package caql import ( "fmt" "strconv" "strings" "github.com/SecurityBrewery/catalyst/generated/caql/parser" ) type aqlInterpreter struct { *parser.BaseCAQLParserListener values map[string]any stack []any errs []error } // push is a helper function for pushing new node to the listener Stack. func (s *aqlInterpreter) push(i any) { s.stack = append(s.stack, i) } // pop is a helper function for poping a node from the listener Stack. func (s *aqlInterpreter) pop() (n any) { // Check that we have nodes in the stack. size := len(s.stack) if size < 1 { s.appendErrors(ErrStack) return } // Pop the last value from the Stack. n, s.stack = s.stack[size-1], s.stack[:size-1] return } func (s *aqlInterpreter) binaryPop() (any, any) { right, left := s.pop(), s.pop() return left, right } // ExitExpression is called when production expression is exited. func (s *aqlInterpreter) ExitExpression(ctx *parser.ExpressionContext) { switch { case ctx.Value_literal() != nil: // pass case ctx.Reference() != nil: // pass case ctx.Operator_unary() != nil: // pass case ctx.T_PLUS() != nil: s.push(plus(s.binaryPop())) case ctx.T_MINUS() != nil: s.push(minus(s.binaryPop())) case ctx.T_TIMES() != nil: s.push(times(s.binaryPop())) case ctx.T_DIV() != nil: s.push(div(s.binaryPop())) case ctx.T_MOD() != nil: s.push(mod(s.binaryPop())) case ctx.T_RANGE() != nil: s.push(aqlrange(s.binaryPop())) case ctx.T_LT() != nil && ctx.GetEq_op() == nil: s.push(lt(s.binaryPop())) case ctx.T_GT() != nil && ctx.GetEq_op() == nil: s.push(gt(s.binaryPop())) case ctx.T_LE() != nil && ctx.GetEq_op() == nil: s.push(le(s.binaryPop())) case ctx.T_GE() != nil && ctx.GetEq_op() == nil: s.push(ge(s.binaryPop())) case ctx.T_IN() != nil && ctx.GetEq_op() == nil: s.push(maybeNot(ctx, in(s.binaryPop()))) case ctx.T_EQ() != nil && ctx.GetEq_op() == nil: s.push(eq(s.binaryPop())) case ctx.T_NE() != nil && ctx.GetEq_op() == nil: s.push(ne(s.binaryPop())) case ctx.T_ALL() != nil && ctx.GetEq_op() != nil: right, left := s.pop(), s.pop() s.push(all(left.([]any), getOp(ctx.GetEq_op().GetTokenType()), right)) case ctx.T_ANY() != nil && ctx.GetEq_op() != nil: right, left := s.pop(), s.pop() s.push(anyElement(left.([]any), getOp(ctx.GetEq_op().GetTokenType()), right)) case ctx.T_NONE() != nil && ctx.GetEq_op() != nil: right, left := s.pop(), s.pop() s.push(none(left.([]any), getOp(ctx.GetEq_op().GetTokenType()), right)) case ctx.T_ALL() != nil && ctx.T_NOT() != nil && ctx.T_IN() != nil: right, left := s.pop(), s.pop() s.push(all(left.([]any), in, right)) case ctx.T_ANY() != nil && ctx.T_NOT() != nil && ctx.T_IN() != nil: right, left := s.pop(), s.pop() s.push(anyElement(left.([]any), in, right)) case ctx.T_NONE() != nil && ctx.T_NOT() != nil && ctx.T_IN() != nil: right, left := s.pop(), s.pop() s.push(none(left.([]any), in, right)) case ctx.T_LIKE() != nil: m, err := like(s.binaryPop()) s.appendErrors(err) s.push(maybeNot(ctx, m)) case ctx.T_REGEX_MATCH() != nil: m, err := regexMatch(s.binaryPop()) s.appendErrors(err) s.push(maybeNot(ctx, m)) case ctx.T_REGEX_NON_MATCH() != nil: m, err := regexNonMatch(s.binaryPop()) s.appendErrors(err) s.push(maybeNot(ctx, m)) case ctx.T_AND() != nil: s.push(and(s.binaryPop())) case ctx.T_OR() != nil: s.push(or(s.binaryPop())) case ctx.T_QUESTION() != nil && len(ctx.AllExpression()) == 3: right, middle, left := s.pop(), s.pop(), s.pop() s.push(ternary(left, middle, right)) case ctx.T_QUESTION() != nil && len(ctx.AllExpression()) == 2: right, left := s.pop(), s.pop() s.push(ternary(left, nil, right)) default: panic("unknown expression") } } func (s *aqlInterpreter) appendErrors(err error) { if err != nil { s.errs = append(s.errs, err) } } // ExitOperator_unary is called when production operator_unary is exited. func (s *aqlInterpreter) ExitOperator_unary(ctx *parser.Operator_unaryContext) { value := s.pop() switch { case ctx.T_PLUS() != nil: s.push(value.(float64)) case ctx.T_MINUS() != nil: s.push(-value.(float64)) case ctx.T_NOT() != nil: s.push(!toBool(value)) default: panic(fmt.Sprintf("unexpected operation: %s", ctx.GetText())) } } // ExitReference is called when production reference is exited. func (s *aqlInterpreter) ExitReference(ctx *parser.ReferenceContext) { switch { case ctx.DOT() != nil: reference := s.pop() s.push(reference.(map[string]any)[ctx.T_STRING().GetText()]) case ctx.T_STRING() != nil: s.push(s.getVar(ctx.T_STRING().GetText())) case ctx.Compound_value() != nil: // pass case ctx.Function_call() != nil: // pass case ctx.T_OPEN() != nil: // pass case ctx.T_ARRAY_OPEN() != nil: key := s.pop() reference := s.pop() if f, ok := key.(float64); ok { index := int(f) if index < 0 { index = len(reference.([]any)) + index } s.push(reference.([]any)[index]) return } s.push(reference.(map[string]any)[key.(string)]) default: panic(fmt.Sprintf("unexpected value: %s", ctx.GetText())) } } // ExitCompound_value is called when production compound_value is exited. func (s *aqlInterpreter) ExitCompound_value(ctx *parser.Compound_valueContext) { // pass } // ExitFunction_call is called when production function_call is exited. func (s *aqlInterpreter) ExitFunction_call(ctx *parser.Function_callContext) { s.function(ctx) } // ExitValue_literal is called when production value_literal is exited. func (s *aqlInterpreter) ExitValue_literal(ctx *parser.Value_literalContext) { switch { case ctx.T_QUOTED_STRING() != nil: st, err := unquote(ctx.GetText()) s.appendErrors(err) s.push(st) case ctx.T_INT() != nil: t := ctx.GetText() switch { case strings.HasPrefix(strings.ToLower(t), "0b"): i64, err := strconv.ParseInt(t[2:], 2, 64) s.appendErrors(err) s.push(float64(i64)) case strings.HasPrefix(strings.ToLower(t), "0x"): i64, err := strconv.ParseInt(t[2:], 16, 64) s.appendErrors(err) s.push(float64(i64)) default: i, err := strconv.Atoi(t) s.appendErrors(err) s.push(float64(i)) } case ctx.T_FLOAT() != nil: i, err := strconv.ParseFloat(ctx.GetText(), 64) s.appendErrors(err) s.push(i) case ctx.T_NULL() != nil: s.push(nil) case ctx.T_TRUE() != nil: s.push(true) case ctx.T_FALSE() != nil: s.push(false) default: panic(fmt.Sprintf("unexpected value: %s", ctx.GetText())) } } // ExitArray is called when production array is exited. func (s *aqlInterpreter) ExitArray(ctx *parser.ArrayContext) { array := []any{} for range ctx.AllExpression() { // prepend element array = append([]any{s.pop()}, array...) } s.push(array) } // ExitObject is called when production object is exited. func (s *aqlInterpreter) ExitObject(ctx *parser.ObjectContext) { object := map[string]any{} for range ctx.AllObject_element() { key, value := s.pop(), s.pop() object[key.(string)] = value } s.push(object) } // ExitObject_element is called when production object_element is exited. func (s *aqlInterpreter) ExitObject_element(ctx *parser.Object_elementContext) { switch { case ctx.T_STRING() != nil: s.push(ctx.GetText()) s.push(s.getVar(ctx.GetText())) case ctx.Object_element_name() != nil, ctx.T_ARRAY_OPEN() != nil: key, value := s.pop(), s.pop() s.push(key) s.push(value) default: panic(fmt.Sprintf("unexpected value: %s", ctx.GetText())) } } // ExitObject_element_name is called when production object_element_name is exited. func (s *aqlInterpreter) ExitObject_element_name(ctx *parser.Object_element_nameContext) { switch { case ctx.T_STRING() != nil: s.push(ctx.T_STRING().GetText()) case ctx.T_QUOTED_STRING() != nil: st, err := unquote(ctx.T_QUOTED_STRING().GetText()) if err != nil { s.appendErrors(fmt.Errorf("%w: %s", err, ctx.GetText())) } s.push(st) default: panic(fmt.Sprintf("unexpected value: %s", ctx.GetText())) } } func (s *aqlInterpreter) getVar(identifier string) any { v, ok := s.values[identifier] if !ok { s.appendErrors(ErrUndefined) } return v } func maybeNot(ctx *parser.ExpressionContext, m bool) bool { if ctx.T_NOT() != nil { return !m } return m } func getOp(tokenType int) func(left, right any) bool { switch tokenType { case parser.CAQLLexerT_EQ: return eq case parser.CAQLLexerT_NE: return ne case parser.CAQLLexerT_LT: return lt case parser.CAQLLexerT_GT: return gt case parser.CAQLLexerT_LE: return le case parser.CAQLLexerT_GE: return ge case parser.CAQLLexerT_IN: return in default: panic("unknown token type") } } func all(slice []any, op func(any, any) bool, expr any) bool { for _, e := range slice { if !op(e, expr) { return false } } return true } func anyElement(slice []any, op func(any, any) bool, expr any) bool { for _, e := range slice { if op(e, expr) { return true } } return false } func none(slice []any, op func(any, any) bool, expr any) bool { for _, e := range slice { if op(e, expr) { return false } } return true }