             `json:"closed,omitempty"`
-	Created    time.Time              `json:"created"`
-	Data       map[string]interface{} `json:"data,omitempty"`
-	Done       bool                   `json:"done"`
-	Join       *bool                  `json:"join,omitempty"`
-	Name       string                 `json:"name"`
-	Next       map[string]string      `json:"next,omitempty"`
-	Order      int64                  `json:"order"`
-	Owner      *string                `json:"owner,omitempty"`
-	Payload    map[string]string      `json:"payload,omitempty"`
-	Schema     map[string]interface{} `json:"schema,omitempty"`
-	Type       string                 `json:"type"`
+	Active     bool              `json:"active"`
+	Automation *string           `json:"automation,omitempty"`
+	Closed     *time.Time        `json:"closed,omitempty"`
+	Created    time.Time         `json:"created"`
+	Data       map[string]any    `json:"data,omitempty"`
+	Done       bool              `json:"done"`
+	Join       *bool             `json:"join,omitempty"`
+	Name       string            `json:"name"`
+	Next       map[string]string `json:"next,omitempty"`
+	Order      int64             `json:"order"`
+	Owner      *string           `json:"owner,omitempty"`
+	Payload    map[string]string `json:"payload,omitempty"`
+	Schema     map[string]any    `json:"schema,omitempty"`
+	Type       string            `json:"type"`
 }
 
 type TaskWithContext struct {
@@ -432,28 +432,28 @@ type TaskWithContext struct {
 }
 
 type Ticket struct {
-	Artifacts  []*Artifact            `json:"artifacts,omitempty"`
-	Comments   []*Comment             `json:"comments,omitempty"`
-	Created    time.Time              `json:"created"`
-	Details    map[string]interface{} `json:"details,omitempty"`
-	Files      []*File                `json:"files,omitempty"`
-	Modified   time.Time              `json:"modified"`
-	Name       string                 `json:"name"`
-	Owner      *string                `json:"owner,omitempty"`
-	Playbooks  map[string]*Playbook   `json:"playbooks,omitempty"`
-	Read       []string               `json:"read,omitempty"`
-	References []*Reference           `json:"references,omitempty"`
-	Schema     string                 `json:"schema"`
-	Status     string                 `json:"status"`
-	Type       string                 `json:"type"`
-	Write      []string               `json:"write,omitempty"`
+	Artifacts  []*Artifact          `json:"artifacts,omitempty"`
+	Comments   []*Comment           `json:"comments,omitempty"`
+	Created    time.Time            `json:"created"`
+	Details    map[string]any       `json:"details,omitempty"`
+	Files      []*File              `json:"files,omitempty"`
+	Modified   time.Time            `json:"modified"`
+	Name       string               `json:"name"`
+	Owner      *string              `json:"owner,omitempty"`
+	Playbooks  map[string]*Playbook `json:"playbooks,omitempty"`
+	Read       []string             `json:"read,omitempty"`
+	References []*Reference         `json:"references,omitempty"`
+	Schema     string               `json:"schema"`
+	Status     string               `json:"status"`
+	Type       string               `json:"type"`
+	Write      []string             `json:"write,omitempty"`
 }
 
 type TicketForm struct {
 	Artifacts  []*Artifact             `json:"artifacts,omitempty"`
 	Comments   []*Comment              `json:"comments,omitempty"`
 	Created    *time.Time              `json:"created,omitempty"`
-	Details    map[string]interface{}  `json:"details,omitempty"`
+	Details    map[string]any          `json:"details,omitempty"`
 	Files      []*File                 `json:"files,omitempty"`
 	ID         *int64                  `json:"id,omitempty"`
 	Modified   *time.Time              `json:"modified,omitempty"`
@@ -479,7 +479,7 @@ type TicketResponse struct {
 	Artifacts  []*Artifact                  `json:"artifacts,omitempty"`
 	Comments   []*Comment                   `json:"comments,omitempty"`
 	Created    time.Time                    `json:"created"`
-	Details    map[string]interface{}       `json:"details,omitempty"`
+	Details    map[string]any               `json:"details,omitempty"`
 	Files      []*File                      `json:"files,omitempty"`
 	ID         int64                        `json:"id"`
 	Modified   time.Time                    `json:"modified"`
@@ -495,22 +495,22 @@ type TicketResponse struct {
 }
 
 type TicketSimpleResponse struct {
-	Artifacts  []*Artifact            `json:"artifacts,omitempty"`
-	Comments   []*Comment             `json:"comments,omitempty"`
-	Created    time.Time              `json:"created"`
-	Details    map[string]interface{} `json:"details,omitempty"`
-	Files      []*File                `json:"files,omitempty"`
-	ID         int64                  `json:"id"`
-	Modified   time.Time              `json:"modified"`
-	Name       string                 `json:"name"`
-	Owner      *string                `json:"owner,omitempty"`
-	Playbooks  map[string]*Playbook   `json:"playbooks,omitempty"`
-	Read       []string               `json:"read,omitempty"`
-	References []*Reference           `json:"references,omitempty"`
-	Schema     string                 `json:"schema"`
-	Status     string                 `json:"status"`
-	Type       string                 `json:"type"`
-	Write      []string               `json:"write,omitempty"`
+	Artifacts  []*Artifact          `json:"artifacts,omitempty"`
+	Comments   []*Comment           `json:"comments,omitempty"`
+	Created    time.Time            `json:"created"`
+	Details    map[string]any       `json:"details,omitempty"`
+	Files      []*File              `json:"files,omitempty"`
+	ID         int64                `json:"id"`
+	Modified   time.Time            `json:"modified"`
+	Name       string               `json:"name"`
+	Owner      *string              `json:"owner,omitempty"`
+	Playbooks  map[string]*Playbook `json:"playbooks,omitempty"`
+	Read       []string             `json:"read,omitempty"`
+	References []*Reference         `json:"references,omitempty"`
+	Schema     string               `json:"schema"`
+	Status     string               `json:"status"`
+	Type       string               `json:"type"`
+	Write      []string             `json:"write,omitempty"`
 }
 
 type TicketTemplate struct {
@@ -560,7 +560,7 @@ type TicketWithTickets struct {
 	Artifacts  []*Artifact                  `json:"artifacts,omitempty"`
 	Comments   []*Comment                   `json:"comments,omitempty"`
 	Created    time.Time                    `json:"created"`
-	Details    map[string]interface{}       `json:"details,omitempty"`
+	Details    map[string]any               `json:"details,omitempty"`
 	Files      []*File                      `json:"files,omitempty"`
 	ID         int64                        `json:"id"`
 	Logs       []*LogEntry                  `json:"logs,omitempty"`

go.mod

@@ -1,53 +1,93 @@
 module github.com/SecurityBrewery/catalyst
 
-go 1.16
+go 1.18
 
 require (
-	github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1 // indirect
-	github.com/Microsoft/go-winio v0.5.1 // indirect
 	github.com/alecthomas/kong v0.2.17
 	github.com/alecthomas/kong-yaml v0.1.1
 	github.com/antlr/antlr4/runtime/Go/antlr v0.0.0-20211101200231-0802afb9c160
 	github.com/arangodb/go-driver v1.2.1
 	github.com/aws/aws-sdk-go v1.41.19
-	github.com/bits-and-blooms/bitset v1.2.1 // indirect
 	github.com/blevesearch/bleve/v2 v2.2.2
-	github.com/bmizerany/pat v0.0.0-20210406213842-e4b6760bdd6f // indirect
-	github.com/containerd/containerd v1.5.8 // indirect
 	github.com/coreos/go-oidc/v3 v3.1.0
 	github.com/docker/docker v17.12.0-ce-rc1.0.20201201034508-7d75c1d40d88+incompatible
-	github.com/docker/go-connections v0.4.0 // indirect
-	github.com/eclipse/paho.mqtt.golang v1.3.5 // indirect
 	github.com/emitter-io/go/v2 v2.0.9
 	github.com/go-chi/chi v1.5.4
 	github.com/go-chi/cors v1.2.0
 	github.com/gobwas/ws v1.1.0
-	github.com/golang/snappy v0.0.4 // indirect
 	github.com/google/uuid v1.3.0
-	github.com/gorilla/mux v1.8.0 // indirect
 	github.com/iancoleman/strcase v0.2.0
 	github.com/icza/dyno v0.0.0-20210726202311-f1bafe5d9996
 	github.com/imdario/mergo v0.3.12
-	github.com/kr/pretty v0.3.0 // indirect
 	github.com/mingrammer/commonregex v1.0.1
-	github.com/morikuni/aec v1.0.0 // indirect
-	github.com/opencontainers/image-spec v1.0.2 // indirect
-	github.com/rogpeppe/go-internal v1.8.0 // indirect
 	github.com/stretchr/testify v1.7.0
 	github.com/tidwall/gjson v1.12.1
 	github.com/tidwall/sjson v1.2.4
 	github.com/tus/tusd v1.8.0
-	github.com/xeipuuv/gojsonpointer v0.0.0-20190905194746-02993c407bfb // indirect
 	github.com/xeipuuv/gojsonschema v1.2.0
-	go.etcd.io/bbolt v1.3.6 // indirect
-	golang.org/x/crypto v0.0.0-20210921155107-089bfa567519 // indirect
-	golang.org/x/net v0.0.0-20211105192438-b53810dc28af // indirect
+	golang.org/x/exp v0.0.0-20220318154914-8dddf5d87bd8
 	golang.org/x/oauth2 v0.0.0-20211104180415-d3ed0bb246c8
-	golang.org/x/sys v0.0.0-20211105183446-c75c47738b0c // indirect
-	golang.org/x/text v0.3.7 // indirect
-	gopkg.in/square/go-jose.v2 v2.6.0 // indirect
 	gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b
+)
 
+require (
+	github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1 // indirect
+	github.com/Microsoft/go-winio v0.5.1 // indirect
+	github.com/RoaringBitmap/roaring v0.9.4 // indirect
+	github.com/arangodb/go-velocypack v0.0.0-20200318135517-5af53c29c67e // indirect
+	github.com/bits-and-blooms/bitset v1.2.1 // indirect
+	github.com/blevesearch/bleve_index_api v1.0.1 // indirect
+	github.com/blevesearch/go-porterstemmer v1.0.3 // indirect
+	github.com/blevesearch/mmap-go v1.0.3 // indirect
+	github.com/blevesearch/scorch_segment_api/v2 v2.1.0 // indirect
+	github.com/blevesearch/segment v0.9.0 // indirect
+	github.com/blevesearch/snowballstem v0.9.0 // indirect
+	github.com/blevesearch/upsidedown_store_api v1.0.1 // indirect
+	github.com/blevesearch/vellum v1.0.7 // indirect
+	github.com/blevesearch/zapx/v11 v11.3.1 // indirect
+	github.com/blevesearch/zapx/v12 v12.3.1 // indirect
+	github.com/blevesearch/zapx/v13 v13.3.1 // indirect
+	github.com/blevesearch/zapx/v14 v14.3.1 // indirect
+	github.com/blevesearch/zapx/v15 v15.3.1 // indirect
+	github.com/bmizerany/pat v0.0.0-20210406213842-e4b6760bdd6f // indirect
+	github.com/containerd/containerd v1.5.8 // indirect
+	github.com/davecgh/go-spew v1.1.1 // indirect
+	github.com/docker/distribution v2.7.1+incompatible // indirect
+	github.com/docker/go-connections v0.4.0 // indirect
+	github.com/docker/go-units v0.4.0 // indirect
+	github.com/eclipse/paho.mqtt.golang v1.3.5 // indirect
+	github.com/gobwas/httphead v0.1.0 // indirect
+	github.com/gobwas/pool v0.2.1 // indirect
+	github.com/gogo/protobuf v1.3.2 // indirect
+	github.com/golang/protobuf v1.5.2 // indirect
+	github.com/golang/snappy v0.0.4 // indirect
+	github.com/gorilla/mux v1.8.0 // indirect
+	github.com/gorilla/websocket v1.4.2 // indirect
+	github.com/jmespath/go-jmespath v0.4.0 // indirect
+	github.com/kr/pretty v0.3.0 // indirect
+	github.com/morikuni/aec v1.0.0 // indirect
+	github.com/mschoch/smat v0.2.0 // indirect
+	github.com/opencontainers/go-digest v1.0.0 // indirect
+	github.com/opencontainers/image-spec v1.0.2 // indirect
+	github.com/pkg/errors v0.9.1 // indirect
+	github.com/pmezard/go-difflib v1.0.0 // indirect
+	github.com/rogpeppe/go-internal v1.8.0 // indirect
+	github.com/sirupsen/logrus v1.8.1 // indirect
+	github.com/steveyen/gtreap v0.1.0 // indirect
+	github.com/tidwall/match v1.1.1 // indirect
+	github.com/tidwall/pretty v1.2.0 // indirect
+	github.com/xeipuuv/gojsonpointer v0.0.0-20190905194746-02993c407bfb // indirect
+	github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect
+	go.etcd.io/bbolt v1.3.6 // indirect
+	golang.org/x/crypto v0.0.0-20210322153248-0c34fe9e7dc2 // indirect
+	golang.org/x/net v0.0.0-20211105192438-b53810dc28af // indirect
+	golang.org/x/sys v0.0.0-20211105183446-c75c47738b0c // indirect
+	google.golang.org/appengine v1.6.7 // indirect
+	google.golang.org/genproto v0.0.0-20211021150943-2b146023228c // indirect
+	google.golang.org/grpc v1.41.0 // indirect
+	google.golang.org/protobuf v1.27.1 // indirect
+	gopkg.in/square/go-jose.v2 v2.6.0 // indirect
+	gopkg.in/yaml.v2 v2.4.0 // indirect
 )
 
 replace github.com/xeipuuv/gojsonschema => github.com/warjiang/gojsonschema v1.2.1-0.20210329105853-aa9f9a8cfec7

go.sum

@@ -276,7 +276,6 @@ github.com/coreos/go-etcd v2.0.0+incompatible/go.mod h1:Jez6KQU2B/sWsbdaef3ED8Nz
 github.com/coreos/go-iptables v0.4.3/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmekav8Dbxlm1MU=
 github.com/coreos/go-iptables v0.4.5/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmekav8Dbxlm1MU=
 github.com/coreos/go-iptables v0.5.0/go.mod h1:/mVI274lEDI2ns62jHCDnCyBF9Iwsmekav8Dbxlm1MU=
-github.com/coreos/go-oidc v2.1.0+incompatible h1:sdJrfw8akMnCuUlaZU3tE/uYXFgfqom8DBE9so9EBsM=
 github.com/coreos/go-oidc v2.1.0+incompatible/go.mod h1:CgnwVTmzoESiwO9qyAFEMiHoZ1nMCKZlZ9V6mm3/LKc=
 github.com/coreos/go-oidc/v3 v3.1.0 h1:6avEvcdvTa1qYsOZ6I5PRkSYHzpTNWgKYmaJfaYbrRw=
 github.com/coreos/go-oidc/v3 v3.1.0/go.mod h1:rEJ/idjfUyfkBit1eI1fvyr+64/g9dcKpAm8MJMesvo=
@@ -833,9 +832,8 @@ golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8U
 golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
 golang.org/x/crypto v0.0.0-20200728195943-123391ffb6de/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
 golang.org/x/crypto v0.0.0-20201002170205-7f63de1d35b0/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
+golang.org/x/crypto v0.0.0-20210322153248-0c34fe9e7dc2 h1:It14KIkyBFYkHkwZ7k45minvA9aorojkyjGk9KJ5B/w=
 golang.org/x/crypto v0.0.0-20210322153248-0c34fe9e7dc2/go.mod h1:T9bdIzuCu7OtxOm1hfPfRQxPLYneinmdGuTeoZ9dtd4=
-golang.org/x/crypto v0.0.0-20210921155107-089bfa567519 h1:7I4JAnoQBe7ZtJcBaYHi5UtiO8tQHbUSXxL+pnGRANg=
-golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
 golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
 golang.org/x/exp v0.0.0-20190306152737-a1d7652674e8/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
 golang.org/x/exp v0.0.0-20190510132918-efd6b22b2522/go.mod h1:ZjyILWgesfNpC6sMxTJOJm9Kp84zZh5NQWvqDGG3Qr8=
@@ -846,6 +844,8 @@ golang.org/x/exp v0.0.0-20191227195350-da58074b4299/go.mod h1:2RIsYlXP63K8oxa1u0
 golang.org/x/exp v0.0.0-20200119233911-0405dc783f0a/go.mod h1:2RIsYlXP63K8oxa1u096TMicItID8zy7Y6sNkU49FU4=
 golang.org/x/exp v0.0.0-20200207192155-f17229e696bd/go.mod h1:J/WKrq2StrnmMY6+EHIKF9dgMWnmCNThgcyBT1FY9mM=
 golang.org/x/exp v0.0.0-20200224162631-6cc2880d07d6/go.mod h1:3jZMyOhIsHpP37uCMkUooju7aAi5cS1Q23tOzKc+0MU=
+golang.org/x/exp v0.0.0-20220318154914-8dddf5d87bd8 h1:s/+U+w0teGzcoH2mdIlFQ6KfVKGaYpgyGdUefZrn9TU=
+golang.org/x/exp v0.0.0-20220318154914-8dddf5d87bd8/go.mod h1:lgLbSvA5ygNOMpwM/9anMpWVlVJ7Z+cHWq/eFuinpGE=
 golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js=
 golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0=
 golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
@@ -1040,7 +1040,6 @@ golang.org/x/sys v0.0.0-20210510120138-977fb7262007/go.mod h1:oPkhp1MJrh7nUepCBc
 golang.org/x/sys v0.0.0-20210514084401-e8d321eab015/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20210603081109-ebe580a85c40/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20210603125802-9665404d3644/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
-golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20210616094352-59db8d763f22/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20210630005230-0f9fa26af87c/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20210806184541-e5e7981a1069/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
@@ -1058,9 +1057,8 @@ golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
 golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
 golang.org/x/text v0.3.4/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
 golang.org/x/text v0.3.5/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
+golang.org/x/text v0.3.6 h1:aRYxNxv6iGQlyVaZmk6ZgYEDa+Jg18DxebPSrd6bg1M=
 golang.org/x/text v0.3.6/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
-golang.org/x/text v0.3.7 h1:olpwvP2KacW1ZWvsR7uQhoyTYvKAupfQrRGBFM352Gk=
-golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ=
 golang.org/x/time v0.0.0-20180412165947-fbb02b2291d2/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
 golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
 golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=

hooks/hooks.go

@@ -11,8 +11,8 @@ import (
 type Hooks struct {
 	DatabaseAfterConnectFuncs []func(ctx context.Context, client driver.Client, name string)
 	IngestionFilterFunc       func(ctx context.Context, index *index.Index) (string, error)
-	TicketReadFilterFunc      func(ctx context.Context) (string, map[string]interface{}, error)
-	TicketWriteFilterFunc     func(ctx context.Context) (string, map[string]interface{}, error)
+	TicketReadFilterFunc      func(ctx context.Context) (string, map[string]any, error)
+	TicketWriteFilterFunc     func(ctx context.Context) (string, map[string]any, error)
 	GetGroupsFunc             func(ctx context.Context, username string) ([]string, error)
 }
 
@@ -26,20 +26,23 @@ func (h *Hooks) IngestionFilter(ctx context.Context, index *index.Index) (string
 	if h.IngestionFilterFunc != nil {
 		return h.IngestionFilterFunc(ctx, index)
 	}
+
 	return "[]", nil
 }
 
-func (h *Hooks) TicketReadFilter(ctx context.Context) (string, map[string]interface{}, error) {
+func (h *Hooks) TicketReadFilter(ctx context.Context) (string, map[string]any, error) {
 	if h.TicketReadFilterFunc != nil {
 		return h.TicketReadFilterFunc(ctx)
 	}
+
 	return "", nil, nil
 }
 
-func (h *Hooks) TicketWriteFilter(ctx context.Context) (string, map[string]interface{}, error) {
+func (h *Hooks) TicketWriteFilter(ctx context.Context) (string, map[string]any, error) {
 	if h.TicketWriteFilterFunc != nil {
 		return h.TicketWriteFilterFunc(ctx)
 	}
+
 	return "", nil, nil
 }
 
@@ -47,5 +50,6 @@ func (h *Hooks) GetGroups(ctx context.Context, username string) ([]string, error
 	if h.GetGroupsFunc != nil {
 		return h.GetGroupsFunc(ctx, username)
 	}
+
 	return nil, nil
 }

index/index.go

@@ -36,6 +36,7 @@ func (i *Index) Index(incidents []*model.TicketSimpleResponse) {
 	for _, incident := range incidents {
 		if incident.ID == 0 {
 			log.Println(errors.New("no ID"), incident)
+
 			continue
 		}
 
@@ -44,8 +45,8 @@ func (i *Index) Index(incidents []*model.TicketSimpleResponse) {
 			log.Println(err)
 		}
 	}
-	err := i.internal.Batch(b)
-	if err != nil {
+
+	if err := i.internal.Batch(b); err != nil {
 		log.Println(err)
 	}
 }
@@ -59,6 +60,7 @@ func (i *Index) Search(term string) (ids []string, err error) {
 	for _, match := range result.Hits {
 		ids = append(ids, match.ID)
 	}
+
 	return ids, nil
 }
 
@@ -76,6 +78,7 @@ func (i *Index) Truncate() error {
 		return err
 	}
 	i.internal = index
+
 	return nil
 }
 

index/index_test.go

@@ -9,6 +9,8 @@ import (
 )
 
 func TestIndex(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		term string
 	}
@@ -22,7 +24,10 @@ func TestIndex(t *testing.T) {
 		{name: "Not exists", args: args{"bar"}},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			i, cleanup, err := test.Index(t)
 			if err != nil {
 				t.Fatal(err)
@@ -37,6 +42,7 @@ func TestIndex(t *testing.T) {
 			gotIds, err := i.Search(tt.args.term)
 			if (err != nil) != tt.wantErr {
 				t.Errorf("Search() error = %v, wantErr %v", err, tt.wantErr)
+
 				return
 			}
 			if !reflect.DeepEqual(gotIds, tt.wantIds) {
@@ -47,6 +53,8 @@ func TestIndex(t *testing.T) {
 }
 
 func TestIndex_Truncate(t *testing.T) {
+	t.Parallel()
+
 	tests := []struct {
 		name    string
 		wantErr bool
@@ -54,7 +62,10 @@ func TestIndex_Truncate(t *testing.T) {
 		{name: "Truncate"},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			i, cleanup, err := test.Index(t)
 			if err != nil {
 				t.Fatal(err)

restore.go

@@ -29,11 +29,13 @@ func restoreHandler(catalystStorage *storage.Storage, db *database.Database, c *
 		uf, header, err := r.FormFile("backup")
 		if err != nil {
 			api.JSONError(w, err)
+
 			return
 		}
 
 		if err = Restore(r.Context(), catalystStorage, db, c, uf, header.Size); err != nil {
 			api.JSONError(w, err)
+
 			return
 		}
 	}
@@ -52,7 +54,7 @@ func Restore(ctx context.Context, catalystStorage *storage.Storage, db *database
 	}
 
 	if fsys.Comment != GetVersion() {
-		return errors.New(fmt.Sprintf("wrong version, got: %s, want: %s", fsys.Comment, GetVersion()))
+		return fmt.Errorf("wrong version, got: %s, want: %s", fsys.Comment, GetVersion())
 	}
 
 	dir, err := os.MkdirTemp("", "catalyst-restore")
@@ -89,17 +91,19 @@ func restoreS3(catalystStorage *storage.Storage, p string) error {
 			return err
 		}
 	}
+
 	return nil
 }
 
 func restoreBucket(catalystStorage *storage.Storage, entry fs.DirEntry, minioDir fs.FS) error {
 	_, err := catalystStorage.S3().CreateBucket(&s3.CreateBucketInput{Bucket: pointer.String(entry.Name())})
 	if err != nil {
-		awsError, ok := err.(awserr.Error)
-		if !ok || (awsError.Code() != s3.ErrCodeBucketAlreadyExists && awsError.Code() != s3.ErrCodeBucketAlreadyOwnedByYou) {
-			return err
+		var awsError awserr.Error
+		if errors.As(err, &awsError) && (awsError.Code() == s3.ErrCodeBucketAlreadyExists || awsError.Code() == s3.ErrCodeBucketAlreadyOwnedByYou) {
+			return nil
 		}
-		return nil
+
+		return err
 	}
 
 	uploader := catalystStorage.Uploader()
@@ -115,11 +119,13 @@ func restoreBucket(catalystStorage *storage.Storage, entry fs.DirEntry, minioDir
 			return nil
 		}
 		_, err = uploader.Upload(&s3manager.UploadInput{Body: f, Bucket: pointer.String(entry.Name()), Key: pointer.String(path)})
+
 		return err
 	})
 	if err != nil {
 		return err
 	}
+
 	return nil
 }
 
@@ -131,6 +137,7 @@ func unzip(archive *zip.Reader, dir string) error {
 
 		if d.IsDir() {
 			_ = os.MkdirAll(path.Join(dir, p), os.ModePerm)
+
 			return nil
 		}
 
@@ -163,5 +170,6 @@ func arangorestore(dir string, config *database.Config) error {
 		"--server.database", name,
 	}
 	cmd := exec.Command("arangorestore", args...)
+
 	return cmd.Run()
 }

role/role.go

@@ -5,6 +5,8 @@ import (
 	"sort"
 	"strings"
 
+	"golang.org/x/exp/slices"
+
 	"github.com/SecurityBrewery/catalyst/generated/model"
 )
 
@@ -60,23 +62,16 @@ func UserHasRoles(user *model.UserResponse, roles []Role) bool {
 	for _, role := range roles {
 		if !UserHasRole(user, role) {
 			hasRoles = false
+
 			break
 		}
 	}
+
 	return hasRoles
 }
 
 func UserHasRole(user *model.UserResponse, role Role) bool {
-	return ContainsRole(FromStrings(user.Roles), role)
-}
-
-func ContainsRole(roles []Role, role Role) bool {
-	for _, r := range roles {
-		if r.String() == role.String() { //  || strings.HasPrefix(role.String(), r.String()+":")
-			return true
-		}
-	}
-	return false
+	return slices.Contains(FromStrings(user.Roles), role)
 }
 
 func Explodes(s []string) []Role {
@@ -84,10 +79,10 @@ func Explodes(s []string) []Role {
 	for _, e := range s {
 		roles = append(roles, Explode(e)...)
 	}
-	roles = unique(roles)
 	sort.Slice(roles, func(i, j int) bool {
 		return roles[i].String() < roles[j].String()
 	})
+	roles = slices.Compact(roles)
 
 	return roles
 }
@@ -98,12 +93,15 @@ func Explode(s string) []Role {
 	switch s {
 	case Admin:
 		roles = append(roles, listPrefix(Admin)...)
+
 		fallthrough
 	case Engineer:
 		roles = append(roles, listPrefix(Engineer)...)
+
 		fallthrough
 	case Analyst:
 		roles = append(roles, listPrefix(Analyst)...)
+
 		return roles
 	}
 
@@ -128,18 +126,6 @@ func listPrefix(s string) []Role {
 	return roles
 }
 
-func unique(l []Role) []Role {
-	keys := make(map[Role]bool)
-	var list []Role
-	for _, entry := range l {
-		if _, value := keys[entry]; !value {
-			keys[entry] = true
-			list = append(list, entry)
-		}
-	}
-	return list
-}
-
 func List() []Role {
 	return []Role{
 		AutomationRead, CurrentuserdataRead, CurrentuserdataWrite,
@@ -167,6 +153,7 @@ func Strings(roles []Role) []string {
 	for _, role := range roles {
 		s = append(s, role.String())
 	}
+
 	return s
 }
 
@@ -179,5 +166,6 @@ func FromStrings(s []string) []Role {
 		}
 		roles = append(roles, role)
 	}
+
 	return roles
 }

service/automation.go

@@ -14,6 +14,7 @@ func automationResponseID(automation *model.AutomationResponse) []driver.Documen
 	if automation == nil {
 		return nil
 	}
+
 	return automationID(automation.ID)
 }
 
@@ -27,6 +28,7 @@ func (s *Service) ListAutomations(ctx context.Context) ([]*model.AutomationRespo
 
 func (s *Service) CreateAutomation(ctx context.Context, form *model.AutomationForm) (doc *model.AutomationResponse, err error) {
 	defer s.publishRequest(ctx, err, "CreateAutomation", automationResponseID(doc))
+
 	return s.database.AutomationCreate(ctx, form)
 }
 
@@ -36,10 +38,12 @@ func (s *Service) GetAutomation(ctx context.Context, id string) (*model.Automati
 
 func (s *Service) UpdateAutomation(ctx context.Context, id string, form *model.AutomationForm) (doc *model.AutomationResponse, err error) {
 	defer s.publishRequest(ctx, err, "UpdateAutomation", automationResponseID(doc))
+
 	return s.database.AutomationUpdate(ctx, id, form)
 }
 
 func (s *Service) DeleteAutomation(ctx context.Context, id string) (err error) {
 	defer s.publishRequest(ctx, err, "DeleteAutomation", automationID(id))
+
 	return s.database.AutomationDelete(ctx, id)
 }

service/dashboard.go

@@ -14,6 +14,7 @@ func dashboardResponseID(doc *model.DashboardResponse) []driver.DocumentID {
 	if doc == nil {
 		return nil
 	}
+
 	return templateID(doc.ID)
 }
 
@@ -27,6 +28,7 @@ func (s *Service) ListDashboards(ctx context.Context) ([]*model.DashboardRespons
 
 func (s *Service) CreateDashboard(ctx context.Context, dashboard *model.Dashboard) (doc *model.DashboardResponse, err error) {
 	defer s.publishRequest(ctx, err, "CreateDashboard", dashboardResponseID(doc))
+
 	return s.database.DashboardCreate(ctx, dashboard)
 }
 
@@ -36,14 +38,16 @@ func (s *Service) GetDashboard(ctx context.Context, id string) (*model.Dashboard
 
 func (s *Service) UpdateDashboard(ctx context.Context, id string, form *model.Dashboard) (doc *model.DashboardResponse, err error) {
 	defer s.publishRequest(ctx, err, "UpdateDashboard", dashboardResponseID(doc))
+
 	return s.database.DashboardUpdate(ctx, id, form)
 }
 
 func (s *Service) DeleteDashboard(ctx context.Context, id string) (err error) {
 	defer s.publishRequest(ctx, err, "DeleteDashboard", dashboardID(id))
+
 	return s.database.DashboardDelete(ctx, id)
 }
 
-func (s *Service) DashboardData(ctx context.Context, aggregation string, filter *string) (map[string]interface{}, error) {
+func (s *Service) DashboardData(ctx context.Context, aggregation string, filter *string) (map[string]any, error) {
 	return s.database.WidgetData(ctx, aggregation, filter)
 }

service/job.go

@@ -15,6 +15,7 @@ func jobResponseID(job *model.JobResponse) []driver.DocumentID {
 	if job == nil {
 		return nil
 	}
+
 	return jobID(job.ID)
 }
 
@@ -48,5 +49,6 @@ func (s *Service) GetJob(ctx context.Context, id string) (*model.JobResponse, er
 
 func (s *Service) UpdateJob(ctx context.Context, id string, job *model.JobUpdate) (doc *model.JobResponse, err error) {
 	defer s.publishRequest(ctx, err, "UpdateJob", jobResponseID(doc))
+
 	return s.database.JobUpdate(ctx, id, job)
 }

service/log.go

@@ -9,5 +9,6 @@ import (
 
 func (s *Service) GetLogs(ctx context.Context, reference string) ([]*model.LogEntry, error) {
 	id, _ := url.QueryUnescape(reference)
+
 	return s.database.LogList(ctx, id)
 }

service/playbook.go

@@ -14,6 +14,7 @@ func playbookResponseID(playbook *model.PlaybookTemplateResponse) []driver.Docum
 	if playbook == nil {
 		return nil
 	}
+
 	return playbookID(playbook.ID)
 }
 
@@ -27,6 +28,7 @@ func (s *Service) ListPlaybooks(ctx context.Context) ([]*model.PlaybookTemplateR
 
 func (s *Service) CreatePlaybook(ctx context.Context, form *model.PlaybookTemplateForm) (doc *model.PlaybookTemplateResponse, err error) {
 	defer s.publishRequest(ctx, err, "CreatePlaybook", playbookResponseID(doc))
+
 	return s.database.PlaybookCreate(ctx, form)
 }
 
@@ -36,10 +38,12 @@ func (s *Service) GetPlaybook(ctx context.Context, id string) (*model.PlaybookTe
 
 func (s *Service) UpdatePlaybook(ctx context.Context, id string, form *model.PlaybookTemplateForm) (doc *model.PlaybookTemplateResponse, err error) {
 	defer s.publishRequest(ctx, err, "UpdatePlaybook", playbookResponseID(doc))
+
 	return s.database.PlaybookUpdate(ctx, id, form)
 }
 
 func (s *Service) DeletePlaybook(ctx context.Context, id string) (err error) {
 	defer s.publishRequest(ctx, err, "DeletePlaybook", playbookID(id))
+
 	return s.database.PlaybookDelete(ctx, id)
 }

service/service.go

@@ -2,6 +2,7 @@ package service
 
 import (
 	"context"
+	"log"
 
 	"github.com/arangodb/go-driver"
 
@@ -33,6 +34,10 @@ func (s *Service) publishRequest(ctx context.Context, err error, function string
 			userID = user.ID
 		}
 
-		go s.bus.PublishRequest(userID, function, ids)
+		go func() {
+			if err := s.bus.PublishRequest(userID, function, ids); err != nil {
+				log.Println(err)
+			}
+		}()
 	}
 }

service/template.go

@@ -14,6 +14,7 @@ func templateResponseID(template *model.TicketTemplateResponse) []driver.Documen
 	if template == nil {
 		return nil
 	}
+
 	return templateID(template.ID)
 }
 
@@ -27,6 +28,7 @@ func (s *Service) ListTemplates(ctx context.Context) ([]*model.TicketTemplateRes
 
 func (s *Service) CreateTemplate(ctx context.Context, form *model.TicketTemplateForm) (doc *model.TicketTemplateResponse, err error) {
 	defer s.publishRequest(ctx, err, "CreateTemplate", templateResponseID(doc))
+
 	return s.database.TemplateCreate(ctx, form)
 }
 
@@ -36,10 +38,12 @@ func (s *Service) GetTemplate(ctx context.Context, id string) (*model.TicketTemp
 
 func (s *Service) UpdateTemplate(ctx context.Context, id string, form *model.TicketTemplateForm) (doc *model.TicketTemplateResponse, err error) {
 	defer s.publishRequest(ctx, err, "UpdateTemplate", templateResponseID(doc))
+
 	return s.database.TemplateUpdate(ctx, id, form)
 }
 
 func (s *Service) DeleteTemplate(ctx context.Context, id string) (err error) {
 	defer s.publishRequest(ctx, err, "DeleteTemplate", templateID(id))
+
 	return s.database.TemplateDelete(ctx, id)
 }

service/ticket.go

@@ -18,11 +18,13 @@ func ticketWithTicketsID(ticketResponse *model.TicketWithTickets) []driver.Docum
 	if ticketResponse == nil {
 		return nil
 	}
+
 	return ticketID(ticketResponse.ID)
 }
 
 func ticketID(ticketID int64) []driver.DocumentID {
 	id := fmt.Sprintf("%s/%d", database.TicketCollectionName, ticketID)
+
 	return []driver.DocumentID{driver.DocumentID(id)}
 }
 
@@ -31,6 +33,7 @@ func ticketIDs(ticketResponses []*model.TicketResponse) []driver.DocumentID {
 	for _, ticketResponse := range ticketResponses {
 		ids = append(ids, ticketID(ticketResponse.ID)...)
 	}
+
 	return ids
 }
 
@@ -63,6 +66,7 @@ func (s *Service) CreateTicket(ctx context.Context, form *model.TicketForm) (doc
 	if len(createdTickets) > 0 {
 		return createdTickets[0], err
 	}
+
 	return nil, err
 }
 
@@ -72,6 +76,7 @@ func (s *Service) CreateTicketBatch(ctx context.Context, ticketFormArray *model.
 	}
 	createdTickets, err := s.database.TicketBatchCreate(ctx, *ticketFormArray)
 	defer s.publishRequest(ctx, err, "CreateTicket", ticketIDs(createdTickets))
+
 	return err
 }
 
@@ -81,16 +86,19 @@ func (s *Service) GetTicket(ctx context.Context, i int64) (*model.TicketWithTick
 
 func (s *Service) UpdateTicket(ctx context.Context, i int64, ticket *model.Ticket) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "UpdateTicket", ticketWithTicketsID(doc))
+
 	return s.database.TicketUpdate(ctx, i, ticket)
 }
 
 func (s *Service) DeleteTicket(ctx context.Context, i int64) (err error) {
 	defer s.publishRequest(ctx, err, "DeleteTicket", ticketID(i))
+
 	return s.database.TicketDelete(ctx, i)
 }
 
 func (s *Service) AddArtifact(ctx context.Context, i int64, artifact *model.Artifact) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "AddArtifact", ticketWithTicketsID(doc))
+
 	return s.database.AddArtifact(ctx, i, artifact)
 }
 
@@ -100,16 +108,19 @@ func (s *Service) GetArtifact(ctx context.Context, i int64, s2 string) (*model.A
 
 func (s *Service) SetArtifact(ctx context.Context, i int64, s2 string, artifact *model.Artifact) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "SetArtifact", ticketWithTicketsID(doc))
+
 	return s.database.ArtifactUpdate(ctx, i, s2, artifact)
 }
 
 func (s *Service) RemoveArtifact(ctx context.Context, i int64, s2 string) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "RemoveArtifact", ticketWithTicketsID(doc))
+
 	return s.database.RemoveArtifact(ctx, i, s2)
 }
 
 func (s *Service) EnrichArtifact(ctx context.Context, i int64, s2 string, form *model.EnrichmentForm) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "EnrichArtifact", ticketWithTicketsID(doc))
+
 	return s.database.EnrichArtifact(ctx, i, s2, form)
 }
 
@@ -123,46 +134,55 @@ func (s *Service) RunArtifact(ctx context.Context, id int64, name string, automa
 
 	jobID := uuid.NewString()
 	origin := &model.Origin{ArtifactOrigin: &model.ArtifactOrigin{TicketId: id, Artifact: name}}
+
 	return s.bus.PublishJob(jobID, automation, map[string]string{"default": name}, &model.Context{Artifact: artifact}, origin)
 }
 
 func (s *Service) AddComment(ctx context.Context, i int64, form *model.CommentForm) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "AddComment", ticketWithTicketsID(doc))
+
 	return s.database.AddComment(ctx, i, form)
 }
 
 func (s *Service) RemoveComment(ctx context.Context, i int64, i2 int) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "RemoveComment", ticketWithTicketsID(doc))
+
 	return s.database.RemoveComment(ctx, i, int64(i2))
 }
 
 func (s *Service) AddTicketPlaybook(ctx context.Context, i int64, form *model.PlaybookTemplateForm) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "AddTicketPlaybook", ticketWithTicketsID(doc))
+
 	return s.database.AddTicketPlaybook(ctx, i, form)
 }
 
 func (s *Service) RemoveTicketPlaybook(ctx context.Context, i int64, s2 string) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "RemoveTicketPlaybook", ticketWithTicketsID(doc))
+
 	return s.database.RemoveTicketPlaybook(ctx, i, s2)
 }
 
-func (s *Service) SetTaskData(ctx context.Context, i int64, s3 string, s2 string, data map[string]interface{}) (doc *model.TicketWithTickets, err error) {
+func (s *Service) SetTaskData(ctx context.Context, i int64, s3 string, s2 string, data map[string]any) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "SetTask", ticketWithTicketsID(doc))
+
 	return s.database.TaskUpdateData(ctx, i, s3, s2, data)
 }
 
 func (s *Service) SetTaskOwner(ctx context.Context, i int64, s3 string, s2 string, owner string) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "SetTask", ticketWithTicketsID(doc))
+
 	return s.database.TaskUpdateOwner(ctx, i, s3, s2, owner)
 }
 
-func (s *Service) CompleteTask(ctx context.Context, i int64, s3 string, s2 string, m map[string]interface{}) (doc *model.TicketWithTickets, err error) {
+func (s *Service) CompleteTask(ctx context.Context, i int64, s3 string, s2 string, m map[string]any) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "CompleteTask", ticketWithTicketsID(doc))
+
 	return s.database.TaskComplete(ctx, i, s3, s2, m)
 }
 
 func (s *Service) RunTask(ctx context.Context, i int64, s3 string, s2 string) (err error) {
 	defer s.publishRequest(ctx, err, "RunTask", ticketID(i))
+
 	return s.database.TaskRun(ctx, i, s3, s2)
 }
 
@@ -171,11 +191,13 @@ func (s *Service) SetReferences(ctx context.Context, i int64, references *model.
 		return nil, &api.HTTPError{Status: http.StatusUnprocessableEntity, Internal: errors.New("no references given")}
 	}
 	defer s.publishRequest(ctx, err, "SetReferences", ticketID(i))
+
 	return s.database.SetReferences(ctx, i, *references)
 }
 
 func (s *Service) SetSchema(ctx context.Context, i int64, s2 string) (doc *model.TicketWithTickets, err error) {
 	defer s.publishRequest(ctx, err, "SetSchema", ticketID(i))
+
 	return s.database.SetTemplate(ctx, i, s2)
 }
 

service/tickettype.go

@@ -14,6 +14,7 @@ func ticketTypeResponseID(ticketType *model.TicketTypeResponse) []driver.Documen
 	if ticketType == nil {
 		return nil
 	}
+
 	return userDataID(ticketType.ID)
 }
 
@@ -27,6 +28,7 @@ func (s *Service) ListTicketTypes(ctx context.Context) ([]*model.TicketTypeRespo
 
 func (s *Service) CreateTicketType(ctx context.Context, form *model.TicketTypeForm) (doc *model.TicketTypeResponse, err error) {
 	defer s.publishRequest(ctx, err, "CreateTicketType", ticketTypeResponseID(doc))
+
 	return s.database.TicketTypeCreate(ctx, form)
 }
 
@@ -36,10 +38,12 @@ func (s *Service) GetTicketType(ctx context.Context, id string) (*model.TicketTy
 
 func (s *Service) UpdateTicketType(ctx context.Context, id string, form *model.TicketTypeForm) (doc *model.TicketTypeResponse, err error) {
 	defer s.publishRequest(ctx, err, "UpdateTicketType", ticketTypeResponseID(doc))
+
 	return s.database.TicketTypeUpdate(ctx, id, form)
 }
 
 func (s *Service) DeleteTicketType(ctx context.Context, id string) (err error) {
 	defer s.publishRequest(ctx, err, "DeleteTicketType", ticketTypeID(id))
+
 	return s.database.TicketTypeDelete(ctx, id)
 }

service/user.go

@@ -16,6 +16,7 @@ func newUserResponseID(user *model.NewUserResponse) []driver.DocumentID {
 	if user == nil {
 		return nil
 	}
+
 	return userID(user.ID)
 }
 
@@ -23,6 +24,7 @@ func userResponseID(user *model.UserResponse) []driver.DocumentID {
 	if user == nil {
 		return nil
 	}
+
 	return userID(user.ID)
 }
 
@@ -36,6 +38,7 @@ func (s *Service) ListUsers(ctx context.Context) ([]*model.UserResponse, error)
 
 func (s *Service) CreateUser(ctx context.Context, form *model.UserForm) (doc *model.NewUserResponse, err error) {
 	defer s.publishRequest(ctx, err, "CreateUser", newUserResponseID(doc))
+
 	return s.database.UserCreate(ctx, form)
 }
 
@@ -45,11 +48,13 @@ func (s *Service) GetUser(ctx context.Context, s2 string) (*model.UserResponse,
 
 func (s *Service) UpdateUser(ctx context.Context, s2 string, form *model.UserForm) (doc *model.UserResponse, err error) {
 	defer s.publishRequest(ctx, err, "UpdateUser", userID(s2))
+
 	return s.database.UserUpdate(ctx, s2, form)
 }
 
 func (s *Service) DeleteUser(ctx context.Context, s2 string) (err error) {
 	defer s.publishRequest(ctx, err, "DeleteUser", userID(s2))
+
 	return s.database.UserDelete(ctx, s2)
 }
 
@@ -59,5 +64,6 @@ func (s *Service) CurrentUser(ctx context.Context) (*model.UserResponse, error)
 		return nil, errors.New("no user in context")
 	}
 	s.publishRequest(ctx, nil, "CurrentUser", userResponseID(user))
+
 	return user, nil
 }

service/userdata.go

@@ -16,6 +16,7 @@ func userDataResponseID(userData *model.UserDataResponse) []driver.DocumentID {
 	if userData == nil {
 		return nil
 	}
+
 	return userDataID(userData.ID)
 }
 
@@ -33,6 +34,7 @@ func (s *Service) GetUserData(ctx context.Context, id string) (*model.UserDataRe
 
 func (s *Service) UpdateUserData(ctx context.Context, id string, data *model.UserData) (doc *model.UserDataResponse, err error) {
 	defer s.publishRequest(ctx, err, "CreateUser", userDataResponseID(doc))
+
 	return s.database.UserDataUpdate(ctx, id, data)
 }
 
@@ -52,5 +54,6 @@ func (s *Service) UpdateCurrentUserData(ctx context.Context, data *model.UserDat
 	}
 
 	defer s.publishRequest(ctx, err, "UpdateCurrentUserData", userDataResponseID(doc))
+
 	return s.database.UserDataUpdate(ctx, user.ID, data)
 }

storage/storage.go

@@ -1,6 +1,8 @@
 package storage
 
 import (
+	"errors"
+
 	"github.com/aws/aws-sdk-go/aws"
 	"github.com/aws/aws-sdk-go/aws/awserr"
 	"github.com/aws/aws-sdk-go/aws/credentials"
@@ -29,6 +31,7 @@ func New(config *Config) (*Storage, error) {
 		DisableSSL:       aws.Bool(true),
 		S3ForcePathStyle: aws.Bool(true),
 	})
+
 	return &Storage{s}, err
 }
 
@@ -39,17 +42,20 @@ func (s *Storage) S3() *s3.S3 {
 func (s *Storage) Downloader() *s3manager.Downloader {
 	d := s3manager.NewDownloader(s.session)
 	d.Concurrency = 1
+
 	return d
 }
 
 func (s *Storage) Uploader() *s3manager.Uploader {
 	d := s3manager.NewUploader(s.session)
 	d.Concurrency = 1
+
 	return d
 }
 
 func (s *Storage) DeleteBucket(name string) error {
 	_, err := s.S3().DeleteBucket(&s3.DeleteBucketInput{Bucket: pointer.String("catalyst-" + name)})
+
 	return err
 }
 
@@ -61,11 +67,13 @@ func CreateBucket(client *s3.S3, ticketID string) error {
 			return err
 		}
 	} else {
-		awsError, ok := err.(awserr.Error)
-		if !ok || (awsError.Code() != s3.ErrCodeBucketAlreadyExists && awsError.Code() != s3.ErrCodeBucketAlreadyOwnedByYou) {
-			return err
+		var awsError awserr.Error
+		if errors.As(err, &awsError) && (awsError.Code() == s3.ErrCodeBucketAlreadyExists || awsError.Code() == s3.ErrCodeBucketAlreadyOwnedByYou) {
+			return nil
 		}
-		return nil
+
+		return err
 	}
+
 	return err
 }

test/backup_test.go

@@ -25,6 +25,8 @@ import (
 )
 
 func TestBackupAndRestore(t *testing.T) {
+	t.Parallel()
+
 	log.SetFlags(log.LstdFlags | log.Lshortfile)
 
 	if runtime.GOARCH == "arm64" {
@@ -41,7 +43,10 @@ func TestBackupAndRestore(t *testing.T) {
 		{name: "Backup", want: want{status: http.StatusOK}},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			ctx, _, server, err := Catalyst(t)
 			if err != nil {
 				t.Fatal(err)
@@ -75,6 +80,8 @@ func TestBackupAndRestore(t *testing.T) {
 }
 
 func assertBackup(t *testing.T, server *catalyst.Server) []byte {
+	t.Helper()
+
 	// setup request
 	req := httptest.NewRequest(http.MethodGet, "/api/backup/create", nil)
 	req.Header.Set("PRIVATE-TOKEN", "test")
@@ -97,6 +104,8 @@ func assertBackup(t *testing.T, server *catalyst.Server) []byte {
 }
 
 func assertZipFile(t *testing.T, r *zip.Reader) {
+	t.Helper()
+
 	var names []string
 	for _, f := range r.File {
 		names = append(names, f.Name)
@@ -120,9 +129,11 @@ func clearAllDatabases(server *catalyst.Server) {
 }
 
 func deleteAllBuckets(t *testing.T, server *catalyst.Server) {
+	t.Helper()
+
 	buckets, err := server.Storage.S3().ListBuckets(&s3.ListBucketsInput{})
 	for _, bucket := range buckets.Buckets {
-		server.Storage.S3().DeleteBucket(&s3.DeleteBucketInput{
+		_, _ = server.Storage.S3().DeleteBucket(&s3.DeleteBucketInput{
 			Bucket: bucket.Name,
 		})
 	}
@@ -133,6 +144,8 @@ func deleteAllBuckets(t *testing.T, server *catalyst.Server) {
 }
 
 func assertRestore(t *testing.T, zipB []byte, server *catalyst.Server) {
+	t.Helper()
+
 	bodyBuf := &bytes.Buffer{}
 	bodyWriter := multipart.NewWriter(bodyBuf)
 	fileWriter, err := bodyWriter.CreateFormFile("backup", "backup.zip")
@@ -166,7 +179,7 @@ func assertRestore(t *testing.T, zipB []byte, server *catalyst.Server) {
 func createFile(ctx context.Context, server *catalyst.Server) {
 	buf := bytes.NewBufferString("test text")
 
-	server.Storage.S3().CreateBucket(&s3.CreateBucketInput{Bucket: pointer.String("catalyst-8125")})
+	_, _ = server.Storage.S3().CreateBucket(&s3.CreateBucketInput{Bucket: pointer.String("catalyst-8125")})
 
 	if _, err := server.Storage.Uploader().Upload(&s3manager.UploadInput{Body: buf, Bucket: pointer.String("catalyst-8125"), Key: pointer.String("test.txt")}); err != nil {
 		log.Fatal(err)
@@ -178,6 +191,8 @@ func createFile(ctx context.Context, server *catalyst.Server) {
 }
 
 func assertTicketExists(t *testing.T, server *catalyst.Server) {
+	t.Helper()
+
 	req := httptest.NewRequest(http.MethodGet, "/api/tickets/8125", nil)
 	req.Header.Set("PRIVATE-TOKEN", "test")
 
@@ -202,6 +217,8 @@ func assertTicketExists(t *testing.T, server *catalyst.Server) {
 }
 
 func assertFileExists(t *testing.T, server *catalyst.Server) {
+	t.Helper()
+
 	obj, err := server.Storage.S3().GetObject(&s3.GetObjectInput{
 		Bucket: aws.String("catalyst-8125"),
 		Key:    aws.String("test.txt"),
@@ -215,6 +232,8 @@ func assertFileExists(t *testing.T, server *catalyst.Server) {
 }
 
 func includes(t *testing.T, names []string, s string) bool {
+	t.Helper()
+
 	for _, name := range names {
 		match, err := regexp.MatchString(s, name)
 		if err != nil {
@@ -225,10 +244,13 @@ func includes(t *testing.T, names []string, s string) bool {
 			return true
 		}
 	}
+
 	return false
 }
 
 func readZipFile(t *testing.T, b []byte) *zip.Reader {
+	t.Helper()
+
 	buf := bytes.NewReader(b)
 
 	zr, err := zip.NewReader(buf, int64(buf.Len()))

test/data.go

@@ -10,9 +10,11 @@ import (
 	"github.com/SecurityBrewery/catalyst/generated/pointer"
 )
 
-var bobSetting = &model.UserData{Email: pointer.String("bob@example.org"), Name: pointer.String("Bob Bad")}
-var bobForm = &model.UserForm{ID: "bob", Blocked: false, Roles: []string{"admin"}}
-var Bob = &model.UserResponse{ID: "bob", Blocked: false, Roles: []string{"admin"}}
+var (
+	bobSetting = &model.UserData{Email: pointer.String("bob@example.org"), Name: pointer.String("Bob Bad")}
+	bobForm    = &model.UserForm{ID: "bob", Blocked: false, Roles: []string{"admin"}}
+	Bob        = &model.UserResponse{ID: "bob", Blocked: false, Roles: []string{"admin"}}
+)
 
 func SetupTestData(ctx context.Context, db *database.Database) error {
 	if err := db.UserDataCreate(ctx, "bob", bobSetting); err != nil {
@@ -109,5 +111,6 @@ func parse(s string) *time.Time {
 	}
 
 	utc := modified.UTC()
+
 	return &utc
 }

test/job_test.go

@@ -18,6 +18,8 @@ import (
 )
 
 func TestJob(t *testing.T) {
+	t.Parallel()
+
 	log.SetFlags(log.LstdFlags | log.Lshortfile)
 
 	_, _, server, err := Catalyst(t)
@@ -27,7 +29,7 @@ func TestJob(t *testing.T) {
 
 	b, err := json.Marshal(model.JobForm{
 		Automation: "hash.sha1",
-		Payload:    map[string]interface{}{"default": "test"},
+		Payload:    map[string]any{"default": "test"},
 	})
 	if err != nil {
 		t.Fatal(err)
@@ -52,11 +54,14 @@ func TestJob(t *testing.T) {
 
 		output := gjson.GetBytes(job, "output.hash").String()
 		assert.Equal(t, "a94a8fe5ccb19ba61c4c0873d391e987982fbbd3", output)
+
 		break
 	}
 }
 
 func request(t *testing.T, server chi.Router, method, url string, data io.Reader) []byte {
+	t.Helper()
+
 	w := httptest.NewRecorder()
 
 	// setup request

test/server_test.go

@@ -25,10 +25,15 @@ func (testClock) Now() time.Time {
 }
 
 func TestServer(t *testing.T) {
+	t.Parallel()
+
 	ctime.DefaultClock = testClock{}
 
 	for _, tt := range api.Tests {
+		tt := tt
 		t.Run(tt.Name, func(t *testing.T) {
+			t.Parallel()
+
 			ctx, _, _, _, _, db, _, server, cleanup, err := Server(t)
 			if err != nil {
 				t.Fatal(err)
@@ -73,8 +78,10 @@ func TestServer(t *testing.T) {
 	}
 }
 
-func jsonEqual(t *testing.T, name string, got io.Reader, want interface{}) {
-	var gotObject, wantObject interface{}
+func jsonEqual(t *testing.T, name string, got io.Reader, want any) {
+	t.Helper()
+
+	var gotObject, wantObject any
 
 	// load bytes
 	wantBytes, err := json.Marshal(want)

test/test.go

@@ -75,6 +75,8 @@ func Config(ctx context.Context) (*catalyst.Config, error) {
 }
 
 func Index(t *testing.T) (*index.Index, func(), error) {
+	t.Helper()
+
 	dir, err := os.MkdirTemp("", "catalyst-test-"+cleanName(t))
 	if err != nil {
 		return nil, nil, err
@@ -84,10 +86,13 @@ func Index(t *testing.T) (*index.Index, func(), error) {
 	if err != nil {
 		return nil, nil, err
 	}
+
 	return catalystIndex, func() { catalystIndex.Close(); os.RemoveAll(dir) }, nil
 }
 
 func Bus(t *testing.T) (context.Context, *catalyst.Config, *bus.Bus, error) {
+	t.Helper()
+
 	ctx := Context()
 
 	config, err := Config(ctx)
@@ -99,10 +104,13 @@ func Bus(t *testing.T) (context.Context, *catalyst.Config, *bus.Bus, error) {
 	if err != nil {
 		t.Fatal(err)
 	}
+
 	return ctx, config, catalystBus, err
 }
 
 func DB(t *testing.T) (context.Context, *catalyst.Config, *bus.Bus, *index.Index, *storage.Storage, *database.Database, func(), error) {
+	t.Helper()
+
 	ctx, config, rbus, err := Bus(t)
 	if err != nil {
 		return nil, nil, nil, nil, nil, nil, nil, err
@@ -146,6 +154,8 @@ func DB(t *testing.T) (context.Context, *catalyst.Config, *bus.Bus, *index.Index
 }
 
 func Service(t *testing.T) (context.Context, *catalyst.Config, *bus.Bus, *index.Index, *storage.Storage, *database.Database, *service.Service, func(), error) {
+	t.Helper()
+
 	ctx, config, rbus, catalystIndex, catalystStorage, db, cleanup, err := DB(t)
 	if err != nil {
 		t.Fatal(err)
@@ -160,6 +170,8 @@ func Service(t *testing.T) (context.Context, *catalyst.Config, *bus.Bus, *index.
 }
 
 func Server(t *testing.T) (context.Context, *catalyst.Config, *bus.Bus, *index.Index, *storage.Storage, *database.Database, *service.Service, chi.Router, func(), error) {
+	t.Helper()
+
 	ctx, config, rbus, catalystIndex, catalystStorage, db, catalystService, cleanup, err := Service(t)
 	if err != nil {
 		t.Fatal(err)
@@ -177,6 +189,8 @@ func Server(t *testing.T) (context.Context, *catalyst.Config, *bus.Bus, *index.I
 }
 
 func Catalyst(t *testing.T) (context.Context, *catalyst.Config, *catalyst.Server, error) {
+	t.Helper()
+
 	ctx := Context()
 
 	config, err := Config(ctx)
@@ -189,13 +203,17 @@ func Catalyst(t *testing.T) (context.Context, *catalyst.Config, *catalyst.Server
 	c, err := catalyst.New(&hooks.Hooks{
 		DatabaseAfterConnectFuncs: []func(ctx context.Context, client driver.Client, name string){Clear},
 	}, config)
+
 	return ctx, config, c, err
 }
 
 func cleanName(t *testing.T) string {
+	t.Helper()
+
 	name := t.Name()
 	name = strings.ReplaceAll(name, " ", "")
 	name = strings.ReplaceAll(name, "/", "_")
+
 	return strings.ReplaceAll(name, "#", "_")
 }
 

test/user_test.go

@@ -9,14 +9,16 @@ import (
 )
 
 func TestUser(t *testing.T) {
+	t.Parallel()
+
 	type args struct {
 		method string
 		url    string
-		data   interface{}
+		data   any
 	}
 	type want struct {
 		status int
-		body   interface{}
+		body   any
 	}
 	tests := []struct {
 		name string
@@ -27,7 +29,10 @@ func TestUser(t *testing.T) {
 		{name: "ListUsers", args: args{method: http.MethodGet, url: "/users"}, want: want{status: http.StatusOK}},
 	}
 	for _, tt := range tests {
+		tt := tt
 		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
 			_, _, _, _, _, _, _, server, cleanup, err := Server(t)
 			if err != nil {
 				t.Fatal(err)

ui/ui_test.go

@@ -3,15 +3,23 @@ package ui
 import "testing"
 
 func TestUI(t *testing.T) {
-	requiredFiles := []string{
-		"dist/index.html",
-		"dist/favicon.ico",
-		"dist/manifest.json",
-		"dist/img",
+	t.Parallel()
+
+	tests := []struct {
+		name string
+		path string
+	}{
+		{"index.html", "dist/index.html"},
+		{"favicon.ico", "dist/favicon.ico"},
+		{"manifest.json", "dist/manifest.json"},
+		{"img", "dist/img"},
 	}
-	for _, requiredFile := range requiredFiles {
-		t.Run("Require "+requiredFile, func(t *testing.T) {
-			f, err := UI.Open(requiredFile)
+	for _, tt := range tests {
+		tt := tt
+		t.Run(tt.name, func(t *testing.T) {
+			t.Parallel()
+
+			f, err := UI.Open(tt.path)
 			if err != nil {
 				t.Fatal(err)
 			}

websocket.go

@@ -41,6 +41,7 @@ func (wb *websocketBroker) NewWebsocket() (string, chan []byte) {
 	wb.mu.Lock()
 	wb.clients[id] = channel
 	wb.mu.Unlock()
+
 	return id, channel
 }
 
@@ -49,7 +50,7 @@ func handleWebSocket(catalystBus *bus.Bus) http.HandlerFunc {
 
 	// send all messages from bus to websocket
 	err := catalystBus.SubscribeDatabaseUpdate(func(msg *bus.DatabaseUpdateMsg) {
-		b, err := json.Marshal(map[string]interface{}{
+		b, err := json.Marshal(map[string]any{
 			"action": "update",
 			"ids":    msg.IDs,
 		})
@@ -67,6 +68,7 @@ func handleWebSocket(catalystBus *bus.Bus) http.HandlerFunc {
 		conn, _, _, err := ws.UpgradeHTTP(r, w)
 		if err != nil {
 			api.JSONError(w, errors.New("upgrade failed"))
+
 			return
 		}